From 40655b4cb3f43417ee32c362a85090821c6507d2 Mon Sep 17 00:00:00 2001 From: Gabe Rodriguez Date: Tue, 10 Mar 2026 12:59:14 +0100 Subject: [PATCH 1/2] Bump program deps to use 3.0 interface --- Cargo.lock | 2658 +++++++++++++++++++--------- program/Cargo.toml | 28 +- program/tests/interface.rs | 55 +- program/tests/program_test.rs | 41 +- program/tests/stake_instruction.rs | 67 +- 5 files changed, 1949 insertions(+), 900 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index fc510e6b..083f06f8 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -3,12 +3,13 @@ version = 4 [[package]] -name = "addr2line" -version = "0.24.2" +name = "Inflector" +version = "0.11.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dfbe277e56a376000877090da837660b4427aad530e3028d44e0bffe4f89a1c1" +checksum = "fe438c63458706e03479442743baae6c88256498e6431708f6dfc520a26515d3" dependencies = [ - "gimli", + "lazy_static", + "regex", ] [[package]] @@ -53,25 +54,68 @@ dependencies = [ "zeroize", ] +[[package]] +name = "agave-bls12-381" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "81bf808e8730d257620d4771898cb7fe975fe8071c54b90ee24e593fd3eeb4dc" +dependencies = [ + "blst", + "blstrs", + "bytemuck", + "bytemuck_derive", + "group", + "pairing", +] + [[package]] name = "agave-feature-set" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "be80c9787c7f30819e2999987cc6208c1ec6f775d7ed2b70f61a00a6e8acc0c8" +checksum = "0684f4e5500a461664d83fb42cddd10b66cd9dfca611271306d617c322b7827a" dependencies = [ - "ahash 0.8.11", + "ahash 0.8.12", "solana-epoch-schedule", "solana-hash 3.1.0", "solana-pubkey 3.0.0", "solana-sha256-hasher", - "solana-svm-feature-set", + "solana-svm-feature-set 3.1.3", +] + +[[package]] +name = "agave-feature-set" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e8d0e133f3c7823314d593050285b78bd51c50abb1b3467a780f708d72309701" +dependencies = [ + "ahash 0.8.12", + "solana-epoch-schedule", + "solana-hash 4.2.0", + "solana-keypair", + "solana-pubkey 4.1.0", + "solana-sha256-hasher", + "solana-svm-feature-set 4.0.0-beta.1", +] + +[[package]] +name = "agave-fs" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4eec5c4629a3456f4ec3d2652177c1595ba80927d0a0a1e4e17c7858963674f0" +dependencies = [ + "agave-io-uring", + "io-uring", + "libc", + "log", + "slab", + "smallvec", ] [[package]] name = "agave-io-uring" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "81f299d8f456e09697966c084619935966c8e0cab4cb2aaf6529f80bd2e359c7" +checksum = "258c297190e6da4ec3c334bbf04732749692660d3b93f20930e592d7b811993d" dependencies = [ "io-uring", "libc", @@ -80,13 +124,25 @@ dependencies = [ "smallvec", ] +[[package]] +name = "agave-logger" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e65de0fcc4e60bfc95caeabae773c4082a4cf768a47326e2ad9f07532e8cea1d" +dependencies = [ + "env_logger", + "libc", + "log", + "signal-hook", +] + [[package]] name = "agave-precompiles" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c4a1a2453f1454c71842928844613289c9d6869ea46faaa30e7c7649e432a429" +checksum = "28701885014b411b29369a0061b8af72eab5bd2280e40f399ceb33e52a1b0d68" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "bincode", "digest 0.10.7", "ed25519-dalek 1.0.1", @@ -104,72 +160,160 @@ dependencies = [ [[package]] name = "agave-reserved-account-keys" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "efb2704410f79989956488f49d6f48fcc4f66e2e6c11d8b5f40e0e01bfbd6b91" +checksum = "25afbc01a53fa48ef788618d924ff403bceac3740c186257eec76bf5ffdf17cd" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "solana-pubkey 3.0.0", "solana-sdk-ids", ] +[[package]] +name = "agave-snapshots" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fb9e9323670f5f83063fb645f133404c57d1eeebef35eea029d23ec745987083" +dependencies = [ + "agave-fs", + "bincode", + "bzip2", + "crossbeam-channel", + "log", + "lz4", + "rand 0.8.5", + "regex", + "semver", + "solana-accounts-db", + "solana-clock", + "solana-genesis-config", + "solana-hash 3.1.0", + "solana-lattice-hash", + "solana-measure", + "solana-metrics", + "strum 0.24.1", + "symlink", + "tar", + "tempfile", + "thiserror 2.0.18", + "zstd", +] + [[package]] name = "agave-syscalls" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a8605fba7ba3e97426ab19179d565a7cd9d6b5566ff49004784c99e302ac7953" +checksum = "776409f32d798250aa57e4a0e8e19cc3b5c477fbce2c3ae309f69160470f3e2b" dependencies = [ "bincode", "libsecp256k1", "num-traits", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-account-info", "solana-big-mod-exp", "solana-blake3-hasher", "solana-bn254", "solana-clock", "solana-cpi", - "solana-curve25519", + "solana-curve25519 3.1.3", "solana-hash 3.1.0", "solana-instruction", "solana-keccak-hasher", "solana-loader-v3-interface", - "solana-poseidon", + "solana-poseidon 3.1.3", "solana-program-entrypoint", - "solana-program-runtime", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", - "solana-sbpf", + "solana-sbpf 0.13.1", + "solana-sdk-ids", + "solana-secp256k1-recover", + "solana-sha256-hasher", + "solana-stable-layout", + "solana-stake-interface 2.0.2", + "solana-svm-callback 3.1.3", + "solana-svm-feature-set 3.1.3", + "solana-svm-log-collector 3.1.3", + "solana-svm-measure 3.1.3", + "solana-svm-timings 3.1.3", + "solana-svm-type-overrides 3.1.3", + "solana-sysvar 3.1.1", + "solana-sysvar-id", + "solana-transaction-context 3.1.3", + "thiserror 2.0.18", +] + +[[package]] +name = "agave-syscalls" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "06cc6dfe3f1849b6ac7d3fea7bd2bdd8f3de2951bf71f87514961d74fb7e5e06" +dependencies = [ + "agave-bls12-381", + "bincode", + "libsecp256k1", + "num-traits", + "solana-account 3.4.0", + "solana-account-info", + "solana-big-mod-exp", + "solana-blake3-hasher", + "solana-bn254", + "solana-clock", + "solana-cpi", + "solana-curve25519 4.0.0", + "solana-hash 4.2.0", + "solana-instruction", + "solana-keccak-hasher", + "solana-loader-v3-interface", + "solana-poseidon 4.0.0", + "solana-program-entrypoint", + "solana-program-runtime 4.0.0-beta.1", + "solana-pubkey 4.1.0", + "solana-sbpf 0.14.4", "solana-sdk-ids", "solana-secp256k1-recover", "solana-sha256-hasher", "solana-stable-layout", - "solana-stake-interface 2.0.1", - "solana-svm-callback", - "solana-svm-feature-set", - "solana-svm-log-collector", - "solana-svm-measure", - "solana-svm-timings", - "solana-svm-type-overrides", - "solana-sysvar 3.0.0", + "solana-stake-interface 2.0.2", + "solana-svm-callback 4.0.0-beta.1", + "solana-svm-feature-set 4.0.0-beta.1", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-svm-measure 4.0.0-beta.1", + "solana-svm-timings 4.0.0-beta.1", + "solana-svm-type-overrides 4.0.0-beta.1", + "solana-sysvar 3.1.1", "solana-sysvar-id", - "solana-transaction-context", + "solana-transaction-context 4.0.0-beta.1", "thiserror 2.0.18", ] [[package]] name = "agave-transaction-view" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d04daeab9de8d1098156d2a73ec5e8dd019b628884c201e5af3f1e8baeffd1b0" +checksum = "92e9045a5df9d3c4d2b653edc5a90217614a74c9b461cf01e1759ab3d99225c4" dependencies = [ "solana-hash 3.1.0", "solana-message", - "solana-packet", + "solana-packet 3.0.0", "solana-pubkey 3.0.0", "solana-sdk-ids", "solana-short-vec", "solana-signature", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", + "solana-transaction-context 3.1.3", +] + +[[package]] +name = "agave-votor-messages" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c06742ec361aac1cff6dd1133b218f0edf60462de4b5b1a0cacf3f831ff1c726" +dependencies = [ + "agave-logger", + "serde", + "solana-bls-signatures 1.0.0", + "solana-clock", + "solana-hash 3.1.0", ] [[package]] @@ -185,15 +329,15 @@ dependencies = [ [[package]] name = "ahash" -version = "0.8.11" +version = "0.8.12" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e89da841a80418a9b391ebaea17f5c112ffaaa96f621d2c285b5174da76b9011" +checksum = "5a15f179cd60c4584b8a8c596927aadc462e27f2ca70c04e0071964a73ba7a75" dependencies = [ "cfg-if", - "getrandom 0.2.15", + "getrandom 0.3.1", "once_cell", "version_check", - "zerocopy", + "zerocopy 0.8.42", ] [[package]] @@ -220,6 +364,12 @@ dependencies = [ "alloc-no-stdlib", ] +[[package]] +name = "allocator-api2" +version = "0.2.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "683d7910e743518b0e34f1186f92494becacb047c7b6bf616c96772180fef923" + [[package]] name = "android-tzdata" version = "0.1.1" @@ -326,9 +476,20 @@ version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a22f4561524cd949590d78d7d4c5df8f592430d221f7f3c9497bbafd8972120f" dependencies = [ - "ark-ec", - "ark-ff", - "ark-std", + "ark-ec 0.4.2", + "ark-ff 0.4.2", + "ark-std 0.4.0", +] + +[[package]] +name = "ark-bn254" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d69eab57e8d2663efa5c63135b2af4f396d66424f88954c21104125ab6b3e6bc" +dependencies = [ + "ark-ec 0.5.0", + "ark-ff 0.5.0", + "ark-std 0.5.0", ] [[package]] @@ -337,10 +498,10 @@ version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "defd9a439d56ac24968cca0571f598a61bc8c55f71d50a89cda591cb750670ba" dependencies = [ - "ark-ff", - "ark-poly", - "ark-serialize", - "ark-std", + "ark-ff 0.4.2", + "ark-poly 0.4.2", + "ark-serialize 0.4.2", + "ark-std 0.4.0", "derivative", "hashbrown 0.13.2", "itertools 0.10.5", @@ -348,16 +509,37 @@ dependencies = [ "zeroize", ] +[[package]] +name = "ark-ec" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "43d68f2d516162846c1238e755a7c4d131b892b70cc70c471a8e3ca3ed818fce" +dependencies = [ + "ahash 0.8.12", + "ark-ff 0.5.0", + "ark-poly 0.5.0", + "ark-serialize 0.5.0", + "ark-std 0.5.0", + "educe 0.6.0", + "fnv", + "hashbrown 0.15.2", + "itertools 0.13.0", + "num-bigint 0.4.6", + "num-integer", + "num-traits", + "zeroize", +] + [[package]] name = "ark-ff" version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ec847af850f44ad29048935519032c33da8aa03340876d351dfab5660d2966ba" dependencies = [ - "ark-ff-asm", - "ark-ff-macros", - "ark-serialize", - "ark-std", + "ark-ff-asm 0.4.2", + "ark-ff-macros 0.4.2", + "ark-serialize 0.4.2", + "ark-std 0.4.0", "derivative", "digest 0.10.7", "itertools 0.10.5", @@ -368,6 +550,26 @@ dependencies = [ "zeroize", ] +[[package]] +name = "ark-ff" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a177aba0ed1e0fbb62aa9f6d0502e9b46dad8c2eab04c14258a1212d2557ea70" +dependencies = [ + "ark-ff-asm 0.5.0", + "ark-ff-macros 0.5.0", + "ark-serialize 0.5.0", + "ark-std 0.5.0", + "arrayvec", + "digest 0.10.7", + "educe 0.6.0", + "itertools 0.13.0", + "num-bigint 0.4.6", + "num-traits", + "paste", + "zeroize", +] + [[package]] name = "ark-ff-asm" version = "0.4.2" @@ -378,6 +580,16 @@ dependencies = [ "syn 1.0.109", ] +[[package]] +name = "ark-ff-asm" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62945a2f7e6de02a31fe400aa489f0e0f5b2502e69f95f853adb82a96c7a6b60" +dependencies = [ + "quote", + "syn 2.0.114", +] + [[package]] name = "ark-ff-macros" version = "0.4.2" @@ -391,27 +603,68 @@ dependencies = [ "syn 1.0.109", ] +[[package]] +name = "ark-ff-macros" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09be120733ee33f7693ceaa202ca41accd5653b779563608f1234f78ae07c4b3" +dependencies = [ + "num-bigint 0.4.6", + "num-traits", + "proc-macro2", + "quote", + "syn 2.0.114", +] + [[package]] name = "ark-poly" version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d320bfc44ee185d899ccbadfa8bc31aab923ce1558716e1997a1e74057fe86bf" dependencies = [ - "ark-ff", - "ark-serialize", - "ark-std", + "ark-ff 0.4.2", + "ark-serialize 0.4.2", + "ark-std 0.4.0", "derivative", "hashbrown 0.13.2", ] +[[package]] +name = "ark-poly" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "579305839da207f02b89cd1679e50e67b4331e2f9294a57693e5051b7703fe27" +dependencies = [ + "ahash 0.8.12", + "ark-ff 0.5.0", + "ark-serialize 0.5.0", + "ark-std 0.5.0", + "educe 0.6.0", + "fnv", + "hashbrown 0.15.2", +] + [[package]] name = "ark-serialize" version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "adb7b85a02b83d2f22f89bd5cac66c9c89474240cb6207cb1efc16d098e822a5" dependencies = [ - "ark-serialize-derive", - "ark-std", + "ark-serialize-derive 0.4.2", + "ark-std 0.4.0", + "digest 0.10.7", + "num-bigint 0.4.6", +] + +[[package]] +name = "ark-serialize" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f4d068aaf107ebcd7dfb52bc748f8030e0fc930ac8e360146ca54c1203088f7" +dependencies = [ + "ark-serialize-derive 0.5.0", + "ark-std 0.5.0", + "arrayvec", "digest 0.10.7", "num-bigint 0.4.6", ] @@ -427,6 +680,17 @@ dependencies = [ "syn 1.0.109", ] +[[package]] +name = "ark-serialize-derive" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "213888f660fddcca0d257e88e54ac05bca01885f258ccdf695bafd77031bb69d" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.114", +] + [[package]] name = "ark-std" version = "0.4.0" @@ -437,6 +701,16 @@ dependencies = [ "rand 0.8.5", ] +[[package]] +name = "ark-std" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "246a225cc6131e9ee4f24619af0f19d67761fff15d7ccc22e42b80846e69449a" +dependencies = [ + "num-traits", + "rand 0.8.5", +] + [[package]] name = "arrayref" version = "0.3.9" @@ -500,17 +774,6 @@ version = "1.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9b34d609dfbaf33d6889b2b7106d3ca345eacad44200913df5ba02bfd31d2ba9" -[[package]] -name = "async-channel" -version = "1.9.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "81953c529336010edd6d8e358f886d9581267795c61b19475b71314bffa46d35" -dependencies = [ - "concurrent-queue", - "event-listener 2.5.3", - "futures-core", -] - [[package]] name = "async-compression" version = "0.4.18" @@ -531,7 +794,7 @@ version = "3.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "5fd03604047cee9b6ce9de9f70c6cd540a0520c813cbd49bae61f33ab80ed1dc" dependencies = [ - "event-listener 5.4.0", + "event-listener", "event-listener-strategy", "pin-project-lite", ] @@ -553,21 +816,6 @@ version = "1.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ace50bade8e6234aa140d9a2f552bbee1db4d353f69b8217bc503490fc1a9f26" -[[package]] -name = "backtrace" -version = "0.3.74" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d82cb332cdfaed17ae235a638438ac4d4839913cc2af585c3c6746e8f8bee1a" -dependencies = [ - "addr2line", - "cfg-if", - "libc", - "miniz_oxide", - "object", - "rustc-demangle", - "windows-targets 0.52.6", -] - [[package]] name = "base16ct" version = "0.2.0" @@ -640,6 +888,18 @@ dependencies = [ "typenum", ] +[[package]] +name = "bitvec" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1bc2832c24239b0141d5674bb9174f9d68a8b5b3f2753311927c172ca46f7e9c" +dependencies = [ + "funty", + "radium", + "tap", + "wyz", +] + [[package]] name = "blake3" version = "1.8.2" @@ -672,6 +932,34 @@ dependencies = [ "generic-array", ] +[[package]] +name = "blst" +version = "0.3.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dcdb4c7013139a150f9fc55d123186dbfaba0d912817466282c73ac49e71fb45" +dependencies = [ + "cc", + "glob", + "threadpool", + "zeroize", +] + +[[package]] +name = "blstrs" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a8a8ed6fefbeef4a8c7b460e4110e12c5e22a5b7cf32621aae6ad650c4dcf29" +dependencies = [ + "blst", + "byte-slice-cast", + "ff", + "group", + "pairing", + "rand_core 0.6.4", + "serde", + "subtle", +] + [[package]] name = "borsh" version = "1.6.0" @@ -747,20 +1035,26 @@ dependencies = [ "serde", ] +[[package]] +name = "byte-slice-cast" +version = "1.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7575182f7272186991736b70173b0ea045398f984bf5ebbb3804736ce1330c9d" + [[package]] name = "bytemuck" -version = "1.23.2" +version = "1.25.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3995eaeebcdf32f91f980d360f78732ddc061097ab4e39991ae7a6ace9194677" +checksum = "c8efb64bd706a16a1bdde310ae86b351e4d21550d98d056f22f8a7f7a2183fec" dependencies = [ "bytemuck_derive", ] [[package]] name = "bytemuck_derive" -version = "1.10.1" +version = "1.10.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4f154e572231cb6ba2bd1176980827e3d5dc04cc183a75dea38109fbdd672d29" +checksum = "f9abbd1bc6865053c427f7198e6af43bfdedc55ab791faed4fbd361d789575ff" dependencies = [ "proc-macro2", "quote", @@ -842,9 +1136,9 @@ checksum = "6d43a04d8753f35258c91f8ec639f792891f748a1edbd759cf1dcea3382ad83c" [[package]] name = "cfg-if" -version = "1.0.0" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd" +checksum = "9330f8b2ff13f34540b44e946ef35111825727b38d33286ef986142615121801" [[package]] name = "cfg_aliases" @@ -1596,16 +1890,28 @@ version = "0.4.23" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0f0042ff8246a363dbe77d2ceedb073339e85a804b9a47636c6e016a9a32c05f" dependencies = [ - "enum-ordinalize", + "enum-ordinalize 3.1.15", "proc-macro2", "quote", "syn 1.0.109", ] [[package]] -name = "either" -version = "1.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" +name = "educe" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d7bc049e1bd8cdeb31b68bbd586a9464ecf9f3944af3958a7a9d0f8b9799417" +dependencies = [ + "enum-ordinalize 4.3.2", + "proc-macro2", + "quote", + "syn 2.0.114", +] + +[[package]] +name = "either" +version = "1.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "60b1af1c220855b6ceac025d3f6ecdd2b7c4894bfe9cd9bda4fbb4bc7c0d4cf0" [[package]] @@ -1642,11 +1948,20 @@ dependencies = [ "enum-iterator-derive", ] +[[package]] +name = "enum-iterator" +version = "2.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a4549325971814bda7a44061bf3fe7e487d447cba01e4220a4b454d630d7a016" +dependencies = [ + "enum-iterator-derive", +] + [[package]] name = "enum-iterator-derive" -version = "1.4.0" +version = "1.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a1ab991c1362ac86c61ab6f556cff143daa22e5a15e4e189df818b2fd19fe65b" +checksum = "685adfa4d6f3d765a26bc5dbc936577de9abf756c1feeb3089b01dd395034842" dependencies = [ "proc-macro2", "quote", @@ -1666,6 +1981,26 @@ dependencies = [ "syn 2.0.114", ] +[[package]] +name = "enum-ordinalize" +version = "4.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4a1091a7bb1f8f2c4b28f1fe2cef4980ca2d410a3d727d67ecc3178c9b0800f0" +dependencies = [ + "enum-ordinalize-derive", +] + +[[package]] +name = "enum-ordinalize-derive" +version = "4.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ca9601fb2d62598ee17836250842873a413586e5d7ed88b356e38ddbb0ec631" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.114", +] + [[package]] name = "env_filter" version = "0.1.3" @@ -1705,12 +2040,6 @@ dependencies = [ "windows-sys 0.59.0", ] -[[package]] -name = "event-listener" -version = "2.5.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0206175f82b8d6bf6652ff7d71a1e27fd2e4efde587fd368662814d6ec1d9ce0" - [[package]] name = "event-listener" version = "5.4.0" @@ -1728,20 +2057,20 @@ version = "0.5.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3c3e4e0dd3673c1139bf041f3008816d9cf2946bbfac2945c09e523b8d7b05b2" dependencies = [ - "event-listener 5.4.0", + "event-listener", "pin-project-lite", ] [[package]] name = "fastbloom" -version = "0.9.0" +version = "0.14.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "27cea6e7f512d43b098939ff4d5a5d6fe3db07971e1d05176fe26c642d33f5b8" +checksum = "4e7f34442dbe69c60fe8eaf58a8cafff81a1f278816d8ab4db255b3bef4ac3c4" dependencies = [ "getrandom 0.3.1", + "libm", "rand 0.9.2", "siphasher 1.0.1", - "wide", ] [[package]] @@ -1762,6 +2091,7 @@ version = "0.13.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "c0b50bfb653653f9ca9095b427bed08ab8d75a137839d9ad64eb11810d5b6393" dependencies = [ + "bitvec", "rand_core 0.6.4", "subtle", ] @@ -1856,9 +2186,9 @@ checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b" [[package]] name = "form_urlencoded" -version = "1.2.1" +version = "1.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e13624c2627564efccf4934284bdd98cbaa14e79b0b5a141218e507b3a823456" +checksum = "cb4cb245038516f5f85277875cdaa4f7d2c9a0fa0468de06ed190163b1581fcf" dependencies = [ "percent-encoding", ] @@ -1869,6 +2199,12 @@ version = "2.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6c2141d6d6c8512188a7891b4b01590a45f6dac67afb4f255c4124dbb86d4eaa" +[[package]] +name = "funty" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e6d5a32815ae3f33302d95fdcb2ce17862f8c65363dcfd29360480ba1001fc9c" + [[package]] name = "futures" version = "0.3.31" @@ -2038,10 +2374,10 @@ dependencies = [ ] [[package]] -name = "gimli" -version = "0.31.1" +name = "glob" +version = "0.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "07e28edb80900c19c28f1072f2e8aeca7fa06b23cd4169cefe1af5aa3260783f" +checksum = "0cc23270f6e1808e30a928bdc84dea0b9b4136a8bc82338574f23baf47bbd280" [[package]] name = "governor" @@ -2070,7 +2406,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f0f9ef7462f7c099f518d754361858f86d8a07af53ba9af0fe635bbccb151a63" dependencies = [ "ff", + "rand 0.8.5", "rand_core 0.6.4", + "rand_xorshift 0.3.0", "subtle", ] @@ -2098,7 +2436,7 @@ version = "0.13.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "43a3c133739dddd0d2990f9a4bdf8eb4b21ef50e4851ca85ab661199821d510e" dependencies = [ - "ahash 0.8.11", + "ahash 0.8.12", ] [[package]] @@ -2113,9 +2451,16 @@ version = "0.15.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "bf151400ff0baff5465007dd2f3e717f3fe502074ca563069ce3a6629d07b289" dependencies = [ + "allocator-api2", "foldhash", ] +[[package]] +name = "hashbrown" +version = "0.16.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "841d1cc9bed7f9236f321df977030373f4a4163ae1a7dbfe1a51a2c1a51d9100" + [[package]] name = "heck" version = "0.4.1" @@ -2261,10 +2606,10 @@ dependencies = [ "http 1.3.1", "hyper", "hyper-util", - "rustls 0.23.32", + "rustls", "rustls-pki-types", "tokio", - "tokio-rustls 0.26.2", + "tokio-rustls", "tower-service", "webpki-roots 1.0.2", ] @@ -2287,7 +2632,7 @@ dependencies = [ "libc", "percent-encoding", "pin-project-lite", - "socket2 0.6.0", + "socket2 0.6.3", "tokio", "tower-service", "tracing", @@ -2448,9 +2793,9 @@ checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39" [[package]] name = "idna" -version = "1.0.3" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "686f825264d630750a544639377bae737628043f20d38bbc029e8f29ea968a7e" +checksum = "3b0875f23caa03898994f6ddc501886a45c7d3d62d04d2d90788d47be1b1e4de" dependencies = [ "idna_adapter", "smallvec", @@ -2515,13 +2860,14 @@ dependencies = [ [[package]] name = "indexmap" -version = "2.10.0" +version = "2.13.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fe4cd85333e22411419a0bcae1297d25e58c9443848b11dc6a86fefe8c78a661" +checksum = "7714e70437a7dc3ac8eb7e6f8df75fd8eb422675fc7678aff7364301092b1017" dependencies = [ "equivalent", - "hashbrown 0.15.2", + "hashbrown 0.16.1", "serde", + "serde_core", ] [[package]] @@ -2548,9 +2894,9 @@ dependencies = [ [[package]] name = "io-uring" -version = "0.7.9" +version = "0.7.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d93587f37623a1a17d94ef2bc9ada592f5465fe7732084ab7beefabe5c77c0c4" +checksum = "fdd7bddefd0a8833b88a4b68f90dae22c7450d11b354198baee3874fd811b344" dependencies = [ "bitflags", "cfg-if", @@ -2597,6 +2943,24 @@ dependencies = [ "either", ] +[[package]] +name = "itertools" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "413ee7dfc52ee1a4949ceeb7dbc8a33f2d6c088194d9f922fb8318faf1f01186" +dependencies = [ + "either", +] + +[[package]] +name = "itertools" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2b192c782037fadd9cfa75548310488aabdbf3d2da73885b31bd0abd03351285" +dependencies = [ + "either", +] + [[package]] name = "itoa" version = "1.0.14" @@ -2720,9 +3084,15 @@ checksum = "09edd9e8b54e49e587e4f6295a7d29c3ea94d469cb40ab8ca70b288248a81db2" [[package]] name = "libc" -version = "0.2.176" +version = "0.2.183" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b5b646652bf6661599e1da8901b3b9522896f01e736bad5f723fe7a3a27f899d" + +[[package]] +name = "libm" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "58f929b4d672ea937a23a1ab494143d968337a5f47e56d0815df1e0890ddf174" +checksum = "b6d2cec3eae94f9f509c767b45932f1ada8350c4bdb85af2fcab4a3c14807981" [[package]] name = "libredox" @@ -2789,8 +3159,20 @@ version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3c9a85a9752c549ceb7578064b4ed891179d20acd85f27318573b64d2d7ee7ee" dependencies = [ - "ark-bn254", - "ark-ff", + "ark-bn254 0.4.0", + "ark-ff 0.4.2", + "num-bigint 0.4.6", + "thiserror 1.0.69", +] + +[[package]] +name = "light-poseidon" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "47a1ccadd0bb5a32c196da536fd72c59183de24a055f6bf0513bf845fefab862" +dependencies = [ + "ark-bn254 0.5.0", + "ark-ff 0.5.0", "num-bigint 0.4.6", "thiserror 1.0.69", ] @@ -2803,9 +3185,9 @@ checksum = "d26c52dbd32dccf2d10cac7725f8eae5296885fb5703b261f7d0a0739ec807ab" [[package]] name = "linux-raw-sys" -version = "0.9.4" +version = "0.12.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd945864f07fe9f5371a27ad7b52a172b4b499999f1d97574c9fa68373937e12" +checksum = "32a66949e030da00e8c7d4434b251670a91556f4144941d37452769c25d58a53" [[package]] name = "litemap" @@ -2825,9 +3207,9 @@ dependencies = [ [[package]] name = "log" -version = "0.4.27" +version = "0.4.29" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "13dc2df351e3202783a1fe0d44375f7295ffb4049267b0f3018346dc122a1d94" +checksum = "5e5032e24019045c762d3c0f28f5b6b8bbf38563a65908389bf7978758920897" [[package]] name = "lru" @@ -2880,9 +3262,9 @@ dependencies = [ [[package]] name = "memmap2" -version = "0.9.7" +version = "0.9.10" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "483758ad303d734cec05e5c12b41d7e93e6a6390c5e9dae6bdeb7c1259012d28" +checksum = "714098028fe011992e1c3962653c96b2d578c4b4bce9036e15ff220319b1e0e3" dependencies = [ "libc", ] @@ -2963,9 +3345,9 @@ dependencies = [ [[package]] name = "modular-bitfield" -version = "0.11.2" +version = "0.13.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a53d79ba8304ac1c4f9eb3b9d281f21f7be9d4626f72ce7df4ad8fbde4f38a74" +checksum = "2956e537fc68236d2aa048f55704f231cc93f1c4de42fe1ecb5bd7938061fc4a" dependencies = [ "modular-bitfield-impl", "static_assertions", @@ -2973,92 +3355,84 @@ dependencies = [ [[package]] name = "modular-bitfield-impl" -version = "0.11.2" +version = "0.13.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5a7d5f7076603ebc68de2dc6a650ec331a062a13abaa346975be747bbfa4b789" +checksum = "59b43b4fd69e3437618106f7754f34021b831a514f9e1a98ae863cabcd8d8dad" dependencies = [ "proc-macro2", "quote", - "syn 1.0.109", + "syn 2.0.114", ] [[package]] name = "mollusk-svm" -version = "0.7.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6ed52e82370cbf4f266a65603d7d1cbe7faf94fcf769d068c0b89bb934a882e3" +version = "0.10.3" +source = "git+https://github.com/anza-xyz/mollusk?rev=2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3#2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3" dependencies = [ - "agave-feature-set", - "agave-syscalls", + "agave-feature-set 4.0.0-beta.1", + "agave-syscalls 4.0.0-beta.1", "bincode", "mollusk-svm-error", - "mollusk-svm-keys", "mollusk-svm-result", - "solana-account 3.2.0", - "solana-bpf-loader-program", + "solana-account 3.4.0", + "solana-account 4.1.0", + "solana-bpf-loader-program 4.0.0-beta.1", "solana-clock", - "solana-compute-budget", + "solana-compute-budget 4.0.0-beta.1", + "solana-compute-budget-program 4.0.0-beta.1", "solana-epoch-rewards", "solana-epoch-schedule", "solana-hash 3.1.0", "solana-instruction", "solana-instruction-error", + "solana-instructions-sysvar", "solana-loader-v3-interface", "solana-loader-v4-interface", - "solana-loader-v4-program", + "solana-loader-v4-program 4.0.0-beta.1", "solana-logger", + "solana-message", "solana-precompile-error", "solana-program-error", - "solana-program-runtime", - "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-program-runtime 4.0.0-beta.1", + "solana-pubkey 4.1.0", + "solana-rent 3.1.0", + "solana-rent 4.1.0", "solana-sdk-ids", "solana-slot-hashes", - "solana-stake-interface 2.0.1", - "solana-stake-program 3.0.10", - "solana-svm-callback", - "solana-svm-log-collector", - "solana-svm-timings", - "solana-system-program", - "solana-sysvar 3.0.0", + "solana-stake-interface 3.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "solana-svm-callback 4.0.0-beta.1", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-svm-timings 4.0.0-beta.1", + "solana-svm-transaction 4.0.0-beta.1", + "solana-system-program 4.0.0-beta.1", + "solana-sysvar 4.0.0", "solana-sysvar-id", - "solana-transaction-context", + "solana-transaction-context 4.0.0-beta.1", + "solana-transaction-error", + "solana-vote-program 4.0.0-beta.1", + "solana-zk-elgamal-proof-program 4.0.0-beta.1", ] [[package]] name = "mollusk-svm-error" -version = "0.7.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "682ad3a990ae8f336ee10f402da2e900a37cff38730e29aa8cda2d82e1b2e9f1" +version = "0.10.3" +source = "git+https://github.com/anza-xyz/mollusk?rev=2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3#2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3" dependencies = [ - "solana-pubkey 3.0.0", + "solana-pubkey 4.1.0", "thiserror 1.0.69", ] -[[package]] -name = "mollusk-svm-keys" -version = "0.7.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b97ddf2442ea621ea5ae25b0c21ae2861588ea34abce0d059cb601de24cd646f" -dependencies = [ - "mollusk-svm-error", - "solana-account 3.2.0", - "solana-instruction", - "solana-pubkey 3.0.0", - "solana-transaction-context", -] - [[package]] name = "mollusk-svm-result" -version = "0.7.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4f23d402bb19bac3b25b02ada2cf1f58dd4bc8e4b12a38fc1f58aef0090ff0f6" +version = "0.10.3" +source = "git+https://github.com/anza-xyz/mollusk?rev=2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3#2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3" dependencies = [ - "solana-account 3.2.0", + "solana-account 4.1.0", "solana-instruction", "solana-program-error", - "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-pubkey 4.1.0", + "solana-rent 4.1.0", + "solana-transaction-error", ] [[package]] @@ -3237,15 +3611,6 @@ dependencies = [ "syn 2.0.114", ] -[[package]] -name = "object" -version = "0.36.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "62948e14d923ea95ea2c7c86c71013138b66525b86bdc08d2dcc262bdb497b87" -dependencies = [ - "memchr", -] - [[package]] name = "oid-registry" version = "0.6.1" @@ -3346,6 +3711,15 @@ dependencies = [ "thiserror 1.0.69", ] +[[package]] +name = "pairing" +version = "0.23.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "81fec4625e73cf41ef4bb6846cafa6d44736525f442ba45e407c4a000a13996f" +dependencies = [ + "group", +] + [[package]] name = "parking" version = "2.2.1" @@ -3407,9 +3781,9 @@ dependencies = [ [[package]] name = "percent-encoding" -version = "2.3.1" +version = "2.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e3148f5046208a5d56bcfc03053e3ca6334e51da8dfb19b6cdc8b306fae3283e" +checksum = "9b4f627cb1b25917193a259e49bdad08f671f8d9708acfd5fe0a8c1455d87220" [[package]] name = "percentage" @@ -3507,7 +3881,7 @@ version = "0.2.20" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "77957b295656769bb8ad2b6a6b09d897d94f05c41b069aede1fcdaa675eaea04" dependencies = [ - "zerocopy", + "zerocopy 0.7.35", ] [[package]] @@ -3601,7 +3975,7 @@ dependencies = [ "num-traits", "rand 0.9.2", "rand_chacha 0.9.0", - "rand_xorshift", + "rand_xorshift 0.4.0", "regex-syntax", "rusty-fork", "tempfile", @@ -3651,9 +4025,9 @@ checksum = "a1d01941d82fa2ab50be1e79e6714289dd7cde78eba4c074bc5a4374f650dfe0" [[package]] name = "quinn" -version = "0.11.8" +version = "0.11.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "626214629cda6781b6dc1d316ba307189c85ba657213ce642d9c77670f8202c8" +checksum = "b9e20a958963c291dc322d98411f541009df2ced7b5a4f2bd52337638cfccf20" dependencies = [ "bytes", "cfg_aliases", @@ -3661,8 +4035,8 @@ dependencies = [ "quinn-proto", "quinn-udp", "rustc-hash", - "rustls 0.23.32", - "socket2 0.5.10", + "rustls", + "socket2 0.6.3", "thiserror 2.0.18", "tokio", "tracing", @@ -3671,9 +4045,9 @@ dependencies = [ [[package]] name = "quinn-proto" -version = "0.11.12" +version = "0.11.14" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "49df843a9161c85bb8aae55f101bc0bac8bcafd637a620d9122fd7e0b2f7422e" +checksum = "434b42fec591c96ef50e21e886936e66d3cc3f737104fdb9b737c40ffb94c098" dependencies = [ "bytes", "fastbloom", @@ -3682,7 +4056,7 @@ dependencies = [ "rand 0.9.2", "ring", "rustc-hash", - "rustls 0.23.32", + "rustls", "rustls-pki-types", "rustls-platform-verifier", "slab", @@ -3721,6 +4095,12 @@ version = "5.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "69cdb34c158ceb288df11e18b4bd39de994f6657d83847bdffdbd7f346754b0f" +[[package]] +name = "radium" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc33ff2d4973d518d823d61aa239014831e521c75da58e3df4840d3f47749d09" + [[package]] name = "rand" version = "0.7.3" @@ -3838,6 +4218,15 @@ dependencies = [ "rand_core 0.5.1", ] +[[package]] +name = "rand_xorshift" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d25bf25ec5ae4a3f1b92f929810509a2f53d7dca2f50b794ff57e3face536c8f" +dependencies = [ + "rand_core 0.6.4", +] + [[package]] name = "rand_xorshift" version = "0.4.0" @@ -3867,9 +4256,9 @@ dependencies = [ [[package]] name = "rayon" -version = "1.10.0" +version = "1.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b418a60154510ca1a002a752ca9714984e21e4241e804d32555251faf8b78ffa" +checksum = "368f01d005bf8fd9b1206fb6fa653e6c4a81ceb1466406b81792d87c5677a58f" dependencies = [ "either", "rayon-core", @@ -3877,9 +4266,9 @@ dependencies = [ [[package]] name = "rayon-core" -version = "1.12.1" +version = "1.13.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1465873a3dfdaa8ae7cb14b4383657caab0b3e8a0aa9ae8e04b044854c8dfce2" +checksum = "22e18b0f0062d30d4230b2e85ff77fdfe4326feb054b9783a3460d8435c8ab91" dependencies = [ "crossbeam-deque", "crossbeam-utils", @@ -3916,9 +4305,9 @@ dependencies = [ [[package]] name = "regex" -version = "1.11.1" +version = "1.12.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b544ef1b4eac5dc2db33ea63606ae9ffcfac26c1416a2806ae0bf5f56b201191" +checksum = "e10754a14b9137dd7b1e3e5b0493cc9171fdd105e0ab477f51b72e7f3ac0e276" dependencies = [ "aho-corasick", "memchr", @@ -3928,9 +4317,9 @@ dependencies = [ [[package]] name = "regex-automata" -version = "0.4.9" +version = "0.4.14" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "809e8dc61f6de73b46c85f4c96486310fe304c434cfa43669d7b40f711150908" +checksum = "6e1dd4122fc1595e8162618945476892eefca7b88c52820e74af6262213cae8f" dependencies = [ "aho-corasick", "memchr", @@ -3945,11 +4334,10 @@ checksum = "2b15c43186be67a4fd63bee50d0303afffcef381492ebe2c5d87f324e1b8815c" [[package]] name = "reqwest" -version = "0.12.23" +version = "0.12.28" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d429f34c8092b2d42c7c93cec323bb4adeb7c67698f70839adec842ec10c7ceb" +checksum = "eddd3ca559203180a307f12d114c268abf583f59b03cb906fd0b3ff8646c1147" dependencies = [ - "async-compression", "base64 0.22.1", "bytes", "futures-channel", @@ -3966,15 +4354,14 @@ dependencies = [ "percent-encoding", "pin-project-lite", "quinn", - "rustls 0.23.32", + "rustls", "rustls-pki-types", "serde", "serde_json", "serde_urlencoded", "sync_wrapper", "tokio", - "tokio-rustls 0.26.2", - "tokio-util 0.7.16", + "tokio-rustls", "tower", "tower-http", "tower-service", @@ -4069,39 +4456,27 @@ dependencies = [ [[package]] name = "rustix" -version = "1.0.8" +version = "1.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "11181fbabf243db407ef8df94a6ce0b2f9a733bd8be4ad02b4eda9602296cac8" +checksum = "b6fe4565b9518b83ef4f91bb47ce29620ca828bd32cb7e408f0062e9930ba190" dependencies = [ "bitflags", "errno", "libc", - "linux-raw-sys 0.9.4", - "windows-sys 0.60.2", -] - -[[package]] -name = "rustls" -version = "0.21.12" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3f56a14d1f48b391359b22f731fd4bd7e43c97f3c50eee276f3aa09c94784d3e" -dependencies = [ - "log", - "ring", - "rustls-webpki 0.101.7", - "sct", + "linux-raw-sys 0.12.1", + "windows-sys 0.61.1", ] [[package]] name = "rustls" -version = "0.23.32" +version = "0.23.37" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd3c25631629d034ce7cd9940adc9d45762d46de2b0f57193c4443b92c6d4d40" +checksum = "758025cb5fccfd3bc2fd74708fd4682be41d99e5dff73c377c0646c6012c73a4" dependencies = [ "once_cell", "ring", "rustls-pki-types", - "rustls-webpki 0.103.7", + "rustls-webpki", "subtle", "zeroize", ] @@ -4130,23 +4505,23 @@ dependencies = [ [[package]] name = "rustls-platform-verifier" -version = "0.5.3" +version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "19787cda76408ec5404443dc8b31795c87cd8fec49762dc75fa727740d34acc1" +checksum = "1d99feebc72bae7ab76ba994bb5e121b8d83d910ca40b36e0921f53becc41784" dependencies = [ "core-foundation", "core-foundation-sys", "jni", "log", "once_cell", - "rustls 0.23.32", + "rustls", "rustls-native-certs", "rustls-platform-verifier-android", - "rustls-webpki 0.103.7", + "rustls-webpki", "security-framework", "security-framework-sys", "webpki-root-certs", - "windows-sys 0.59.0", + "windows-sys 0.61.1", ] [[package]] @@ -4155,16 +4530,6 @@ version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f87165f0995f63a9fbeea62b64d10b4d9d8e78ec6d7d51fb2125fda7bb36788f" -[[package]] -name = "rustls-webpki" -version = "0.101.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b6275d1ee7a1cd780b64aca7726599a1dbc893b1e64144529e55c3c2f745765" -dependencies = [ - "ring", - "untrusted", -] - [[package]] name = "rustls-webpki" version = "0.103.7" @@ -4200,15 +4565,6 @@ version = "1.0.19" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6ea1a2d0a644769cc99faa24c3ad26b379b786fe7c36fd3c546254801650e6dd" -[[package]] -name = "safe_arch" -version = "0.7.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "96b02de82ddbe1b636e6170c21be622223aea188ef2e139be0a5b219ec215323" -dependencies = [ - "bytemuck", -] - [[package]] name = "same-file" version = "1.0.6" @@ -4266,16 +4622,6 @@ version = "1.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49" -[[package]] -name = "sct" -version = "0.7.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "da046153aa2352493d6cb7da4b6e5c0c057d8a1d0a9aa8560baffdd945acd414" -dependencies = [ - "ring", - "untrusted", -] - [[package]] name = "sdd" version = "3.0.10" @@ -4298,9 +4644,9 @@ dependencies = [ [[package]] name = "security-framework" -version = "3.2.0" +version = "3.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "271720403f46ca04f7ba6f55d438f8bd878d6b8ca0a1046e8228c4145bcbb316" +checksum = "d17b898a6d6948c3a8ee4372c17cb384f90d2e6e912ef00895b14fd7ab54ec38" dependencies = [ "bitflags", "core-foundation", @@ -4311,9 +4657,9 @@ dependencies = [ [[package]] name = "security-framework-sys" -version = "2.14.0" +version = "2.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "49db231d56a190491cb4aeda9527f1ad45345af50b0851622a7adb8c03b01c32" +checksum = "6ce2691df843ecc5d231c0b14ece2acc3efb62c0a398c7e1d875f3983ce020e3" dependencies = [ "core-foundation-sys", "libc", @@ -4321,9 +4667,9 @@ dependencies = [ [[package]] name = "semver" -version = "1.0.26" +version = "1.0.27" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "56e6fa9c48d24d85fb3de5ad847117517440f6beceb7798af16b4a87d616b8d0" +checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2" [[package]] name = "seqlock" @@ -4426,7 +4772,7 @@ dependencies = [ "chrono", "hex", "indexmap 1.9.3", - "indexmap 2.10.0", + "indexmap 2.13.0", "schemars 0.9.0", "schemars 1.0.4", "serde_core", @@ -4620,19 +4966,19 @@ dependencies = [ [[package]] name = "socket2" -version = "0.6.0" +version = "0.6.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "233504af464074f9d066d7b5416c5f9b894a5862a6506e306f7b816cdd6f1807" +checksum = "3a766e1110788c36f4fa1c2b71b387a7815aa65f88ce0229841826633d93723e" dependencies = [ "libc", - "windows-sys 0.59.0", + "windows-sys 0.61.1", ] [[package]] name = "solana-account" -version = "3.2.0" +version = "3.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "014dcb9293341241dd153b35f89ea906e4170914f4a347a95e7fb07ade47cd6f" +checksum = "efc0ed36decb689413b9da5d57f2be49eea5bebb3cf7897015167b0c4336e731" dependencies = [ "bincode", "qualifier_attr", @@ -4642,16 +4988,16 @@ dependencies = [ "solana-account-info", "solana-clock", "solana-instruction-error", - "solana-pubkey 3.0.0", + "solana-pubkey 4.1.0", "solana-sdk-ids", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", ] [[package]] name = "solana-account" -version = "4.0.0" +version = "4.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5c7e916e1536da36de86dfa68887507b602e460f7f174db79b961c1114365837" +checksum = "862b95723ec6f2a27451d2fc7f4f8cf1f80a79627dcfed63879aac4ea5fe3bc2" dependencies = [ "bincode", "serde", @@ -4665,18 +5011,59 @@ dependencies = [ "solana-sysvar 4.0.0", ] +[[package]] +name = "solana-account-decoder" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5fd3308940576fd279b73156e29ed398ad1c5424fea9e42cca38b2e6bf98d6a2" +dependencies = [ + "Inflector", + "base64 0.22.1", + "bincode", + "bs58", + "bv", + "serde", + "serde_json", + "solana-account 3.4.0", + "solana-account-decoder-client-types", + "solana-address-lookup-table-interface", + "solana-clock", + "solana-config-interface", + "solana-epoch-schedule", + "solana-fee-calculator", + "solana-instruction", + "solana-loader-v3-interface", + "solana-nonce", + "solana-program-option", + "solana-program-pack", + "solana-pubkey 3.0.0", + "solana-rent 3.1.0", + "solana-sdk-ids", + "solana-slot-hashes", + "solana-slot-history", + "solana-stake-interface 2.0.2", + "solana-sysvar 3.1.1", + "solana-vote-interface 4.0.4", + "spl-generic-token", + "spl-token-2022-interface", + "spl-token-group-interface", + "spl-token-interface", + "spl-token-metadata-interface", + "thiserror 2.0.18", + "zstd", +] + [[package]] name = "solana-account-decoder-client-types" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a254419b647ca675bd0d55749c24a3383691a00e633e38ae58d070223ac01bf2" +checksum = "1e57eff73a653c056ac3131926e1072265d7509f90276ea30412ced57e7628f2" dependencies = [ "base64 0.22.1", "bs58", "serde", - "serde_derive", "serde_json", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-pubkey 3.0.0", "zstd", ] @@ -4696,27 +5083,24 @@ dependencies = [ [[package]] name = "solana-accounts-db" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "81e38e11de48b1f91fcf918bede16d56c961cdbb465dbd7d83d56ac45f4999f4" +checksum = "d7f54a3079b6d1c270c4b3c4ced2f4c218f7e71521411839ba83db3a1826a7fd" dependencies = [ - "agave-io-uring", - "ahash 0.8.11", + "agave-fs", + "ahash 0.8.12", "bincode", "blake3", "bv", "bytemuck", "bytemuck_derive", - "bzip2", "crossbeam-channel", "dashmap", - "indexmap 2.10.0", - "io-uring", + "indexmap 2.13.0", "itertools 0.12.1", - "libc", "log", "lz4", - "memmap2 0.9.7", + "memmap2 0.9.10", "modular-bitfield", "num_cpus", "num_enum", @@ -4724,10 +5108,8 @@ dependencies = [ "rayon", "seqlock", "serde", - "serde_derive", - "slab", "smallvec", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-address-lookup-table-interface", "solana-bucket-map", "solana-clock", @@ -4745,16 +5127,15 @@ dependencies = [ "solana-reward-info", "solana-sha256-hasher", "solana-slot-hashes", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", "solana-system-interface 2.0.0", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", "solana-time-utils", "solana-transaction", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", "spl-generic-token", "static_assertions", - "tar", "tempfile", "thiserror 2.0.18", ] @@ -4823,13 +5204,13 @@ dependencies = [ [[package]] name = "solana-banks-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ac0c8780d1c4216925f72d28d809b172ab83466b687e8110154f39066e228c3d" +checksum = "1443f9b60434d0c9886afe5e006249725f7e732fd71020450dc5da4be81820c1" dependencies = [ "borsh", "futures", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-banks-interface", "solana-clock", "solana-commitment-config", @@ -4837,11 +5218,11 @@ dependencies = [ "solana-message", "solana-program-pack", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-signature", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", "solana-transaction", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", "tarpc", "thiserror 2.0.18", @@ -4851,13 +5232,12 @@ dependencies = [ [[package]] name = "solana-banks-interface" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0114282a0c18cdca6beae1d5cd9c92be7b8a2140aa92e3f0a2536f86303b05d8" +checksum = "21b712065eb568ca4bb8d998ee4a7b0ef9cb3e50bf01f95717b85fcf18b00cfe" dependencies = [ "serde", - "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-clock", "solana-commitment-config", "solana-hash 3.1.0", @@ -4865,22 +5245,22 @@ dependencies = [ "solana-pubkey 3.0.0", "solana-signature", "solana-transaction", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", "tarpc", ] [[package]] name = "solana-banks-server" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2aa01a4c68080b6e91a4d236300612631185a5e0f421caacdf2e53f1ba74fb2a" +checksum = "3cb69c79984b3700881051e0aa8ae55567e1b86202c59c2613d60e627b911cdd" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "bincode", "crossbeam-channel", "futures", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-banks-interface", "solana-client", "solana-clock", @@ -4913,38 +5293,82 @@ dependencies = [ [[package]] name = "solana-bincode" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "534a37aecd21986089224d0c01006a75b96ac6fb2f418c24edc15baf0d2a4c99" +checksum = "278a1a5bad62cd9da89ac8d4b7ec444e83caa8ae96aa656dfc27684b28d49a5d" dependencies = [ "bincode", - "serde", + "serde_core", "solana-instruction-error", ] [[package]] name = "solana-blake3-hasher" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ffa2e3bdac3339c6d0423275e45dafc5ac25f4d43bf344d026a3cc9a85e244a6" +checksum = "7116e1d942a2432ca3f514625104757ab8a56233787e95144c93950029e31176" dependencies = [ "blake3", - "solana-define-syscall 3.0.0", - "solana-hash 3.1.0", + "solana-define-syscall 4.0.1", + "solana-hash 4.2.0", ] [[package]] -name = "solana-bn254" -version = "3.0.0" +name = "solana-bls-signatures" +version = "1.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "20a5f01e99addb316d95d4ed31aa6eacfda557fffc00ae316b919e8ba0fc5b91" +checksum = "61c75573697bbb148afa8209aa3ce228ca0754584c9a8a91e818db0f706ae4fb" dependencies = [ - "ark-bn254", - "ark-ec", - "ark-ff", - "ark-serialize", + "base64 0.22.1", + "blst", + "blstrs", "bytemuck", - "solana-define-syscall 3.0.0", + "cfg_eval", + "ff", + "group", + "pairing", + "rand 0.8.5", + "serde", + "serde_json", + "serde_with", + "solana-signature", + "solana-signer", + "subtle", + "thiserror 2.0.18", +] + +[[package]] +name = "solana-bls-signatures" +version = "3.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "19bfd2948ec24cd177f6fbc052b9d00146c7e3d9989e3715f2d465424398051c" +dependencies = [ + "base64 0.22.1", + "blst", + "blstrs", + "cfg_eval", + "ff", + "group", + "pairing", + "rand 0.8.5", + "serde", + "serde_json", + "serde_with", + "thiserror 2.0.18", +] + +[[package]] +name = "solana-bn254" +version = "3.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62ff13a8867fcc7b0f1114764e1bf6191b4551dcaf93729ddc676cd4ec6abc9f" +dependencies = [ + "ark-bn254 0.5.0", + "ark-ec 0.5.0", + "ark-ff 0.5.0", + "ark-serialize 0.5.0", + "bytemuck", + "solana-define-syscall 5.0.0", "thiserror 2.0.18", ] @@ -4959,43 +5383,72 @@ dependencies = [ [[package]] name = "solana-bpf-loader-program" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a5a2b7914cebd827003d2a1c21cc48bcad2c1857a9ec34656a2caa578707f53a" +checksum = "0e7cb75c221b02918427762bcebdbfd34c831bd1c66442d2df928fa13f6b73fe" dependencies = [ - "agave-syscalls", + "agave-syscalls 3.1.3", "bincode", "qualifier_attr", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-bincode", "solana-clock", "solana-instruction", "solana-loader-v3-interface", "solana-loader-v4-interface", - "solana-packet", + "solana-packet 3.0.0", "solana-program-entrypoint", - "solana-program-runtime", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", - "solana-sbpf", + "solana-sbpf 0.13.1", "solana-sdk-ids", - "solana-svm-feature-set", - "solana-svm-log-collector", - "solana-svm-measure", - "solana-svm-type-overrides", + "solana-svm-feature-set 3.1.3", + "solana-svm-log-collector 3.1.3", + "solana-svm-measure 3.1.3", + "solana-svm-type-overrides 3.1.3", "solana-system-interface 2.0.0", - "solana-transaction-context", + "solana-transaction-context 3.1.3", +] + +[[package]] +name = "solana-bpf-loader-program" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "34ade4c91f5daa06ad7cc42b2f6c2c1fef206ef256f333b9ad152c4e2f47746f" +dependencies = [ + "agave-syscalls 4.0.0-beta.1", + "bincode", + "qualifier_attr", + "solana-account 3.4.0", + "solana-bincode", + "solana-clock", + "solana-instruction", + "solana-loader-v3-interface", + "solana-loader-v4-interface", + "solana-packet 4.1.0", + "solana-program-entrypoint", + "solana-program-runtime 4.0.0-beta.1", + "solana-pubkey 4.1.0", + "solana-sbpf 0.14.4", + "solana-sdk-ids", + "solana-svm-feature-set 4.0.0-beta.1", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-svm-measure 4.0.0-beta.1", + "solana-svm-type-overrides 4.0.0-beta.1", + "solana-system-interface 3.1.0", + "solana-transaction-context 4.0.0-beta.1", ] [[package]] name = "solana-bucket-map" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "96189a1964ca8a8eba213ad3f81a88012a95b5e237aa0a4620b10259371e48a6" +checksum = "1db4efaf4c56ec0ef3a47c1cf17a356e2544aecd8f82a69285612081c07bc859" dependencies = [ "bv", "bytemuck", "bytemuck_derive", - "memmap2 0.9.7", + "memmap2 0.9.10", "modular-bitfield", "num_enum", "rand 0.8.5", @@ -5007,61 +5460,59 @@ dependencies = [ [[package]] name = "solana-builtins" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bf88128e19b680ac1dee682e3271e39d7176db8e2345c3fd19799f4e58889155" +checksum = "f22e573564f9ad10b7c716d153efcdaa5f039e1a82cf74fa561beb8e4baa4738" dependencies = [ - "agave-feature-set", - "solana-bpf-loader-program", - "solana-compute-budget-program", + "agave-feature-set 3.1.3", + "solana-bpf-loader-program 3.1.3", + "solana-compute-budget-program 3.1.3", "solana-hash 3.1.0", - "solana-loader-v4-program", - "solana-program-runtime", + "solana-loader-v4-program 3.1.3", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", "solana-sdk-ids", - "solana-stake-program 3.0.10", - "solana-system-program", - "solana-vote-program", - "solana-zk-elgamal-proof-program", + "solana-system-program 3.1.3", + "solana-vote-program 3.1.3", + "solana-zk-elgamal-proof-program 3.1.3", "solana-zk-token-proof-program", ] [[package]] name = "solana-builtins-default-costs" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8ac0ed2127d61fa4be2978cf692a04106b1e868d9f700d63a7e5934330b8e061" +checksum = "52eb50c3aafcaf5c6666b3fbe80f2d889f75ee6b0c7fb5b20c1349d9a597b5ee" dependencies = [ - "agave-feature-set", - "ahash 0.8.11", + "agave-feature-set 3.1.3", + "ahash 0.8.12", "log", - "solana-bpf-loader-program", - "solana-compute-budget-program", - "solana-loader-v4-program", + "solana-bpf-loader-program 3.1.3", + "solana-compute-budget-program 3.1.3", + "solana-loader-v4-program 3.1.3", "solana-pubkey 3.0.0", "solana-sdk-ids", - "solana-stake-program 3.0.10", - "solana-system-program", - "solana-vote-program", + "solana-system-program 3.1.3", + "solana-vote-program 3.1.3", ] [[package]] name = "solana-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f29482023b8e799e02b35bff330e1cbe963bd7e0cdd20eb1941bede9a66b944d" +checksum = "b459e5f9ab10d2ae6959b96db5b1a56310e762e023102159bf9645f2097ecbbf" dependencies = [ "async-trait", "bincode", "dashmap", "futures", "futures-util", - "indexmap 2.10.0", + "indexmap 2.13.0", "indicatif", "log", "quinn", "rayon", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-client-traits", "solana-commitment-config", "solana-connection-cache", @@ -5071,6 +5522,7 @@ dependencies = [ "solana-keypair", "solana-measure", "solana-message", + "solana-net-utils", "solana-pubkey 3.0.0", "solana-pubsub-client", "solana-quic-client", @@ -5089,6 +5541,7 @@ dependencies = [ "solana-udp-client", "thiserror 2.0.18", "tokio", + "tokio-util 0.7.16", ] [[package]] @@ -5097,7 +5550,7 @@ version = "3.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "08618ed587e128105510c54ae3e456b9a06d674d8640db75afe66dad65cb4e02" dependencies = [ - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-commitment-config", "solana-epoch-info", "solana-hash 3.1.0", @@ -5148,31 +5601,41 @@ dependencies = [ [[package]] name = "solana-compute-budget" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "df3b2d4cca7050320d13653ab369e21a0573b4a4f5dd82c509b0640e87f34d84" +checksum = "686a3d655c6ae8f2ed7ed123e501369d763f733ce566f22703d9e4e34b9eee32" dependencies = [ "solana-fee-structure", - "solana-program-runtime", + "solana-program-runtime 3.1.3", +] + +[[package]] +name = "solana-compute-budget" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "643379a6c4cb6e5dbc718161d6c0d574c62dd87bb4af2e9132a7b6911f89efaa" +dependencies = [ + "solana-fee-structure", + "solana-program-runtime 4.0.0-beta.1", ] [[package]] name = "solana-compute-budget-instruction" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0ac29452169f23259fa6c60ff4be6dd389d45458256a1d74efa62e22cc169f05" +checksum = "ab5c6e1f2a89248ac1f1f0e27364b7b0a30e33922d8ff3ad7cb0567f07e62580" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "log", "solana-borsh", "solana-builtins-default-costs", - "solana-compute-budget", + "solana-compute-budget 3.1.3", "solana-compute-budget-interface", "solana-instruction", - "solana-packet", + "solana-packet 3.0.0", "solana-pubkey 3.0.0", "solana-sdk-ids", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", "solana-transaction-error", "thiserror 2.0.18", ] @@ -5190,11 +5653,20 @@ dependencies = [ [[package]] name = "solana-compute-budget-program" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d2c1993650e417ef1ee1fc9e81ef5d7704cee080a5cff0de429c2ce187b5a505" +checksum = "2af44adad2ae3b34082349310362cb8d6df9d60c6722b95e486d80f3781644fe" dependencies = [ - "solana-program-runtime", + "solana-program-runtime 3.1.3", +] + +[[package]] +name = "solana-compute-budget-program" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ceecd5f62130df15aad5f5979b07a31e1c303814abd7aeeea23f573e6a3daf2c" +dependencies = [ + "solana-program-runtime 4.0.0-beta.1", ] [[package]] @@ -5206,7 +5678,7 @@ dependencies = [ "bincode", "serde", "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-instruction", "solana-pubkey 3.0.0", "solana-sdk-ids", @@ -5216,15 +5688,15 @@ dependencies = [ [[package]] name = "solana-connection-cache" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0432922673ca595f778e1895497020291fdb59aa9098b5a93b99f132d439299f" +checksum = "0748f2086e095d357408944ba8db6a8c8ba49376cb9f911f3fe2c44c055604f5" dependencies = [ "async-trait", "bincode", "crossbeam-channel", "futures-util", - "indexmap 2.10.0", + "indexmap 2.13.0", "log", "rand 0.8.5", "rayon", @@ -5239,51 +5711,51 @@ dependencies = [ [[package]] name = "solana-cost-model" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "377e2608100cf9d7ec21db895f67b9f0822471848a76374fe84065b9ece7f93c" +checksum = "06f4bdb9c5727e9f5e55c5cde53d000365c1eb00eb4de63ab4cb007dc8af7f32" dependencies = [ - "agave-feature-set", - "ahash 0.8.11", + "agave-feature-set 3.1.3", + "ahash 0.8.12", "log", "solana-bincode", "solana-borsh", "solana-builtins-default-costs", "solana-clock", - "solana-compute-budget", + "solana-compute-budget 3.1.3", "solana-compute-budget-instruction", "solana-compute-budget-interface", "solana-fee-structure", "solana-metrics", - "solana-packet", + "solana-packet 3.0.0", "solana-pubkey 3.0.0", "solana-runtime-transaction", "solana-sdk-ids", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", "solana-system-interface 2.0.0", "solana-transaction-error", - "solana-vote-program", + "solana-vote-program 3.1.3", ] [[package]] name = "solana-cpi" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "16238feb63d1cbdf915fb287f29ef7a7ebf81469bd6214f8b72a53866b593f8f" +checksum = "4dea26709d867aada85d0d3617db0944215c8bb28d3745b912de7db13a23280c" dependencies = [ "solana-account-info", - "solana-define-syscall 3.0.0", + "solana-define-syscall 4.0.1", "solana-instruction", "solana-program-error", - "solana-pubkey 3.0.0", + "solana-pubkey 4.1.0", "solana-stable-layout", ] [[package]] name = "solana-curve25519" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "be2ca224d51d8a1cc20f221706968d8f851586e6b05937cb518bedc156596dee" +checksum = "c7123212926bb5957229c6736956eff0a05a73d0924b5d2ef898d43fb67befe9" dependencies = [ "bytemuck", "bytemuck_derive", @@ -5293,12 +5765,32 @@ dependencies = [ "thiserror 2.0.18", ] +[[package]] +name = "solana-curve25519" +version = "4.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c0ee66a3e25ed8d20ed6fcd1ac71735415ff1edaf33ff1ec2118826eba927bcc" +dependencies = [ + "bytemuck", + "bytemuck_derive", + "curve25519-dalek 4.1.3", + "solana-define-syscall 5.0.0", + "subtle", + "thiserror 2.0.18", +] + [[package]] name = "solana-define-syscall" version = "3.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f9697086a4e102d28a156b8d6b521730335d6951bd39a5e766512bbe09007cee" +[[package]] +name = "solana-define-syscall" +version = "4.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "57e5b1c0bc1d4a4d10c88a4100499d954c09d3fecfae4912c1a074dff68b1738" + [[package]] name = "solana-define-syscall" version = "5.0.0" @@ -5389,7 +5881,7 @@ dependencies = [ "solana-nonce", "solana-pubkey 4.1.0", "solana-sdk-ids", - "solana-system-interface 3.0.0", + "solana-system-interface 3.1.0", "thiserror 2.0.18", ] @@ -5402,32 +5894,32 @@ dependencies = [ "bincode", "serde", "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-account-info", "solana-instruction", "solana-program-error", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-sdk-ids", "solana-system-interface 2.0.0", ] [[package]] name = "solana-fee" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b438bf9ad402491785a4195bc1bc26ca6c01903ef19e94e6c12a8ac29f0267e8" +checksum = "b44d71a15c79306d888dfeeaeb5514ba3c167ef1dc8dd6f6380ade15a2e9f118" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "solana-fee-structure", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", ] [[package]] name = "solana-fee-calculator" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2a73cc03ca4bed871ca174558108835f8323e85917bb38b9c81c7af2ab853efe" +checksum = "4b2a5675b2cf8d407c672dc1776492b1f382337720ddf566645ae43237a3d8c3" dependencies = [ "log", "serde", @@ -5488,7 +5980,7 @@ dependencies = [ "memmap2 0.5.10", "serde", "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-clock", "solana-cluster-type", "solana-epoch-schedule", @@ -5498,7 +5990,7 @@ dependencies = [ "solana-keypair", "solana-poh-config", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-sdk-ids", "solana-sha256-hasher", "solana-shred-version", @@ -5601,13 +6093,13 @@ dependencies = [ [[package]] name = "solana-keccak-hasher" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "57eebd3012946913c8c1b8b43cdf8a6249edb09c0b6be3604ae910332a3acd97" +checksum = "ed1c0d16d6fdeba12291a1f068cdf0d479d9bff1141bf44afd7aa9d485f65ef8" dependencies = [ "sha3", - "solana-define-syscall 3.0.0", - "solana-hash 3.1.0", + "solana-define-syscall 4.0.1", + "solana-hash 4.2.0", ] [[package]] @@ -5643,9 +6135,9 @@ dependencies = [ [[package]] name = "solana-lattice-hash" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "30443bf8af65ad7ec2a7493d14e70b2d26b925fd0750fa9048a44a441b0a23bf" +checksum = "2da94c0f51ae89816dfc479e0ccece6c138bf6af9e50bf930e2027f041328895" dependencies = [ "base64 0.22.1", "blake3", @@ -5685,27 +6177,50 @@ dependencies = [ [[package]] name = "solana-loader-v4-program" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4b4ce5ca27d4b16be527583738bac230fa0e62867e6c8b4bd6345cf09a3c941c" +checksum = "8b3721017c1ca803f8571df2a1909c8353c11a56a8eaac3f7d96d751d0a779ec" dependencies = [ "log", - "qualifier_attr", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-bincode", - "solana-bpf-loader-program", + "solana-bpf-loader-program 3.1.3", "solana-instruction", "solana-loader-v3-interface", "solana-loader-v4-interface", - "solana-packet", - "solana-program-runtime", + "solana-packet 3.0.0", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", - "solana-sbpf", + "solana-sbpf 0.13.1", + "solana-sdk-ids", + "solana-svm-log-collector 3.1.3", + "solana-svm-measure 3.1.3", + "solana-svm-type-overrides 3.1.3", + "solana-transaction-context 3.1.3", +] + +[[package]] +name = "solana-loader-v4-program" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c868d6db9fda27c6bb962ba73d063ebcb62e5905732553bba6a36078321214bd" +dependencies = [ + "log", + "solana-account 3.4.0", + "solana-bincode", + "solana-bpf-loader-program 4.0.0-beta.1", + "solana-instruction", + "solana-loader-v3-interface", + "solana-loader-v4-interface", + "solana-packet 4.1.0", + "solana-program-runtime 4.0.0-beta.1", + "solana-pubkey 4.1.0", + "solana-sbpf 0.14.4", "solana-sdk-ids", - "solana-svm-log-collector", - "solana-svm-measure", - "solana-svm-type-overrides", - "solana-transaction-context", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-svm-measure 4.0.0-beta.1", + "solana-svm-type-overrides 4.0.0-beta.1", + "solana-transaction-context 4.0.0-beta.1", ] [[package]] @@ -5723,24 +6238,24 @@ dependencies = [ [[package]] name = "solana-measure" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ec1c31d6a2213afe934a46f61a2f7512d32dab05247efca046d0713fdc0c8a9e" +checksum = "c48d639f9c87b48437b3feab27cfc50ea4d471de2d18b2afc84aa69df1201fb5" [[package]] name = "solana-message" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2c33e9fa7871147ac3235a7320386afa2dc64bbb21ca3cf9d79a6f6827313176" +checksum = "0448b1fd891c5f46491e5dc7d9986385ba3c852c340db2911dd29faa01d2b08d" dependencies = [ "bincode", "blake3", "lazy_static", "serde", "serde_derive", - "solana-hash 3.1.0", + "solana-address 2.2.0", + "solana-hash 4.2.0", "solana-instruction", - "solana-pubkey 3.0.0", "solana-sanitize", "solana-sdk-ids", "solana-short-vec", @@ -5749,9 +6264,9 @@ dependencies = [ [[package]] name = "solana-metrics" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bb5c1cc9f378f38108827a50d7e7c988915c855378c99443728e852b5d3e5ee9" +checksum = "f8c46308f901be3b6b55e54bf8277fd6b6001361dbe583e5b033f88bc031197d" dependencies = [ "crossbeam-channel", "gethostname", @@ -5780,21 +6295,23 @@ checksum = "ae8dd4c280dca9d046139eb5b7a5ac9ad10403fbd64964c7d7571214950d758f" [[package]] name = "solana-net-utils" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cccd09673923a9766a43d540eb10ed62e598582039178a71ec4ba9a7be237c83" +checksum = "d2edb6edf83fa8b3d71135cda15d650062120e26021b41683bbbd94f527ed683" dependencies = [ "anyhow", "bincode", "bytes", + "cfg-if", + "dashmap", "itertools 0.12.1", "log", "nix", "rand 0.8.5", "serde", - "serde_derive", - "socket2 0.6.0", + "socket2 0.6.3", "solana-serde", + "solana-svm-type-overrides 3.1.3", "tokio", "url", ] @@ -5825,7 +6342,7 @@ version = "3.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "805fd25b29e5a1a0e6c3dd6320c9da80f275fbe4ff6e392617c303a2085c435e" dependencies = [ - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-hash 3.1.0", "solana-nonce", "solana-sdk-ids", @@ -5845,13 +6362,23 @@ dependencies = [ "serde_with", ] +[[package]] +name = "solana-packet" +version = "4.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0ad62e1045c2347a0c0e219a6ceb0abfe904be622920996bfcac8d116fabe3c7" +dependencies = [ + "bitflags", + "solana-pubkey 4.1.0", +] + [[package]] name = "solana-perf" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "acd85605438c9eaae275815ae34c56e4dc2c1e35a4156d4fd66873a1045c382e" +checksum = "60c681205a42c004c5a66d90bebe30f646936041894f20acd941667a412a4a5f" dependencies = [ - "ahash 0.8.11", + "ahash 0.8.12", "bincode", "bv", "bytes", @@ -5868,13 +6395,14 @@ dependencies = [ "solana-hash 3.1.0", "solana-message", "solana-metrics", - "solana-packet", + "solana-packet 3.0.0", "solana-pubkey 3.0.0", "solana-rayon-threadlimit", "solana-sdk-ids", "solana-short-vec", "solana-signature", "solana-time-utils", + "solana-transaction-context 3.1.3", ] [[package]] @@ -5889,16 +6417,32 @@ dependencies = [ [[package]] name = "solana-poseidon" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "794ff76c70d6f4c5d9c86c626069225c0066043405c0c9d6b96f00c8525dade5" +checksum = "6e51c9ffecacac7691711b91e15f557af5ee652d0e8d66477f6c919b1ca4ed18" dependencies = [ - "ark-bn254", - "light-poseidon", + "ark-bn254 0.4.0", + "ark-bn254 0.5.0", + "light-poseidon 0.2.0", + "light-poseidon 0.4.0", "solana-define-syscall 3.0.0", "thiserror 2.0.18", ] +[[package]] +name = "solana-poseidon" +version = "4.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "737b8ab25bf4cc8e618f80f1fe40709b2ace708bc764a36b8a4c81eea8c07034" +dependencies = [ + "ark-bn254 0.4.0", + "ark-bn254 0.5.0", + "light-poseidon 0.2.0", + "light-poseidon 0.4.0", + "solana-define-syscall 4.0.1", + "thiserror 2.0.18", +] + [[package]] name = "solana-precompile-error" version = "3.0.0" @@ -5908,17 +6452,32 @@ dependencies = [ "num-traits", ] +[[package]] +name = "solana-program-binaries" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3fcc481513bd7af956e81bd0ba4b3830eaf2b5c2bdc66e2f605cf9aa39c83e51" +dependencies = [ + "bincode", + "serde", + "solana-account 3.4.0", + "solana-loader-v3-interface", + "solana-pubkey 3.0.0", + "solana-rent 3.1.0", + "solana-sdk-ids", + "spl-generic-token", +] + [[package]] name = "solana-program-entrypoint" -version = "3.1.0" +version = "3.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6557cf5b5e91745d1667447438a1baa7823c6086e4ece67f8e6ebfa7a8f72660" +checksum = "84c9b0a1ff494e05f503a08b3d51150b73aa639544631e510279d6375f290997" dependencies = [ "solana-account-info", - "solana-define-syscall 3.0.0", - "solana-msg", + "solana-define-syscall 4.0.1", "solana-program-error", - "solana-pubkey 3.0.0", + "solana-pubkey 4.1.0", ] [[package]] @@ -5939,6 +6498,12 @@ dependencies = [ "solana-define-syscall 3.0.0", ] +[[package]] +name = "solana-program-option" +version = "3.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "362279f6e8020e4cf11313233789bf619420ad8835ebc91963ee5cec91bb05da" + [[package]] name = "solana-program-pack" version = "3.0.0" @@ -5950,9 +6515,9 @@ dependencies = [ [[package]] name = "solana-program-runtime" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d6ec3fec9e5f8c01aa76e0d63911af6acb4ee840b6f7ec5ddee284552c0de60" +checksum = "1946dc97d7666617c6eb9231d07ffdfd36841ebef3b08e04e2dd2249c56843a1" dependencies = [ "base64 0.22.1", "bincode", @@ -5961,7 +6526,8 @@ dependencies = [ "percentage", "rand 0.8.5", "serde", - "solana-account 3.2.0", + "solana-account 3.4.0", + "solana-account-info", "solana-clock", "solana-epoch-rewards", "solana-epoch-schedule", @@ -5969,33 +6535,83 @@ dependencies = [ "solana-hash 3.1.0", "solana-instruction", "solana-last-restart-slot", + "solana-loader-v3-interface", "solana-program-entrypoint", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", - "solana-sbpf", + "solana-rent 3.1.0", + "solana-sbpf 0.13.1", "solana-sdk-ids", "solana-slot-hashes", - "solana-stake-interface 2.0.1", - "solana-svm-callback", - "solana-svm-feature-set", - "solana-svm-log-collector", - "solana-svm-measure", - "solana-svm-timings", - "solana-svm-transaction", - "solana-svm-type-overrides", + "solana-stable-layout", + "solana-stake-interface 2.0.2", + "solana-svm-callback 3.1.3", + "solana-svm-feature-set 3.1.3", + "solana-svm-log-collector 3.1.3", + "solana-svm-measure 3.1.3", + "solana-svm-timings 3.1.3", + "solana-svm-transaction 3.1.3", + "solana-svm-type-overrides 3.1.3", "solana-system-interface 2.0.0", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", "solana-sysvar-id", - "solana-transaction-context", + "solana-transaction-context 3.1.3", + "thiserror 2.0.18", +] + +[[package]] +name = "solana-program-runtime" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8cf8fdd9f188e33d040135d8d4b63e025780f132fbb9096ba293c118e51df200" +dependencies = [ + "base64 0.22.1", + "bincode", + "cfg-if", + "itertools 0.14.0", + "log", + "percentage", + "rand 0.9.2", + "serde", + "solana-account 3.4.0", + "solana-account-info", + "solana-clock", + "solana-epoch-rewards", + "solana-epoch-schedule", + "solana-fee-structure", + "solana-hash 4.2.0", + "solana-instruction", + "solana-last-restart-slot", + "solana-loader-v3-interface", + "solana-program-entrypoint", + "solana-pubkey 4.1.0", + "solana-rent 3.1.0", + "solana-sbpf 0.14.4", + "solana-sdk-ids", + "solana-slot-hashes", + "solana-stable-layout", + "solana-stake-interface 2.0.2", + "solana-svm-callback 4.0.0-beta.1", + "solana-svm-feature-set 4.0.0-beta.1", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-svm-measure 4.0.0-beta.1", + "solana-svm-timings 4.0.0-beta.1", + "solana-svm-transaction 4.0.0-beta.1", + "solana-svm-type-overrides 4.0.0-beta.1", + "solana-system-interface 3.1.0", + "solana-sysvar 3.1.1", + "solana-sysvar-id", + "solana-transaction-context 4.0.0-beta.1", + "thiserror 2.0.18", ] [[package]] name = "solana-program-test" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d828f0e8ff75dd2b745206ee4b965613a6f0caf7f502fc70d7c3e627abde46ff" +checksum = "3da3eb68baabb4b0c5f3e4d0961270f4dedab6db85a3298d1d5c9058e8640586" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", + "agave-logger", "assert_matches", "async-trait", "base64 0.22.1", @@ -6004,7 +6620,7 @@ dependencies = [ "crossbeam-channel", "log", "serde", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-account-info", "solana-accounts-db", "solana-banks-client", @@ -6013,7 +6629,7 @@ dependencies = [ "solana-clock", "solana-cluster-type", "solana-commitment-config", - "solana-compute-budget", + "solana-compute-budget 3.1.3", "solana-epoch-rewards", "solana-epoch-schedule", "solana-fee-calculator", @@ -6022,32 +6638,32 @@ dependencies = [ "solana-instruction", "solana-keypair", "solana-loader-v3-interface", - "solana-logger", "solana-message", "solana-msg", "solana-native-token", "solana-poh-config", + "solana-program-binaries", "solana-program-entrypoint", "solana-program-error", - "solana-program-runtime", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-runtime", - "solana-sbpf", + "solana-sbpf 0.13.1", "solana-sdk-ids", "solana-signer", "solana-stable-layout", - "solana-stake-interface 2.0.1", + "solana-stake-interface 2.0.2", "solana-svm", - "solana-svm-log-collector", - "solana-svm-timings", + "solana-svm-log-collector 3.1.3", + "solana-svm-timings 3.1.3", "solana-system-interface 2.0.0", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", "solana-sysvar-id", "solana-transaction", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", - "solana-vote-program", + "solana-vote-program 3.1.3", "spl-generic-token", "thiserror 2.0.18", "tokio", @@ -6069,14 +6685,15 @@ version = "4.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1b06bd918d60111ee1f97de817113e2040ca0cedb740099ee8d646233f6b906c" dependencies = [ + "rand 0.9.2", "solana-address 2.2.0", ] [[package]] name = "solana-pubsub-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1dc18dc70532b72eaa8df04683560b99b7177d1fea29f2f5bf3a4a79796df425" +checksum = "27b1fd9238ec0868382d1405a18d1d9dbf78fd8bfb1bc33c199d856400c4129b" dependencies = [ "crossbeam-channel", "futures-util", @@ -6084,7 +6701,6 @@ dependencies = [ "log", "semver", "serde", - "serde_derive", "serde_json", "solana-account-decoder-client-types", "solana-clock", @@ -6101,9 +6717,9 @@ dependencies = [ [[package]] name = "solana-quic-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "831453427ac891cba2eaa30051a8a1f1c0a7c8eb9d283cc75ee09ce16245d007" +checksum = "de5985d8dab9b47d28f81773afb3d3b96df9e4b785baf824628e5ff22c6d82b2" dependencies = [ "async-lock", "async-trait", @@ -6112,7 +6728,7 @@ dependencies = [ "log", "quinn", "quinn-proto", - "rustls 0.23.32", + "rustls", "solana-connection-cache", "solana-keypair", "solana-measure", @@ -6140,9 +6756,9 @@ dependencies = [ [[package]] name = "solana-rayon-threadlimit" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d977cc0f8132e2f7c317a03bc8cec328a4eacccba231cf12d7624bb97cb39ae3" +checksum = "4e4bc48c5884744db48e7c394cc563985828b869e3c49c6eb8d95d78777ffd35" dependencies = [ "log", "num_cpus", @@ -6150,9 +6766,9 @@ dependencies = [ [[package]] name = "solana-rent" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b702d8c43711e3c8a9284a4f1bbc6a3de2553deb25b0c8142f9a44ef0ce5ddc1" +checksum = "e860d5499a705369778647e97d760f7670adfb6fc8419dd3d568deccd46d5487" dependencies = [ "serde", "serde_derive", @@ -6163,9 +6779,9 @@ dependencies = [ [[package]] name = "solana-rent" -version = "4.0.0" +version = "4.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "763fe5c88a76ce18235db595b21d38b7aebf6db56b324cdf9fc96059f4410823" +checksum = "a1771d726d4854f1818c750e14aff40b19d84720d0b1b6d53e50e8f16cb6bd62" dependencies = [ "serde", "serde_derive", @@ -6186,9 +6802,9 @@ dependencies = [ [[package]] name = "solana-rpc-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2cc97cd8bbbe8fb74a76b2812629dae284e6f5446f7e84a98c3f854e4dc2621b" +checksum = "695f5c9e9afbb79269d173db59ec79993720b817212addc0367fc447e12eb0da" dependencies = [ "async-trait", "base64 0.22.1", @@ -6201,9 +6817,9 @@ dependencies = [ "reqwest-middleware", "semver", "serde", - "serde_derive", "serde_json", - "solana-account 3.2.0", + "solana-account 3.4.0", + "solana-account-decoder", "solana-account-decoder-client-types", "solana-clock", "solana-commitment-config", @@ -6220,22 +6836,21 @@ dependencies = [ "solana-transaction-error", "solana-transaction-status-client-types", "solana-version", - "solana-vote-interface 3.0.0", + "solana-vote-interface 4.0.4", "tokio", ] [[package]] name = "solana-rpc-client-api" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "26e5f5a813f457dff5a66dfe83eaa7e0e766be5251fc99922e9f2e48a2ebca2e" +checksum = "e6eeb20b0d1b0d4daaf2e2f8d5e2c008d8809282b2ccc1451c68d427d6662d78" dependencies = [ "anyhow", "jsonrpc-core", "reqwest", "reqwest-middleware", "serde", - "serde_derive", "serde_json", "solana-account-decoder-client-types", "solana-clock", @@ -6248,11 +6863,11 @@ dependencies = [ [[package]] name = "solana-rpc-client-nonce-utils" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b9902af67012d1e92b4a737e26329ae17c4678b5322ed841aa0018bfcfd7a033" +checksum = "694ee738ae2981a584f3ae984e53f4ea1deaca400147867ef030c42891e8de74" dependencies = [ - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-commitment-config", "solana-hash 3.1.0", "solana-message", @@ -6265,23 +6880,24 @@ dependencies = [ [[package]] name = "solana-rpc-client-types" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1a6d3a5969b7ccd2863012fa06daa35e152e264181d24b5153b974351faa9c40" +checksum = "151719868cc3fece2d268795951f732d74423ac64e6832e33aba00a76713d1e8" dependencies = [ "base64 0.22.1", "bs58", "semver", "serde", - "serde_derive", "serde_json", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-account-decoder-client-types", + "solana-address 1.1.0", "solana-clock", "solana-commitment-config", "solana-fee-calculator", "solana-inflation", - "solana-pubkey 3.0.0", + "solana-reward-info", + "solana-transaction", "solana-transaction-error", "solana-transaction-status-client-types", "solana-version", @@ -6291,15 +6907,18 @@ dependencies = [ [[package]] name = "solana-runtime" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a3e92c3f0652c772afd524d91119b70a4163bbf3449cf867444cb0efbdc3c0ed" +checksum = "6a778afa6c1fde03f12759fb6a3116c8a4d6c38d1b909dc2baa64a0528ead25a" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", + "agave-fs", "agave-precompiles", "agave-reserved-account-keys", - "agave-syscalls", - "ahash 0.8.11", + "agave-snapshots", + "agave-syscalls 3.1.3", + "agave-votor-messages", + "ahash 0.8.12", "aquamarine", "arc-swap", "arrayref", @@ -6318,7 +6937,7 @@ dependencies = [ "libc", "log", "lz4", - "memmap2 0.9.7", + "memmap2 0.9.10", "mockall", "modular-bitfield", "num-derive", @@ -6330,24 +6949,26 @@ dependencies = [ "rand 0.8.5", "rayon", "regex", + "semver", "serde", - "serde_derive", "serde_json", "serde_with", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-account-info", "solana-accounts-db", "solana-address-lookup-table-interface", - "solana-bpf-loader-program", + "solana-bls-signatures 1.0.0", + "solana-bpf-loader-program 3.1.3", "solana-bucket-map", "solana-builtins", "solana-client-traits", "solana-clock", "solana-cluster-type", "solana-commitment-config", - "solana-compute-budget", + "solana-compute-budget 3.1.3", "solana-compute-budget-instruction", "solana-compute-budget-interface", + "solana-config-interface", "solana-cost-model", "solana-cpi", "solana-ed25519-program", @@ -6374,14 +6995,14 @@ dependencies = [ "solana-nohash-hasher", "solana-nonce", "solana-nonce-account", - "solana-packet", + "solana-packet 3.0.0", "solana-perf", "solana-poh-config", "solana-precompile-error", - "solana-program-runtime", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", "solana-rayon-threadlimit", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-reward-info", "solana-runtime-transaction", "solana-sdk-ids", @@ -6393,69 +7014,84 @@ dependencies = [ "solana-signer", "solana-slot-hashes", "solana-slot-history", - "solana-stake-interface 2.0.1", - "solana-stake-program 3.0.10", + "solana-stake-interface 2.0.2", "solana-svm", - "solana-svm-callback", - "solana-svm-timings", - "solana-svm-transaction", + "solana-svm-callback 3.1.3", + "solana-svm-timings 3.1.3", + "solana-svm-transaction 3.1.3", "solana-system-interface 2.0.0", "solana-system-transaction", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", "solana-sysvar-id", "solana-time-utils", "solana-transaction", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", "solana-transaction-status-client-types", "solana-unified-scheduler-logic", "solana-version", "solana-vote", - "solana-vote-interface 3.0.0", - "solana-vote-program", + "solana-vote-interface 4.0.4", + "solana-vote-program 3.1.3", "spl-generic-token", "static_assertions", "strum 0.24.1", "strum_macros 0.24.3", "symlink", - "tar", "tempfile", "thiserror 2.0.18", - "zstd", ] [[package]] name = "solana-runtime-transaction" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "eefe5fab5fd673124acd1445b25e69a86a35b4cc06c21f41d15e2c6389120ff0" +checksum = "21d6fc87b6eed4b29530501d65c14bdac6c96cd8812deb81df66be4cc49b06bf" dependencies = [ "agave-transaction-view", "log", - "solana-compute-budget", + "solana-compute-budget 3.1.3", "solana-compute-budget-instruction", "solana-hash 3.1.0", "solana-message", "solana-pubkey 3.0.0", "solana-sdk-ids", "solana-signature", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", "solana-transaction", + "solana-transaction-context 3.1.3", "solana-transaction-error", "thiserror 2.0.18", ] [[package]] name = "solana-sanitize" -version = "3.0.0" +version = "3.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dcf09694a0fc14e5ffb18f9b7b7c0f15ecb6eac5b5610bf76a1853459d19daf9" + +[[package]] +name = "solana-sbpf" +version = "0.13.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "927e833259588ac8f860861db0f6e2668c3cc46d917798ade116858960acfe8a" +checksum = "b15b079e08471a9dbfe1e48b2c7439c85aa2a055cbd54eddd8bd257b0a7dbb29" +dependencies = [ + "byteorder", + "combine 3.8.1", + "hash32", + "libc", + "log", + "rand 0.8.5", + "rustc-demangle", + "thiserror 2.0.18", + "winapi", +] [[package]] name = "solana-sbpf" -version = "0.12.2" +version = "0.14.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0f224d906c14efc7ed7f42bc5fe9588f3f09db8cabe7f6023adda62a69678e1a" +checksum = "733b3657a0fab205102b799dbe17f85d3972cf984232c1b0b108fa6ba438e382" dependencies = [ "byteorder", "combine 3.8.1", @@ -6470,11 +7106,11 @@ dependencies = [ [[package]] name = "solana-sdk-ids" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b1b6d6aaf60669c592838d382266b173881c65fb1cdec83b37cb8ce7cb89f9ad" +checksum = "def234c1956ff616d46c9dd953f251fa7096ddbaa6d52b165218de97882b7280" dependencies = [ - "solana-pubkey 3.0.0", + "solana-address 2.2.0", ] [[package]] @@ -6505,12 +7141,12 @@ dependencies = [ [[package]] name = "solana-secp256k1-recover" -version = "3.0.0" +version = "3.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "394a4470477d66296af5217970a905b1c5569032a7732c367fb69e5666c8607e" +checksum = "e7c5f18893d62e6c73117dcba48f8f5e3266d90e5ec3d0a0a90f9785adac36c1" dependencies = [ "k256", - "solana-define-syscall 3.0.0", + "solana-define-syscall 5.0.0", "thiserror 2.0.18", ] @@ -6548,9 +7184,9 @@ dependencies = [ [[package]] name = "solana-send-transaction-service" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9a9ef499f45da422018cb8d9274d7bb10b71115d728f10edc8352a5d79c7359b" +checksum = "09b29b1bfc7f2fcf4fe86058187f23c218c634a43d13b8b5061d46b2349a9551" dependencies = [ "async-trait", "crossbeam-channel", @@ -6585,9 +7221,9 @@ dependencies = [ [[package]] name = "solana-serde-varint" -version = "3.0.0" +version = "3.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3e5174c57d5ff3c1995f274d17156964664566e2cde18a07bba1586d35a70d3b" +checksum = "950e5b83e839dc0f92c66afc124bb8f40e89bc90f0579e8ec5499296d27f54e3" dependencies = [ "serde", ] @@ -6605,22 +7241,22 @@ dependencies = [ [[package]] name = "solana-sha256-hasher" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a9b912ba6f71cb202c0c3773ec77bf898fa9fe0c78691a2d6859b3b5b8954719" +checksum = "db7dc3011ea4c0334aaaa7e7128cb390ecf546b28d412e9bf2064680f57f588f" dependencies = [ "sha2 0.10.8", - "solana-define-syscall 3.0.0", - "solana-hash 3.1.0", + "solana-define-syscall 4.0.1", + "solana-hash 4.2.0", ] [[package]] name = "solana-short-vec" -version = "3.0.0" +version = "3.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b69d029da5428fc1c57f7d49101b2077c61f049d4112cd5fb8456567cc7d2638" +checksum = "de3bd991c2cc415291c86bb0b6b4d53e93d13bb40344e4c5a2884e0e4f5fa93f" dependencies = [ - "serde", + "serde_core", ] [[package]] @@ -6662,13 +7298,13 @@ dependencies = [ [[package]] name = "solana-slot-hashes" -version = "3.0.0" +version = "3.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "80a293f952293281443c04f4d96afd9d547721923d596e92b4377ed2360f1746" +checksum = "2585f70191623887329dfb5078da3a00e15e3980ea67f42c2e10b07028419f43" dependencies = [ "serde", "serde_derive", - "solana-hash 3.1.0", + "solana-hash 4.2.0", "solana-sdk-ids", "solana-sysvar-id", ] @@ -6716,11 +7352,10 @@ dependencies = [ [[package]] name = "solana-stake-interface" -version = "2.0.1" +version = "2.0.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f6f912ae679b683365348dea482dbd9468d22ff258b554fd36e3d3683c2122e3" +checksum = "b9bc26191b533f9a6e5a14cca05174119819ced680a80febff2f5051a713f0db" dependencies = [ - "borsh", "num-traits", "serde", "serde_derive", @@ -6730,7 +7365,7 @@ dependencies = [ "solana-program-error", "solana-pubkey 3.0.0", "solana-system-interface 2.0.0", - "solana-sysvar 3.0.0", + "solana-sysvar 3.1.1", "solana-sysvar-id", ] @@ -6749,7 +7384,7 @@ dependencies = [ "serde_derive", "serde_json", "serial_test", - "solana-account 4.0.0", + "solana-account 4.1.0", "solana-borsh", "solana-clock", "solana-cpi", @@ -6761,7 +7396,7 @@ dependencies = [ "solana-pubkey 4.1.0", "solana-sdk-ids", "solana-stake-interface 3.0.0", - "solana-system-interface 3.0.0", + "solana-system-interface 3.1.0", "solana-sysvar 4.0.0", "solana-sysvar-id", "static_assertions", @@ -6771,39 +7406,30 @@ dependencies = [ ] [[package]] -name = "solana-stake-program" -version = "3.0.10" +name = "solana-stake-interface" +version = "3.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "06f174d24c78d8874c4c28cb855bfe87f720c7e40362ea1b856c4a65abdc6209" +checksum = "cd714713337a7f5b513e02119f484fb9b7e056c6ce74af30e70505f2e62b64b7" dependencies = [ - "agave-feature-set", - "bincode", - "log", - "solana-account 3.2.0", - "solana-bincode", + "borsh", + "num-traits", + "serde", + "serde_derive", "solana-clock", - "solana-config-interface", - "solana-genesis-config", + "solana-cpi", "solana-instruction", - "solana-native-token", - "solana-packet", - "solana-program-runtime", - "solana-pubkey 3.0.0", - "solana-rent 3.0.0", - "solana-sdk-ids", - "solana-stake-interface 2.0.1", - "solana-svm-log-collector", - "solana-svm-type-overrides", - "solana-sysvar 3.0.0", - "solana-transaction-context", - "solana-vote-interface 3.0.0", + "solana-program-error", + "solana-pubkey 4.1.0", + "solana-system-interface 3.1.0", + "solana-sysvar 4.0.0", + "solana-sysvar-id", ] [[package]] name = "solana-stake-program" version = "4.0.0" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "arbitrary", "assert_matches", "bincode", @@ -6811,7 +7437,8 @@ dependencies = [ "mollusk-svm-result", "proptest", "rand 0.10.0", - "solana-account 3.2.0", + "solana-account 3.4.0", + "solana-account 4.1.0", "solana-account-info", "solana-clock", "solana-config-interface", @@ -6827,29 +7454,28 @@ dependencies = [ "solana-program-entrypoint", "solana-program-error", "solana-program-test", - "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-pubkey 4.1.0", + "solana-rent 4.1.0", "solana-sdk-ids", "solana-signature", "solana-signer", - "solana-stake-interface 2.0.1", - "solana-svm-log-collector", - "solana-system-interface 2.0.0", - "solana-sysvar 3.0.0", + "solana-stake-interface 3.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-system-interface 3.1.0", + "solana-sysvar 4.0.0", "solana-sysvar-id", "solana-transaction", - "solana-vote-interface 4.0.4", + "solana-vote-interface 5.1.1", "test-case", ] [[package]] name = "solana-streamer" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "93b8636508e20281a495a33b213f2e19c6b6828419d5c2daa3766411355144e3" +checksum = "899889e499eaa2faed76e271c52d867ea69ddc22b40274df837a89b8ab6c1e89" dependencies = [ "arc-swap", - "async-channel", "bytes", "crossbeam-channel", "dashmap", @@ -6857,7 +7483,7 @@ dependencies = [ "futures-util", "governor", "histogram", - "indexmap 2.10.0", + "indexmap 2.13.0", "itertools 0.12.1", "libc", "log", @@ -6868,14 +7494,14 @@ dependencies = [ "quinn", "quinn-proto", "rand 0.8.5", - "rustls 0.23.32", + "rustls", "smallvec", - "socket2 0.6.0", + "socket2 0.6.3", "solana-keypair", "solana-measure", "solana-metrics", "solana-net-utils", - "solana-packet", + "solana-packet 3.0.0", "solana-perf", "solana-pubkey 3.0.0", "solana-quic-definitions", @@ -6893,16 +7519,15 @@ dependencies = [ [[package]] name = "solana-svm" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0ef1ffa2586ff7023f6dde1b8fd0523557938ef08ac0b7c19b092da2eea6e834" +checksum = "95e4f9b2f74565d69ec3041f6540e0a4b4a4f654648f54f3e04c9c3f28477277" dependencies = [ - "ahash 0.8.11", + "ahash 0.8.12", "log", "percentage", "serde", - "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-clock", "solana-fee-structure", "solana-hash 3.1.0", @@ -6910,26 +7535,26 @@ dependencies = [ "solana-instructions-sysvar", "solana-loader-v3-interface", "solana-loader-v4-interface", - "solana-loader-v4-program", + "solana-loader-v4-program 3.1.3", "solana-message", "solana-nonce", "solana-nonce-account", "solana-program-entrypoint", "solana-program-pack", - "solana-program-runtime", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-sdk-ids", - "solana-svm-callback", - "solana-svm-feature-set", - "solana-svm-log-collector", - "solana-svm-measure", - "solana-svm-timings", - "solana-svm-transaction", - "solana-svm-type-overrides", + "solana-svm-callback 3.1.3", + "solana-svm-feature-set 3.1.3", + "solana-svm-log-collector 3.1.3", + "solana-svm-measure 3.1.3", + "solana-svm-timings 3.1.3", + "solana-svm-transaction 3.1.3", + "solana-svm-type-overrides 3.1.3", "solana-system-interface 2.0.0", "solana-sysvar-id", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", "spl-generic-token", "thiserror 2.0.18", @@ -6937,53 +7562,97 @@ dependencies = [ [[package]] name = "solana-svm-callback" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d2211ecefc92a3d6db1206eca32aa579bb112eb1a2823ac227d8cbd5cdb0465" +checksum = "e2a3d780b1ab2f2cfb55f41e192b78c2e80e3224cf0c6de77343552bcbd7bc57" dependencies = [ - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-clock", "solana-precompile-error", "solana-pubkey 3.0.0", ] +[[package]] +name = "solana-svm-callback" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "de2826ade77d8b6a4cff419c966002b62aaf8d305298f1a058fff3349a701616" +dependencies = [ + "solana-account 3.4.0", + "solana-clock", + "solana-precompile-error", + "solana-pubkey 4.1.0", +] + [[package]] name = "solana-svm-feature-set" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6a35cded5bc9e32d84c98d81bb9811239d3aea03d0f5ef09aa2f1e8cdaf2d0ff" +checksum = "4639fc59e29da44c4010fb672db9980c26d8073892f07aad568be32e00acf9d4" + +[[package]] +name = "solana-svm-feature-set" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f182da549443fdf0b3a786e7138a131c01ffa0d4d621f46381e6e0dee2bab8c" [[package]] name = "solana-svm-log-collector" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "455455f9ef91bb738c2363284cd8b6f5956726b0a366ab85976dca23ee1611a4" +checksum = "93afa0242ccc1ec642845f75773ba5aaf63a3cd0953dd2d09d47beb2ca4e8fe2" +dependencies = [ + "log", +] + +[[package]] +name = "solana-svm-log-collector" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "42ba0b4b95e4e7d732e765a669e57c510f3e0785921d68c1930e17e7c384fa03" dependencies = [ "log", ] [[package]] name = "solana-svm-measure" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3e3c0ecb1caf08e9d70e41ca99bb18550e05e9a40dce8866fd1c360e67fa78c5" +checksum = "69ff602eec3e6df1cac6693da4aec76e66c2fc1ee8420635995352df0d3bfc6b" + +[[package]] +name = "solana-svm-measure" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4d120b3e3689884aec0d7d5c4403c69225bf5cd083353390aca5b302a85d0cd1" [[package]] name = "solana-svm-timings" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "62606f820fe99b72ee8e26b8e20eed3c2ccc2f6e3146f537c4cb22a442c69170" +checksum = "60a9d32decdf9487b8d5bed7f1a4eb3d80cfa95e108b69272d91a0d6be918b82" dependencies = [ "eager", - "enum-iterator", + "enum-iterator 1.5.0", "solana-pubkey 3.0.0", ] +[[package]] +name = "solana-svm-timings" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "915b94fb66797525a2cd543f3bda2cbe3686edcb5b3e0791fdf256d2bc0f9e08" +dependencies = [ + "eager", + "enum-iterator 2.3.0", + "solana-pubkey 4.1.0", +] + [[package]] name = "solana-svm-transaction" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "336583f8418964f7050b98996e13151857995604fe057c0d8f2f3512a16d3a8b" +checksum = "23b071f7ae92dedb3e947af983ff4e6e9f721bca431e336ab2ed2d2a90fdb8cd" dependencies = [ "solana-hash 3.1.0", "solana-message", @@ -6993,15 +7662,38 @@ dependencies = [ "solana-transaction", ] +[[package]] +name = "solana-svm-transaction" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "814956ccf1f7f15440746f15e15529bef388062bf4c0b247ee09946dd6148ef2" +dependencies = [ + "solana-hash 4.2.0", + "solana-message", + "solana-pubkey 4.1.0", + "solana-sdk-ids", + "solana-signature", + "solana-transaction", +] + [[package]] name = "solana-svm-type-overrides" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f802b43ced1f9c6a2bf3b8c740dd43e194f33b3c98a6b3e3d0f989f632ec3ccc" +checksum = "0e1ace47d2d211d9a43655a76866b4c8cfcdd751d9f4c3fa0f6a46e049d04218" dependencies = [ "rand 0.8.5", ] +[[package]] +name = "solana-svm-type-overrides" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0a601cc64cdb6e0714c480f3239ad2b404949663e5fd9637c76fd442b1d3d34c" +dependencies = [ + "rand 0.9.2", +] + [[package]] name = "solana-system-interface" version = "2.0.0" @@ -7019,9 +7711,9 @@ dependencies = [ [[package]] name = "solana-system-interface" -version = "3.0.0" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "14591d6508042ebefb110305d3ba761615927146a26917ade45dc332d8e1ecde" +checksum = "a95a6f2e23ed861d6444ad4a6d6896c418d7d101b960787e65a8e33157cee81b" dependencies = [ "num-traits", "serde", @@ -7034,29 +7726,54 @@ dependencies = [ [[package]] name = "solana-system-program" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b4c68c4e74ea2d55e59cab3346781156c456850a781f07cb6bc0fdbd52fba55b" +checksum = "a6a7a47efcfe3ada26f190077a0d90dfcffa7e08fc0174a5fce75b0159761b59" dependencies = [ "bincode", "log", "serde", - "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-bincode", "solana-fee-calculator", "solana-instruction", "solana-nonce", "solana-nonce-account", - "solana-packet", - "solana-program-runtime", + "solana-packet 3.0.0", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", "solana-sdk-ids", - "solana-svm-log-collector", - "solana-svm-type-overrides", + "solana-svm-log-collector 3.1.3", + "solana-svm-type-overrides 3.1.3", "solana-system-interface 2.0.0", - "solana-sysvar 3.0.0", - "solana-transaction-context", + "solana-sysvar 3.1.1", + "solana-transaction-context 3.1.3", +] + +[[package]] +name = "solana-system-program" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a1d938ef751618305b47d71337e269dcbb7b37adc4cd756dde9b3053ed24a17" +dependencies = [ + "bincode", + "log", + "serde", + "solana-account 3.4.0", + "solana-bincode", + "solana-fee-calculator", + "solana-instruction", + "solana-nonce", + "solana-nonce-account", + "solana-packet 4.1.0", + "solana-program-runtime 4.0.0-beta.1", + "solana-pubkey 4.1.0", + "solana-sdk-ids", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-svm-type-overrides 4.0.0-beta.1", + "solana-system-interface 3.1.0", + "solana-sysvar 3.1.1", + "solana-transaction-context 4.0.0-beta.1", ] [[package]] @@ -7076,9 +7793,9 @@ dependencies = [ [[package]] name = "solana-sysvar" -version = "3.0.0" +version = "3.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "63205e68d680bcc315337dec311b616ab32fea0a612db3b883ce4de02e0953f9" +checksum = "6690d3dd88f15c21edff68eb391ef8800df7a1f5cec84ee3e8d1abf05affdf74" dependencies = [ "base64 0.22.1", "bincode", @@ -7087,18 +7804,18 @@ dependencies = [ "serde_derive", "solana-account-info", "solana-clock", - "solana-define-syscall 3.0.0", + "solana-define-syscall 4.0.1", "solana-epoch-rewards", "solana-epoch-schedule", "solana-fee-calculator", - "solana-hash 3.1.0", + "solana-hash 4.2.0", "solana-instruction", "solana-last-restart-slot", "solana-program-entrypoint", "solana-program-error", "solana-program-memory", - "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-pubkey 4.1.0", + "solana-rent 3.1.0", "solana-sdk-ids", "solana-sdk-macro", "solana-slot-hashes", @@ -7132,7 +7849,7 @@ dependencies = [ "solana-program-error", "solana-program-memory", "solana-pubkey 4.1.0", - "solana-rent 4.0.0", + "solana-rent 4.1.0", "solana-sdk-ids", "solana-sdk-macro", "solana-slot-hashes", @@ -7158,11 +7875,11 @@ checksum = "0ced92c60aa76ec4780a9d93f3bd64dfa916e1b998eacc6f1c110f3f444f02c9" [[package]] name = "solana-tls-utils" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "213b0b783dc59c113821478ab18da70b7b143ef69b194b7975fcdda20372130c" +checksum = "39ecf07b047c05d08d234ad99b90050e043c5024b484ba82cf25b1f9517baa01" dependencies = [ - "rustls 0.23.32", + "rustls", "solana-keypair", "solana-pubkey 3.0.0", "solana-signer", @@ -7171,14 +7888,14 @@ dependencies = [ [[package]] name = "solana-tpu-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "eebf10061d061815585f32ea318e6dc71aa253dde5c4ad527bd973b71656c0b4" +checksum = "73b148fd0833086cb75a8d38d341752f5c1f082d73d3150cc45b47032e5d0fe8" dependencies = [ "async-trait", "bincode", "futures-util", - "indexmap 2.10.0", + "indexmap 2.13.0", "indicatif", "log", "rayon", @@ -7205,15 +7922,15 @@ dependencies = [ [[package]] name = "solana-tpu-client-next" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8091cd93c843a7a7d3496002590aea8796b7c5f55ffc03d34746fc0674804286" +checksum = "41f263f57157eb064d835572a4e130b1ea0b5d5ade7dffba73edb1f3b043bfa3" dependencies = [ "async-trait", "log", "lru", "quinn", - "rustls 0.23.32", + "rustls", "solana-clock", "solana-connection-cache", "solana-keypair", @@ -7232,9 +7949,9 @@ dependencies = [ [[package]] name = "solana-transaction" -version = "3.0.2" +version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2ceb2efbf427a91b884709ffac4dac29117752ce1e37e9ae04977e450aa0bb76" +checksum = "96697cff5075a028265324255efed226099f6d761ca67342b230d09f72cc48d2" dependencies = [ "bincode", "serde", @@ -7254,20 +7971,36 @@ dependencies = [ [[package]] name = "solana-transaction-context" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f9c6820c3a14bd07b2256640bd64af4a44ac49f505dca93cc11f77bc79cfd44a" +checksum = "fd9a056caa8b6bc1f47db81e6b92da836b2aa3cf20553ab49a1a2b2ab8fde31e" dependencies = [ "bincode", - "qualifier_attr", "serde", - "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-instruction", "solana-instructions-sysvar", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", - "solana-sbpf", + "solana-rent 3.1.0", + "solana-sbpf 0.13.1", + "solana-sdk-ids", +] + +[[package]] +name = "solana-transaction-context" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2007c649cb91437e32ac48a19b9598fe331df25454343419a2aad7e7c6902c4f" +dependencies = [ + "bincode", + "qualifier_attr", + "serde", + "solana-account 3.4.0", + "solana-instruction", + "solana-instructions-sysvar", + "solana-pubkey 4.1.0", + "solana-rent 3.1.0", + "solana-sbpf 0.14.4", "solana-sdk-ids", ] @@ -7285,15 +8018,15 @@ dependencies = [ [[package]] name = "solana-transaction-metrics-tracker" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f80e292c487f87712db7962dbe648054e362c37bd5dbdc7d28efcfc4d9ef1217" +checksum = "a34f0be8c181093704032287650a52d2a884eba81614aa4c404a7ec43bca7b7c" dependencies = [ "base64 0.22.1", "bincode", "log", "rand 0.8.5", - "solana-packet", + "solana-packet 3.0.0", "solana-perf", "solana-short-vec", "solana-signature", @@ -7301,15 +8034,14 @@ dependencies = [ [[package]] name = "solana-transaction-status-client-types" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "42333c56ebbbaab0a354c0a5ad621c0640b136e4ba0db3ba56d12b0500b27071" +checksum = "5b68112658f8ed0901054d3d1e7fcce3bedab88f190ca1b00ac5f121384cdb3b" dependencies = [ "base64 0.22.1", "bincode", "bs58", "serde", - "serde_derive", "serde_json", "solana-account-decoder-client-types", "solana-commitment-config", @@ -7319,16 +8051,16 @@ dependencies = [ "solana-reward-info", "solana-signature", "solana-transaction", - "solana-transaction-context", + "solana-transaction-context 3.1.3", "solana-transaction-error", "thiserror 2.0.18", ] [[package]] name = "solana-udp-client" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f25cf8797c360193e9500aa8c96fa969cd27ac5f4a03928616bb45acedda391a" +checksum = "b1ccd63a4899f45e080d061de4da2cf60c3bf4d61397d6b211e7be4b9190efd3" dependencies = [ "async-trait", "solana-connection-cache", @@ -7342,9 +8074,9 @@ dependencies = [ [[package]] name = "solana-unified-scheduler-logic" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9151a3f80cb570d848fe8ff2985d2e8f84df49b832a9434ed255065c5e670e9c" +checksum = "5d0693e556093104277518e1832b1b1d9fb3e6d991620bfba238327e501d030a" dependencies = [ "assert_matches", "solana-pubkey 3.0.0", @@ -7356,52 +8088,50 @@ dependencies = [ [[package]] name = "solana-version" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "44177fea32b10c8b9f3c19ba13ea21c5abc163d1cfb7a134fe16449f13f7c5b2" +checksum = "3e04d8d5ea770807f8cd6ef57bd493a9856085127045d241509be0790b3de7fb" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "rand 0.8.5", "semver", "serde", - "serde_derive", "solana-sanitize", "solana-serde-varint", ] [[package]] name = "solana-vote" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "073d95f8c00bc11ec692d3b3ce896f84e16e9ac107f32a73c9b2224d84b5fced" +checksum = "2222b5be4809768448faf3313f07ef743250aa2a710ea28853c010134cfd6db6" dependencies = [ "itertools 0.12.1", "log", "serde", - "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-bincode", "solana-clock", "solana-hash 3.1.0", "solana-instruction", "solana-keypair", - "solana-packet", + "solana-packet 3.0.0", "solana-pubkey 3.0.0", "solana-sdk-ids", "solana-serialize-utils", "solana-signature", "solana-signer", - "solana-svm-transaction", + "solana-svm-transaction 3.1.3", "solana-transaction", - "solana-vote-interface 3.0.0", + "solana-vote-interface 4.0.4", "thiserror 2.0.18", ] [[package]] name = "solana-vote-interface" -version = "3.0.0" +version = "4.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "66631ddbe889dab5ec663294648cd1df395ec9df7a4476e7b3e095604cfdb539" +checksum = "db6e123e16bfdd7a81d71b4c4699e0b29580b619f4cd2ef5b6aae1eb85e8979f" dependencies = [ "bincode", "cfg_eval", @@ -7415,7 +8145,7 @@ dependencies = [ "solana-instruction", "solana-instruction-error", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-sdk-ids", "solana-serde-varint", "solana-serialize-utils", @@ -7425,9 +8155,9 @@ dependencies = [ [[package]] name = "solana-vote-interface" -version = "4.0.4" +version = "5.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "db6e123e16bfdd7a81d71b4c4699e0b29580b619f4cd2ef5b6aae1eb85e8979f" +checksum = "d444ce30b6b4f9c281ba06061ea96638d063b53c2171b1e41ba02ebff79ed28f" dependencies = [ "bincode", "cfg_eval", @@ -7437,73 +8167,160 @@ dependencies = [ "serde_derive", "serde_with", "solana-clock", - "solana-hash 3.1.0", + "solana-hash 4.2.0", "solana-instruction", "solana-instruction-error", - "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-pubkey 4.1.0", + "solana-rent 4.1.0", "solana-sdk-ids", "solana-serde-varint", "solana-serialize-utils", "solana-short-vec", - "solana-system-interface 2.0.0", + "solana-system-interface 3.1.0", ] [[package]] name = "solana-vote-program" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "76271ecc50cdb46fd4c792f9d6078e60d1e2fb6ac2e21e3134085f9bf4159554" +checksum = "e25b1cebb26a3e4cce242612beb2bb2ada3a51e99d76a1cbece67591769273e7" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "bincode", "log", "num-derive", "num-traits", "serde", - "serde_derive", - "solana-account 3.2.0", + "solana-account 3.4.0", "solana-bincode", "solana-clock", "solana-epoch-schedule", "solana-hash 3.1.0", "solana-instruction", "solana-keypair", - "solana-packet", - "solana-program-runtime", + "solana-packet 3.0.0", + "solana-program-runtime 3.1.3", "solana-pubkey 3.0.0", - "solana-rent 3.0.0", + "solana-rent 3.1.0", "solana-sdk-ids", "solana-signer", "solana-slot-hashes", "solana-transaction", - "solana-transaction-context", - "solana-vote-interface 3.0.0", + "solana-transaction-context 3.1.3", + "solana-vote-interface 4.0.4", + "thiserror 2.0.18", +] + +[[package]] +name = "solana-vote-program" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a98ed8cdf386aeff5da0dcfef2488596f2a620c99ffbbd00583f8a922a27117b" +dependencies = [ + "agave-feature-set 4.0.0-beta.1", + "bincode", + "log", + "num-derive", + "num-traits", + "serde", + "solana-account 3.4.0", + "solana-bincode", + "solana-bls-signatures 3.1.0", + "solana-clock", + "solana-epoch-schedule", + "solana-hash 4.2.0", + "solana-instruction", + "solana-keypair", + "solana-packet 4.1.0", + "solana-program-runtime 4.0.0-beta.1", + "solana-pubkey 4.1.0", + "solana-rent 3.1.0", + "solana-sdk-ids", + "solana-signer", + "solana-slot-hashes", + "solana-system-interface 3.1.0", + "solana-transaction", + "solana-transaction-context 4.0.0-beta.1", + "solana-vote-interface 5.1.1", "thiserror 2.0.18", ] [[package]] name = "solana-zk-elgamal-proof-program" -version = "3.0.10" +version = "3.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "98159849b2040a4815ce02e30590a43bb6866fcaeb7ec46e62e6fc11fd8738dc" +dependencies = [ + "agave-feature-set 3.1.3", + "bytemuck", + "num-derive", + "num-traits", + "solana-instruction", + "solana-program-runtime 3.1.3", + "solana-sdk-ids", + "solana-svm-log-collector 3.1.3", + "solana-zk-sdk 4.0.0", +] + +[[package]] +name = "solana-zk-elgamal-proof-program" +version = "4.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "378de349b2722aaccff06b24f8709304a37325998dc1bf7f98fdafabd9b399d8" +dependencies = [ + "agave-feature-set 4.0.0-beta.1", + "bytemuck", + "num-derive", + "num-traits", + "solana-instruction", + "solana-program-runtime 4.0.0-beta.1", + "solana-sdk-ids", + "solana-svm-log-collector 4.0.0-beta.1", + "solana-zk-sdk 5.0.1", +] + +[[package]] +name = "solana-zk-sdk" +version = "4.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "27a10e5f73160da55ab35471443edfaa551503514571cc63c34a4d0a10b0ff45" +checksum = "9602bcb1f7af15caef92b91132ec2347e1c51a72ecdbefdaefa3eac4b8711475" dependencies = [ - "agave-feature-set", + "aes-gcm-siv", + "base64 0.22.1", + "bincode", "bytemuck", + "bytemuck_derive", + "curve25519-dalek 4.1.3", + "getrandom 0.2.15", + "itertools 0.12.1", + "js-sys", + "merlin", "num-derive", "num-traits", + "rand 0.8.5", + "serde", + "serde_derive", + "serde_json", + "sha3", + "solana-derivation-path", "solana-instruction", - "solana-program-runtime", + "solana-pubkey 3.0.0", "solana-sdk-ids", - "solana-svm-log-collector", - "solana-zk-sdk", + "solana-seed-derivable", + "solana-seed-phrase", + "solana-signature", + "solana-signer", + "subtle", + "thiserror 2.0.18", + "wasm-bindgen", + "zeroize", ] [[package]] name = "solana-zk-sdk" -version = "4.0.0" +version = "5.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9602bcb1f7af15caef92b91132ec2347e1c51a72ecdbefdaefa3eac4b8711475" +checksum = "09670ff59f60e6ddc2209c2e4353992a9b9f01d4e244f3e9d67bd5146e33d388" dependencies = [ "aes-gcm-siv", "base64 0.22.1", @@ -7511,9 +8328,7 @@ dependencies = [ "bytemuck", "bytemuck_derive", "curve25519-dalek 4.1.3", - "getrandom 0.2.15", - "itertools 0.12.1", - "js-sys", + "itertools 0.14.0", "merlin", "num-derive", "num-traits", @@ -7522,9 +8337,9 @@ dependencies = [ "serde_derive", "serde_json", "sha3", + "solana-address 2.2.0", "solana-derivation-path", "solana-instruction", - "solana-pubkey 3.0.0", "solana-sdk-ids", "solana-seed-derivable", "solana-seed-phrase", @@ -7532,32 +8347,31 @@ dependencies = [ "solana-signer", "subtle", "thiserror 2.0.18", - "wasm-bindgen", "zeroize", ] [[package]] name = "solana-zk-token-proof-program" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f48e57c79397d1c2bc34a5de7600ed09aad047958f1d36ba4aee4cb6993a5b01" +checksum = "cbfe01c829b6797939034c5524eed46fc558c8ff1dac6e86d9b21681f2cbbb09" dependencies = [ - "agave-feature-set", + "agave-feature-set 3.1.3", "bytemuck", "num-derive", "num-traits", "solana-instruction", - "solana-program-runtime", + "solana-program-runtime 3.1.3", "solana-sdk-ids", - "solana-svm-log-collector", + "solana-svm-log-collector 3.1.3", "solana-zk-token-sdk", ] [[package]] name = "solana-zk-token-sdk" -version = "3.0.10" +version = "3.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ef89a6d71457129ed9686cd24018b86c10de0c07697b6b6a572fd0bbcb9bed94" +checksum = "5cae28b0bffeeb4431c12fb3b95f7afe748d81f7b3862a8a8770a84aff9b8282" dependencies = [ "aes-gcm-siv", "base64 0.22.1", @@ -7571,10 +8385,9 @@ dependencies = [ "num-traits", "rand 0.8.5", "serde", - "serde_derive", "serde_json", "sha3", - "solana-curve25519", + "solana-curve25519 3.1.3", "solana-derivation-path", "solana-instruction", "solana-pubkey 3.0.0", @@ -7607,6 +8420,42 @@ dependencies = [ "der", ] +[[package]] +name = "spl-discriminator" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d48cc11459e265d5b501534144266620289720b4c44522a47bc6b63cd295d2f3" +dependencies = [ + "bytemuck", + "solana-program-error", + "solana-sha256-hasher", + "spl-discriminator-derive", +] + +[[package]] +name = "spl-discriminator-derive" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d9e8418ea6269dcfb01c712f0444d2c75542c04448b480e87de59d2865edc750" +dependencies = [ + "quote", + "spl-discriminator-syn", + "syn 2.0.114", +] + +[[package]] +name = "spl-discriminator-syn" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5d1dbc82ab91422345b6df40a79e2b78c7bce1ebb366da323572dd60b7076b67" +dependencies = [ + "proc-macro2", + "quote", + "sha2 0.10.8", + "syn 2.0.114", + "thiserror 1.0.69", +] + [[package]] name = "spl-generic-token" version = "2.0.1" @@ -7617,6 +8466,159 @@ dependencies = [ "solana-pubkey 3.0.0", ] +[[package]] +name = "spl-pod" +version = "0.7.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d6f3df240f67bea453d4bc5749761e45436d14b9457ed667e0300555d5c271f3" +dependencies = [ + "borsh", + "bytemuck", + "bytemuck_derive", + "num-derive", + "num-traits", + "num_enum", + "solana-program-error", + "solana-program-option", + "solana-pubkey 3.0.0", + "solana-zk-sdk 4.0.0", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-token-2022-interface" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0888304af6b3d839e435712e6c84025e09513017425ff62045b6b8c41feb77d9" +dependencies = [ + "arrayref", + "bytemuck", + "num-derive", + "num-traits", + "num_enum", + "solana-account-info", + "solana-instruction", + "solana-program-error", + "solana-program-option", + "solana-program-pack", + "solana-pubkey 3.0.0", + "solana-sdk-ids", + "solana-zk-sdk 4.0.0", + "spl-pod", + "spl-token-confidential-transfer-proof-extraction", + "spl-token-confidential-transfer-proof-generation", + "spl-token-group-interface", + "spl-token-metadata-interface", + "spl-type-length-value", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-token-confidential-transfer-proof-extraction" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "879a9ebad0d77383d3ea71e7de50503554961ff0f4ef6cbca39ad126e6f6da3a" +dependencies = [ + "bytemuck", + "solana-account-info", + "solana-curve25519 3.1.3", + "solana-instruction", + "solana-instructions-sysvar", + "solana-msg", + "solana-program-error", + "solana-pubkey 3.0.0", + "solana-sdk-ids", + "solana-zk-sdk 4.0.0", + "spl-pod", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-token-confidential-transfer-proof-generation" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a0cd59fce3dc00f563c6fa364d67c3f200d278eae681f4dc250240afcfe044b1" +dependencies = [ + "curve25519-dalek 4.1.3", + "solana-zk-sdk 4.0.0", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-token-group-interface" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "452d0f758af20caaa10d9a6f7608232e000d4c74462f248540b3d2ddfa419776" +dependencies = [ + "bytemuck", + "num-derive", + "num-traits", + "num_enum", + "solana-instruction", + "solana-program-error", + "solana-pubkey 3.0.0", + "spl-discriminator", + "spl-pod", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-token-interface" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c564ac05a7c8d8b12e988a37d82695b5ba4db376d07ea98bc4882c81f96c7f3" +dependencies = [ + "arrayref", + "bytemuck", + "num-derive", + "num-traits", + "num_enum", + "solana-instruction", + "solana-program-error", + "solana-program-option", + "solana-program-pack", + "solana-pubkey 3.0.0", + "solana-sdk-ids", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-token-metadata-interface" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9c467c7c3bd056f8fe60119e7ec34ddd6f23052c2fa8f1f51999098063b72676" +dependencies = [ + "borsh", + "num-derive", + "num-traits", + "solana-borsh", + "solana-instruction", + "solana-program-error", + "solana-pubkey 3.0.0", + "spl-discriminator", + "spl-pod", + "spl-type-length-value", + "thiserror 2.0.18", +] + +[[package]] +name = "spl-type-length-value" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca20a1a19f4507a98ca4b28ff5ed54cac9b9d34ed27863e2bde50a3238f9a6ac" +dependencies = [ + "bytemuck", + "num-derive", + "num-traits", + "num_enum", + "solana-account-info", + "solana-msg", + "solana-program-error", + "spl-discriminator", + "spl-pod", + "thiserror 2.0.18", +] + [[package]] name = "stable_deref_trait" version = "1.2.0" @@ -7741,6 +8743,12 @@ dependencies = [ "syn 2.0.114", ] +[[package]] +name = "tap" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "55937e1799185b12863d447f42597ed69d9928686b8d88a1df17376a097d8369" + [[package]] name = "tar" version = "0.4.44" @@ -7789,15 +8797,15 @@ dependencies = [ [[package]] name = "tempfile" -version = "3.20.0" +version = "3.26.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e8a64e3985349f2441a1a9ef0b853f869006c3855f2cda6862a94d26ebb9d6a1" +checksum = "82a72c767771b47409d2345987fda8628641887d5466101319899796367354a0" dependencies = [ "fastrand", - "getrandom 0.3.1", + "getrandom 0.4.1", "once_cell", - "rustix 1.0.8", - "windows-sys 0.59.0", + "rustix 1.1.4", + "windows-sys 0.61.1", ] [[package]] @@ -7889,6 +8897,15 @@ dependencies = [ "once_cell", ] +[[package]] +name = "threadpool" +version = "1.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d050e60b33d41c19108b32cea32164033a9013fe3b46cbd4457559bfbf77afaa" +dependencies = [ + "num_cpus", +] + [[package]] name = "time" version = "0.3.47" @@ -7947,52 +8964,39 @@ checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20" [[package]] name = "tokio" -version = "1.47.1" +version = "1.50.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "89e49afdadebb872d3145a5638b59eb0691ea23e46ca484037cfab3b76b95038" +checksum = "27ad5e34374e03cfffefc301becb44e9dc3c17584f414349ebe29ed26661822d" dependencies = [ - "backtrace", "bytes", - "io-uring", "libc", "mio", "parking_lot", "pin-project-lite", "signal-hook-registry", - "slab", - "socket2 0.6.0", + "socket2 0.6.3", "tokio-macros", - "windows-sys 0.59.0", + "windows-sys 0.61.1", ] [[package]] name = "tokio-macros" -version = "2.5.0" +version = "2.6.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6e06d43f1345a3bcd39f6a56dbb7dcab2ba47e68e8ac134855e7e2bdbaf8cab8" +checksum = "5c55a2eff8b69ce66c84f85e1da1c233edc36ceb85a2058d11b0d6a3c7e7569c" dependencies = [ "proc-macro2", "quote", "syn 2.0.114", ] -[[package]] -name = "tokio-rustls" -version = "0.24.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c28327cf380ac148141087fbfb9de9d7bd4e84ab5d2c28fbc911d753de8a7081" -dependencies = [ - "rustls 0.21.12", - "tokio", -] - [[package]] name = "tokio-rustls" version = "0.26.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8e727b36a1a0e8b74c376ac2211e40c2c8af09fb4013c60d910495810f008e9b" dependencies = [ - "rustls 0.23.32", + "rustls", "tokio", ] @@ -8004,7 +9008,7 @@ checksum = "911a61637386b789af998ee23f50aa30d5fd7edcec8d6d3dedae5e5815205466" dependencies = [ "bincode", "bytes", - "educe", + "educe 0.4.23", "futures-core", "futures-sink", "pin-project", @@ -8025,17 +9029,18 @@ dependencies = [ [[package]] name = "tokio-tungstenite" -version = "0.20.1" +version = "0.28.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "212d5dcb2a1ce06d81107c3d0ffa3121fe974b73f068c8282cb1c32328113b6c" +checksum = "d25a406cddcc431a75d3d9afc6a7c0f7428d4891dd973e4d54c56b46127bf857" dependencies = [ "futures-util", "log", - "rustls 0.21.12", + "rustls", + "rustls-pki-types", "tokio", - "tokio-rustls 0.24.1", + "tokio-rustls", "tungstenite", - "webpki-roots 0.25.4", + "webpki-roots 0.26.11", ] [[package]] @@ -8062,6 +9067,7 @@ dependencies = [ "bytes", "futures-core", "futures-sink", + "futures-util", "pin-project-lite", "tokio", ] @@ -8093,7 +9099,7 @@ version = "0.22.24" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "17b4795ff5edd201c7cd6dca065ae59972ce77d1b80fa0a84d94950ece7d1474" dependencies = [ - "indexmap 2.10.0", + "indexmap 2.13.0", "serde", "serde_spanned", "toml_datetime", @@ -8117,17 +9123,22 @@ dependencies = [ [[package]] name = "tower-http" -version = "0.6.6" +version = "0.6.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "adc82fd73de2a9722ac5da747f12383d2bfdb93591ee6c58486e0097890f05f2" +checksum = "d4e6559d53cc268e5031cd8429d05415bc4cb4aefc4aa5d6cc35fbf5b924a1f8" dependencies = [ + "async-compression", "bitflags", "bytes", + "futures-core", "futures-util", "http 1.3.1", "http-body", + "http-body-util", "iri-string", "pin-project-lite", + "tokio", + "tokio-util 0.7.16", "tower", "tower-layer", "tower-service", @@ -8210,23 +9221,22 @@ checksum = "e421abadd41a4225275504ea4d6566923418b7f05506fbc9c0fe86ba7396114b" [[package]] name = "tungstenite" -version = "0.20.1" +version = "0.28.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9e3dac10fd62eaf6617d3a904ae222845979aec67c615d1c842b4002c7666fb9" +checksum = "8628dcc84e5a09eb3d8423d6cb682965dea9133204e8fb3efee74c2a0c259442" dependencies = [ - "byteorder", "bytes", "data-encoding", - "http 0.2.12", + "http 1.3.1", "httparse", "log", - "rand 0.8.5", - "rustls 0.21.12", + "rand 0.9.2", + "rustls", + "rustls-pki-types", "sha1", - "thiserror 1.0.69", - "url", + "thiserror 2.0.18", "utf-8", - "webpki-roots 0.24.0", + "webpki-roots 0.26.11", ] [[package]] @@ -8308,13 +9318,14 @@ dependencies = [ [[package]] name = "url" -version = "2.5.4" +version = "2.5.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "32f8b686cadd1473f4bd0117a5d28d36b1ade384ea9b5069a1c40aefed7fda60" +checksum = "ff67a8a4397373c3ef660812acab3268222035010ab8680ec4215f38ba3d0eed" dependencies = [ "form_urlencoded", "idna", "percent-encoding", + "serde", ] [[package]] @@ -8520,7 +9531,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "bb0e353e6a2fbdc176932bbaab493762eb1255a7900fe0fea1a2f96c296cc909" dependencies = [ "anyhow", - "indexmap 2.10.0", + "indexmap 2.13.0", "wasm-encoder", "wasmparser", ] @@ -8533,7 +9544,7 @@ checksum = "47b807c72e1bac69382b3a6fb3dbe8ea4c0ed87ff5629b8685ae6b9a611028fe" dependencies = [ "bitflags", "hashbrown 0.15.2", - "indexmap 2.10.0", + "indexmap 2.13.0", "semver", ] @@ -8559,28 +9570,22 @@ dependencies = [ [[package]] name = "webpki-root-certs" -version = "0.26.8" +version = "1.0.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "09aed61f5e8d2c18344b3faa33a4c837855fe56642757754775548fee21386c4" +checksum = "804f18a4ac2676ffb4e8b5b5fa9ae38af06df08162314f96a68d2a363e21a8ca" dependencies = [ "rustls-pki-types", ] [[package]] name = "webpki-roots" -version = "0.24.0" +version = "0.26.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b291546d5d9d1eab74f069c77749f2cb8504a12caa20f0f2de93ddbf6f411888" +checksum = "521bc38abb08001b01866da9f51eb7c5d647a19260e00054a8c7fd5f9e57f7a9" dependencies = [ - "rustls-webpki 0.101.7", + "webpki-roots 1.0.2", ] -[[package]] -name = "webpki-roots" -version = "0.25.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5f20c57d8d7db6d3b86154206ae5d8fba62dd39573114de97c2cb0578251f8e1" - [[package]] name = "webpki-roots" version = "1.0.2" @@ -8590,16 +9595,6 @@ dependencies = [ "rustls-pki-types", ] -[[package]] -name = "wide" -version = "0.7.33" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0ce5da8ecb62bcd8ec8b7ea19f69a51275e91299be594ea5cc6ef7819e16cd03" -dependencies = [ - "bytemuck", - "safe_arch", -] - [[package]] name = "winapi" version = "0.3.9" @@ -8948,7 +9943,7 @@ checksum = "b7c566e0f4b284dd6561c786d9cb0142da491f46a9fbed79ea69cdad5db17f21" dependencies = [ "anyhow", "heck 0.5.0", - "indexmap 2.10.0", + "indexmap 2.13.0", "prettyplease", "syn 2.0.114", "wasm-metadata", @@ -8979,7 +9974,7 @@ checksum = "9d66ea20e9553b30172b5e831994e35fbde2d165325bec84fc43dbf6f4eb9cb2" dependencies = [ "anyhow", "bitflags", - "indexmap 2.10.0", + "indexmap 2.13.0", "log", "serde", "serde_derive", @@ -8998,7 +9993,7 @@ checksum = "ecc8ac4bc1dc3381b7f59c34f00b67e18f910c2c0f50015669dde7def656a736" dependencies = [ "anyhow", "id-arena", - "indexmap 2.10.0", + "indexmap 2.13.0", "log", "semver", "serde", @@ -9020,6 +10015,15 @@ version = "0.5.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1e9df38ee2d2c3c5948ea468a8406ff0db0b29ae1ffde1bcf20ef305bcc95c51" +[[package]] +name = "wyz" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05f360fc0b24296329c78fda852a1e9ae82de9cf7b27dae4b7f62f118f77b9ed" +dependencies = [ + "tap", +] + [[package]] name = "x509-parser" version = "0.14.0" @@ -9080,7 +10084,16 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1b9b4fd18abc82b8136838da5d50bae7bdea537c574d8dc1a34ed098d6c166f0" dependencies = [ "byteorder", - "zerocopy-derive", + "zerocopy-derive 0.7.35", +] + +[[package]] +name = "zerocopy" +version = "0.8.42" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f2578b716f8a7a858b7f02d5bd870c14bf4ddbbcf3a4c05414ba6503640505e3" +dependencies = [ + "zerocopy-derive 0.8.42", ] [[package]] @@ -9094,6 +10107,17 @@ dependencies = [ "syn 2.0.114", ] +[[package]] +name = "zerocopy-derive" +version = "0.8.42" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7e6cc098ea4d3bd6246687de65af3f920c430e236bee1e3bf2e441463f08a02f" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.114", +] + [[package]] name = "zerofrom" version = "0.1.5" diff --git a/program/Cargo.toml b/program/Cargo.toml index 55f4244d..f36e915c 100644 --- a/program/Cargo.toml +++ b/program/Cargo.toml @@ -17,35 +17,39 @@ solana-msg = "3.1.0" solana-native-token = "3.0.0" solana-program-entrypoint = "3.0.0" solana-program-error = "3.0.0" -solana-pubkey = "3.0.0" -solana-rent = "3.0.0" -solana-stake-interface = { version = "2", features = ["bincode", "borsh", "sysvar"] } -solana-sysvar = "3.0.0" +solana-pubkey = "4.1.0" +solana-rent = "4.1.0" +solana-stake-interface = { version = "3.0.0", features = ["bincode", "borsh", "sysvar"] } +solana-sysvar = "4.0.0" solana-sysvar-id = "3.1.0" -solana-vote-interface = { version = "4.0.4", features = ["bincode"] } +solana-vote-interface = { version = "5.1.1", features = ["bincode"] } [dev-dependencies] agave-feature-set = "3.0.0" arbitrary = { version = "1.4.2", features = ["derive"] } assert_matches = "1.5.0" -mollusk-svm = { version = "0.7.2", features = ["all-builtins"] } -mollusk-svm-result = "0.7.2" +# Temporary until the Agave 4.0 packages are released. +mollusk-svm = { git = "https://github.com/anza-xyz/mollusk", rev = "2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3", features = ["all-builtins"] } +mollusk-svm-result = { git = "https://github.com/anza-xyz/mollusk", rev = "2eb3b0f86887269e3780a63e1d4ceae79a7ea5f3" } proptest = "1.10.0" rand = "0.10.0" -solana-account = { version = "3.2.0", features = ["bincode"] } +solana-account = { version = "4.1.0", features = ["bincode"] } +# Temporary until the program-test deps update to the newer account crate. +solana-account-legacy = { package = "solana-account", version = "3.4.0", features = ["bincode"] } +solana-pubkey = { version = "4.1.0", features = ["rand"] } solana-config-interface = { version = "2", features = ["serde"] } solana-epoch-rewards = "3.0.1" solana-epoch-schedule = "3.0.0" solana-instruction = "3.2.0" solana-keypair = "3.1.0" solana-logger = "3.0.0" -solana-program-test = "3.0.10" +solana-program-test = { version = "3.1.3", features = ["agave-unstable-api"] } solana-sdk-ids = "3.0.0" solana-signature = "3.3.0" solana-signer = "3.0.0" -solana-svm-log-collector = "3.0.0" -solana-system-interface = { version = "2.0.0", features = ["bincode"] } -solana-transaction = "3.0.2" +solana-svm-log-collector = "=4.0.0-beta.1" +solana-system-interface = { version = "3.1.0", features = ["bincode"] } +solana-transaction = { version = "3.1.0", features = ["bincode"] } test-case = "3.3.1" [lib] diff --git a/program/tests/interface.rs b/program/tests/interface.rs index 17357033..6ba865ff 100644 --- a/program/tests/interface.rs +++ b/program/tests/interface.rs @@ -11,7 +11,7 @@ use { solana_instruction::{AccountMeta, Instruction}, solana_native_token::LAMPORTS_PER_SOL, solana_pubkey::Pubkey, - solana_rent::{Rent, DEFAULT_LAMPORTS_PER_BYTE_YEAR}, + solana_rent::{Rent, DEFAULT_LAMPORTS_PER_BYTE}, solana_sdk_ids::system_program, solana_stake_interface::{ instruction::{self, LockupArgs}, @@ -117,9 +117,11 @@ fn assert_pseudo_stake_rent_exemption() { Rent::default().minimum_balance(StakeStateV2::size_of()), PSEUDO_RENT_EXEMPT_RESERVE ); + // `lamports_per_byte` replaced the legacy yearly rate, so the historical + // default formula is doubled to preserve the same default minimum balance. assert_eq!( - 1_000_000_000 / 100 * 365 / (1024 * 1024), - DEFAULT_LAMPORTS_PER_BYTE_YEAR, + 2 * (1_000_000_000 / 100 * 365 / (1024 * 1024)), + DEFAULT_LAMPORTS_PER_BYTE, ); } @@ -183,13 +185,13 @@ impl Env { let vote_rent_exemption = mollusk.sysvars.rent.minimum_balance(VoteStateV4::size_of()); let vote_state_versions = VoteStateVersions::new_v4(VoteStateV4::default()); let vote_data = bincode::serialize(&vote_state_versions).unwrap(); - let vote_account = Account::create( - vote_rent_exemption, - vote_data, - vote_program::id(), - false, - u64::MAX, - ); + let vote_account = Account { + lamports: vote_rent_exemption, + data: vote_data, + owner: vote_program::id(), + executable: false, + rent_epoch: u64::MAX, + }; base_accounts.insert(VOTE_ACCOUNT_RED, vote_account.clone()); base_accounts.insert(VOTE_ACCOUNT_BLUE, vote_account); @@ -202,24 +204,23 @@ impl Env { } let vote_state_versions = VoteStateVersions::new_v4(reference_vote_state); let vote_data = bincode::serialize(&vote_state_versions).unwrap(); - let vote_account = Account::create( - vote_rent_exemption, - vote_data, - vote_program::id(), - false, - u64::MAX, - ); + let vote_account = Account { + lamports: vote_rent_exemption, + data: vote_data, + owner: vote_program::id(), + executable: false, + rent_epoch: u64::MAX, + }; base_accounts.insert(VOTE_ACCOUNT_GOLD, vote_account); // create two blank stake accounts - let stake_account = Account::create( + let stake_account = Account::new_rent_epoch( mollusk .sysvars .rent .minimum_balance(StakeStateV2::size_of()), - vec![0; StakeStateV2::size_of()], - id(), - false, + StakeStateV2::size_of(), + &id(), u64::MAX, ); base_accounts.insert(STAKE_ACCOUNT_BLACK, stake_account.clone()); @@ -1129,7 +1130,7 @@ fn test_no_use_dealloc() { .get(&stake_address) .unwrap_or_else(|| env.base_accounts.get(&stake_address).unwrap()) .lamports(); - let stake_account = Account::create(lamports, vec![], id(), false, u64::MAX); + let stake_account = Account::new_rent_epoch(lamports, 0, &id(), u64::MAX); env.override_accounts.insert(stake_address, stake_account); if is_withdraw { @@ -1206,12 +1207,12 @@ fn test_no_signer_bypass_new_interface() { // test that various different rent values do not interfere with stake program operations // also test that the stake program preserves the legacy `Meta.rent_exempt_reserve` value // we dont need to parametrize our failure tests over rent because none care about lamports -#[test_case(DEFAULT_LAMPORTS_PER_BYTE_YEAR / 2; "half_rent")] -#[test_case(DEFAULT_LAMPORTS_PER_BYTE_YEAR / 10; "tenth_rent")] -#[test_case(DEFAULT_LAMPORTS_PER_BYTE_YEAR * 2; "twice_rent")] -fn test_all_success_non_default_rent(lamports_per_byte_year: u64) { +#[test_case(DEFAULT_LAMPORTS_PER_BYTE / 2; "half_rent")] +#[test_case(DEFAULT_LAMPORTS_PER_BYTE / 10; "tenth_rent")] +#[test_case(DEFAULT_LAMPORTS_PER_BYTE * 2; "twice_rent")] +fn test_all_success_non_default_rent(lamports_per_byte: u64) { let rent = Rent { - lamports_per_byte_year, + lamports_per_byte, ..Rent::default() }; diff --git a/program/tests/program_test.rs b/program/tests/program_test.rs index 732a4032..0a8d645e 100644 --- a/program/tests/program_test.rs +++ b/program/tests/program_test.rs @@ -1,7 +1,7 @@ #![allow(clippy::arithmetic_side_effects)] use { - solana_account::Account as SolanaAccount, + solana_account_legacy::Account as SolanaAccount, solana_clock::Clock, solana_instruction::Instruction, solana_keypair::Keypair, @@ -20,6 +20,7 @@ use { state::{Authorized, Delegation, Lockup, Meta, Stake, StakeAuthorize, StakeStateV2}, }, solana_system_interface::instruction as system_instruction, + solana_sysvar_id::SysvarId, solana_transaction::{Signers, Transaction, TransactionError}, solana_vote_interface::{ instruction as vote_instruction, @@ -187,12 +188,15 @@ pub async fn get_stake_account( pub async fn get_stake_account_rent(banks_client: &mut BanksClient) -> u64 { let rent = banks_client.get_rent().await.unwrap(); - rent.minimum_balance(std::mem::size_of::()) + rent.minimum_balance(StakeStateV2::size_of()) } pub async fn get_effective_stake(banks_client: &mut BanksClient, pubkey: &Pubkey) -> u64 { let clock = banks_client.get_sysvar::().await.unwrap(); - let stake_history = banks_client.get_sysvar::().await.unwrap(); + // Temporary until the BanksClient/StakeHistory deps align and + // `banks_client.get_sysvar::()` works again. + let stake_history_account = get_account(banks_client, &StakeHistory::id()).await; + let stake_history = bincode::deserialize::(&stake_history_account.data).unwrap(); let stake_account = get_account(banks_client, pubkey).await; match bincode::deserialize::(&stake_account.data).unwrap() { StakeStateV2::Stake(_, stake, _) => { @@ -255,7 +259,7 @@ pub async fn create_independent_stake_account_with_lockup( &context.payer.pubkey(), &stake.pubkey(), lamports, - std::mem::size_of::() as u64, + StakeStateV2::size_of() as u64, &id(), ), ixn::initialize(&stake.pubkey(), authorized, lockup), @@ -1022,12 +1026,18 @@ async fn program_test_split(split_source_type: StakeLifecycle) { _ => vec![&staker_keypair], }; - // fail, cannot split zero + // zero split succeeds for an uninitialized stake account, but still fails + // for all initialized stake states let instruction = &ixn::split(&split_source, &signers[0].pubkey(), 0, &split_dest)[2]; - let e = process_instruction(&mut context, instruction, &signers) - .await - .unwrap_err(); - assert_eq!(e, ProgramError::InsufficientFunds); + let split_zero_result = process_instruction(&mut context, instruction, &signers).await; + if split_source_type == StakeLifecycle::Uninitialized { + split_zero_result.unwrap(); + } else { + assert_eq!( + split_zero_result.unwrap_err(), + ProgramError::InsufficientFunds + ); + } // fail, split more than available (even if not active, would kick source out of // rent exemption) @@ -1041,14 +1051,7 @@ async fn program_test_split(split_source_type: StakeLifecycle) { let e = process_instruction(&mut context, instruction, &signers) .await .unwrap_err(); - assert_eq!( - e, - if split_source_type.minimum_delegation_enforced() { - StakeError::InsufficientDelegation.into() - } else { - ProgramError::InsufficientFunds - } - ); + assert_eq!(e, ProgramError::InsufficientFunds); // an active or transitioning stake account cannot have less than the minimum delegation // this is NOT dependent on the one sol minimum delegation feature @@ -1065,7 +1068,7 @@ async fn program_test_split(split_source_type: StakeLifecycle) { let e = process_instruction(&mut context, instruction, &signers) .await .unwrap_err(); - assert_eq!(e, StakeError::InsufficientDelegation.into()); + assert_eq!(e, ProgramError::InsufficientFunds); // underfunded source fails let instruction = &ixn::split( @@ -1078,7 +1081,7 @@ async fn program_test_split(split_source_type: StakeLifecycle) { let e = process_instruction(&mut context, instruction, &signers) .await .unwrap_err(); - assert_eq!(e, StakeError::InsufficientDelegation.into()); + assert_eq!(e, ProgramError::InsufficientFunds); } // split to non-owned account fails diff --git a/program/tests/stake_instruction.rs b/program/tests/stake_instruction.rs index 03e89a3d..b1bd4c11 100644 --- a/program/tests/stake_instruction.rs +++ b/program/tests/stake_instruction.rs @@ -246,7 +246,11 @@ fn get_active_stake_for_tests( } fn create_empty_stake_history_for_test() -> AccountSharedData { - AccountSharedData::create(1, vec![0; 8], solana_sdk_ids::sysvar::id(), false, u64::MAX) + let mut account = + AccountSharedData::new_data(1, &StakeHistory::default(), &solana_sdk_ids::sysvar::id()) + .unwrap(); + account.set_rent_epoch(u64::MAX); + account } fn new_stake_history_entry<'a, I>( @@ -1110,7 +1114,7 @@ fn test_stake_initialize() { transaction_accounts[1] = ( rent::id(), create_account_shared_data_for_test(&Rent { - lamports_per_byte_year: rent.lamports_per_byte_year + 1, + lamports_per_byte: rent.lamports_per_byte + 1, ..rent }), ); @@ -7068,13 +7072,40 @@ enum VoteStateVersion { V4, } -impl VoteStateVersion { - fn default_vote_state(&self) -> VoteStateVersions { - match self { - Self::V0_23_5 => VoteStateVersions::V0_23_5(Box::default()), - Self::V1_14_11 => VoteStateVersions::V1_14_11(Box::default()), - Self::V3 => VoteStateVersions::V3(Box::default()), - Self::V4 => VoteStateVersions::V4(Box::default()), +fn vote_account_for_version(vote_state_version: VoteStateVersion) -> AccountSharedData { + let lamports = Rent::default().minimum_balance(VoteStateV4::size_of()); + match vote_state_version { + VoteStateVersion::V1_14_11 => AccountSharedData::new_data_with_space( + lamports, + &VoteStateVersions::V1_14_11(Box::default()), + VoteStateV4::size_of(), + &solana_sdk_ids::vote::id(), + ) + .unwrap(), + VoteStateVersion::V3 => AccountSharedData::new_data_with_space( + lamports, + &VoteStateVersions::V3(Box::default()), + VoteStateV4::size_of(), + &solana_sdk_ids::vote::id(), + ) + .unwrap(), + VoteStateVersion::V4 => AccountSharedData::new_data_with_space( + lamports, + &VoteStateVersions::V4(Box::default()), + VoteStateV4::size_of(), + &solana_sdk_ids::vote::id(), + ) + .unwrap(), + VoteStateVersion::V0_23_5 => { + let mut account = AccountSharedData::new_rent_epoch( + lamports, + VoteStateV4::size_of(), + &solana_sdk_ids::vote::id(), + u64::MAX, + ); + let zeroed_vote_state = vec![0; VoteStateV4::size_of()]; + account.set_data_from_slice(&zeroed_vote_state); + account } } } @@ -7263,14 +7294,7 @@ fn test_delegate_deserialize_vote_state( vote_state_version: VoteStateVersion, expected_result: Result<(), ProgramError>, ) { - let vote_state = vote_state_version.default_vote_state(); - let vote_account = AccountSharedData::new_data_with_space( - Rent::default().minimum_balance(VoteStateV4::size_of()), - &vote_state, - VoteStateV4::size_of(), - &solana_sdk_ids::vote::id(), - ) - .unwrap(); + let vote_account = vote_account_for_version(vote_state_version); let (mollusk, instruction_accounts, transaction_accounts) = setup_delegate_test_with_vote_account(vote_account); @@ -7320,14 +7344,7 @@ fn test_deactivate_delinquent_deserialize_vote_state( expected_result: Result<(), ProgramError>, ) { // Create delinquent vote account with the specified version - let vote_state = vote_state_version.default_vote_state(); - let vote_account = AccountSharedData::new_data_with_space( - Rent::default().minimum_balance(VoteStateV4::size_of()), - &vote_state, - VoteStateV4::size_of(), - &solana_sdk_ids::vote::id(), - ) - .unwrap(); + let vote_account = vote_account_for_version(vote_state_version); let (mollusk, instruction_accounts, transaction_accounts) = setup_deactivate_delinquent_test_with_vote_account(vote_account); From bc04b78d6e3f375918ac2546a615b91ae1725ccc Mon Sep 17 00:00:00 2001 From: Gabe Rodriguez Date: Fri, 31 Oct 2025 15:29:34 -0400 Subject: [PATCH 2/2] Convert warmup/cooldown rate to integers --- Cargo.lock | 25 +- Cargo.toml | 3 + .../rust/src/generated/types/delegation.rs | 2 +- interface/Cargo.toml | 1 + interface/idl.json | 15 +- interface/src/lib.rs | 3 + interface/src/state.rs | 478 ++++++++++++++++-- interface/src/ulp.rs | 106 ++++ interface/src/warmup_cooldown_allowance.rs | 444 ++++++++++++++++ program/Cargo.toml | 2 +- program/src/helpers/merge.rs | 21 +- program/src/processor.rs | 16 +- program/tests/interface.rs | 13 +- program/tests/program_test.rs | 2 +- program/tests/stake_instruction.rs | 33 +- scripts/solana.dic | 1 + 16 files changed, 1053 insertions(+), 112 deletions(-) create mode 100644 interface/src/ulp.rs create mode 100644 interface/src/warmup_cooldown_allowance.rs diff --git a/Cargo.lock b/Cargo.lock index 083f06f8..5e7bb60c 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -3399,7 +3399,7 @@ dependencies = [ "solana-rent 4.1.0", "solana-sdk-ids", "solana-slot-hashes", - "solana-stake-interface 3.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "solana-stake-interface 3.0.0", "solana-svm-callback 4.0.0-beta.1", "solana-svm-log-collector 4.0.0-beta.1", "solana-svm-timings 4.0.0-beta.1", @@ -7380,6 +7380,7 @@ dependencies = [ "codama", "codama-macros", "num-traits", + "proptest", "serde", "serde_derive", "serde_json", @@ -7405,26 +7406,6 @@ dependencies = [ "test-case", ] -[[package]] -name = "solana-stake-interface" -version = "3.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd714713337a7f5b513e02119f484fb9b7e056c6ce74af30e70505f2e62b64b7" -dependencies = [ - "borsh", - "num-traits", - "serde", - "serde_derive", - "solana-clock", - "solana-cpi", - "solana-instruction", - "solana-program-error", - "solana-pubkey 4.1.0", - "solana-system-interface 3.1.0", - "solana-sysvar 4.0.0", - "solana-sysvar-id", -] - [[package]] name = "solana-stake-program" version = "4.0.0" @@ -7459,7 +7440,7 @@ dependencies = [ "solana-sdk-ids", "solana-signature", "solana-signer", - "solana-stake-interface 3.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "solana-stake-interface 3.0.0", "solana-svm-log-collector 4.0.0-beta.1", "solana-system-interface 3.1.0", "solana-sysvar 4.0.0", diff --git a/Cargo.toml b/Cargo.toml index 41202802..94c2dd1c 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -22,3 +22,6 @@ check-cfg = [ [workspace.metadata.spellcheck] config = "scripts/spellcheck.toml" + +[patch.crates-io] +solana-stake-interface = { path = "interface" } diff --git a/clients/rust/src/generated/types/delegation.rs b/clients/rust/src/generated/types/delegation.rs index 67195f5d..7b5123c4 100644 --- a/clients/rust/src/generated/types/delegation.rs +++ b/clients/rust/src/generated/types/delegation.rs @@ -22,5 +22,5 @@ pub struct Delegation { pub stake: u64, pub activation_epoch: Epoch, pub deactivation_epoch: Epoch, - pub warmup_cooldown_rate: f64, + pub reserved: [u8; 8], } diff --git a/interface/Cargo.toml b/interface/Cargo.toml index 15709781..68b334cf 100644 --- a/interface/Cargo.toml +++ b/interface/Cargo.toml @@ -41,6 +41,7 @@ serde_json = { version = "1.0", optional = true } anyhow = "1" assert_matches = "1.5.0" bincode = "1.3.3" +proptest = "1.10.0" serial_test = "3.4.0" solana-account = { version = "4.0.0", features = ["bincode"] } solana-borsh = "3.0.0" diff --git a/interface/idl.json b/interface/idl.json index 85bf1369..36dbef63 100644 --- a/interface/idl.json +++ b/interface/idl.json @@ -464,11 +464,18 @@ }, { "kind": "structFieldTypeNode", - "name": "warmupCooldownRate", + "name": "reserved", "type": { - "endian": "le", - "format": "f64", - "kind": "numberTypeNode" + "count": { + "kind": "fixedCountNode", + "value": 8 + }, + "item": { + "endian": "le", + "format": "u8", + "kind": "numberTypeNode" + }, + "kind": "arrayTypeNode" } } ], diff --git a/interface/src/lib.rs b/interface/src/lib.rs index c0c064ff..eb506532 100644 --- a/interface/src/lib.rs +++ b/interface/src/lib.rs @@ -13,6 +13,9 @@ pub mod state; #[cfg(feature = "sysvar")] pub mod sysvar; pub mod tools; +#[cfg(test)] +mod ulp; +pub mod warmup_cooldown_allowance; #[cfg(feature = "codama")] use codama_macros::codama; diff --git a/interface/src/state.rs b/interface/src/state.rs index 9f25ce9a..d4fe70a1 100644 --- a/interface/src/state.rs +++ b/interface/src/state.rs @@ -14,6 +14,9 @@ use { instruction::LockupArgs, stake_flags::StakeFlags, stake_history::{StakeHistoryEntry, StakeHistoryGetEntry}, + warmup_cooldown_allowance::{ + calculate_activation_allowance, calculate_deactivation_allowance, + }, }, solana_clock::{Clock, Epoch, UnixTimestamp}, solana_instruction::error::InstructionError, @@ -25,10 +28,16 @@ pub type StakeActivationStatus = StakeHistoryEntry; // Means that no more than RATE of current effective stake may be added or subtracted per // epoch. +#[deprecated( + since = "3.0.0", + note = "Use ORIGINAL_WARMUP_COOLDOWN_RATE_BPS instead" +)] pub const DEFAULT_WARMUP_COOLDOWN_RATE: f64 = 0.25; +#[deprecated(since = "3.0.0", note = "Use TOWER_WARMUP_COOLDOWN_RATE_BPS instead")] pub const NEW_WARMUP_COOLDOWN_RATE: f64 = 0.09; pub const DEFAULT_SLASH_PENALTY: u8 = ((5 * u8::MAX as usize) / 100) as u8; +#[deprecated(since = "3.0.0", note = "Use warmup_cooldown_rate_bps() instead")] pub fn warmup_cooldown_rate(current_epoch: Epoch, new_rate_activation_epoch: Option) -> f64 { if current_epoch < new_rate_activation_epoch.unwrap_or(u64::MAX) { DEFAULT_WARMUP_COOLDOWN_RATE @@ -483,23 +492,19 @@ pub struct Delegation { pub activation_epoch: Epoch, /// epoch the stake was deactivated, `std::u64::MAX` if not deactivated pub deactivation_epoch: Epoch, - /// how much stake we can activate per-epoch as a fraction of currently effective stake - #[deprecated( - since = "1.16.7", - note = "Please use `solana_sdk::stake::state::warmup_cooldown_rate()` instead" - )] - pub warmup_cooldown_rate: f64, + /// Formerly the `warmup_cooldown_rate: f64`, but floats are not eBPF-compatible. + /// It is unused, but this field is now reserved to maintain layout compatibility. + pub _reserved: [u8; 8], } impl Default for Delegation { fn default() -> Self { - #[allow(deprecated)] Self { voter_pubkey: Pubkey::default(), stake: 0, activation_epoch: 0, deactivation_epoch: u64::MAX, - warmup_cooldown_rate: DEFAULT_WARMUP_COOLDOWN_RATE, + _reserved: [0; 8], } } } @@ -517,6 +522,9 @@ impl Delegation { self.activation_epoch == u64::MAX } + /// Previous implementation that uses floats under the hood to calculate warmup/cooldown + /// rate-limiting. New `stake_v2()` uses integers (upstream eBPF-compatible). + #[deprecated(since = "3.0.0", note = "Use stake_v2() instead")] pub fn stake( &self, epoch: Epoch, @@ -527,7 +535,12 @@ impl Delegation { .effective } - #[allow(clippy::comparison_chain)] + /// Previous implementation that uses floats under the hood to calculate warmup/cooldown + /// rate-limiting. New `stake_activating_and_deactivating_v2()` uses integers (upstream eBPF-compatible). + #[deprecated( + since = "3.0.0", + note = "Use stake_activating_and_deactivating_v2() instead" + )] pub fn stake_activating_and_deactivating( &self, target_epoch: Epoch, @@ -615,6 +628,7 @@ impl Delegation { } // returned tuple is (effective, activating) stake + #[deprecated(since = "3.0.0", note = "Use stake_and_activating_v2() instead")] fn stake_and_activating( &self, target_epoch: Epoch, @@ -700,6 +714,199 @@ impl Delegation { (delegated_stake, 0) } } + + pub fn stake_v2( + &self, + epoch: Epoch, + history: &T, + new_rate_activation_epoch: Option, + ) -> u64 { + self.stake_activating_and_deactivating_v2(epoch, history, new_rate_activation_epoch) + .effective + } + + pub fn stake_activating_and_deactivating_v2( + &self, + target_epoch: Epoch, + history: &T, + new_rate_activation_epoch: Option, + ) -> StakeActivationStatus { + // first, calculate an effective and activating stake + let (effective_stake, activating_stake) = + self.stake_and_activating_v2(target_epoch, history, new_rate_activation_epoch); + + // then de-activate some portion if necessary + if target_epoch < self.deactivation_epoch { + // not deactivated + if activating_stake == 0 { + StakeActivationStatus::with_effective(effective_stake) + } else { + StakeActivationStatus::with_effective_and_activating( + effective_stake, + activating_stake, + ) + } + } else if target_epoch == self.deactivation_epoch { + // can only deactivate what's activated + StakeActivationStatus::with_deactivating(effective_stake) + } else if let Some((history, mut prev_epoch, mut prev_cluster_stake)) = history + .get_entry(self.deactivation_epoch) + .map(|cluster_stake_at_deactivation_epoch| { + ( + history, + self.deactivation_epoch, + cluster_stake_at_deactivation_epoch, + ) + }) + { + // target_epoch > self.deactivation_epoch + // + // We advance epoch-by-epoch from just after the deactivation epoch up to the target_epoch, + // removing (cooling down) the account's share of effective stake each epoch, + // potentially rate-limited by cluster history. + + let mut current_epoch; + let mut remaining_deactivating_stake = effective_stake; + loop { + current_epoch = prev_epoch + 1; + // if there is no deactivating stake at prev epoch, we should have been + // fully undelegated at this moment + if prev_cluster_stake.deactivating == 0 { + break; + } + + // Compute how much of this account's stake cools down in `current_epoch` + let newly_deactivated_stake = calculate_deactivation_allowance( + current_epoch, + remaining_deactivating_stake, + &prev_cluster_stake, + new_rate_activation_epoch, + ); + + // Substract the newly deactivated stake, clamping the per-epoch decrease to at + // least 1 lamport so cooldown always makes progress + remaining_deactivating_stake = + remaining_deactivating_stake.saturating_sub(newly_deactivated_stake.max(1)); + + // Stop if we've fully cooled down this account + if remaining_deactivating_stake == 0 { + break; + } + + // Stop when we've reached the time bound for this query + if current_epoch >= target_epoch { + break; + } + + // Advance to the next epoch if we have history, otherwise we can't model further cooldown + if let Some(current_cluster_stake) = history.get_entry(current_epoch) { + prev_epoch = current_epoch; + prev_cluster_stake = current_cluster_stake; + } else { + // No more history data, return the best-effort state as of the last known epoch + break; + } + } + + // Report how much stake remains in cooldown at `target_epoch` + StakeActivationStatus::with_deactivating(remaining_deactivating_stake) + } else { + // no history or I've dropped out of history, so assume fully deactivated + StakeActivationStatus::default() + } + } + + // returned tuple is (effective, activating) stake + fn stake_and_activating_v2( + &self, + target_epoch: Epoch, + history: &T, + new_rate_activation_epoch: Option, + ) -> (u64, u64) { + let delegated_stake = self.stake; + + if self.is_bootstrap() { + // fully effective immediately + (delegated_stake, 0) + } else if self.activation_epoch == self.deactivation_epoch { + // activated but instantly deactivated; no stake at all regardless of target_epoch + // this must be after the bootstrap check and before all-is-activating check + (0, 0) + } else if target_epoch == self.activation_epoch { + // all is activating + (0, delegated_stake) + } else if target_epoch < self.activation_epoch { + // not yet enabled + (0, 0) + } else if let Some((history, mut prev_epoch, mut prev_cluster_stake)) = history + .get_entry(self.activation_epoch) + .map(|cluster_stake_at_activation_epoch| { + ( + history, + self.activation_epoch, + cluster_stake_at_activation_epoch, + ) + }) + { + // target_epoch > self.activation_epoch + // + // We advance epoch-by-epoch from just after the activation epoch up to the target_epoch, + // accumulating (warming up) the account's share of effective stake each epoch, + // potentially rate-limited by cluster history. + + let mut current_epoch; + let mut activated_stake_amount = 0; + loop { + current_epoch = prev_epoch + 1; + // if there is no activating stake at prev epoch, we should have been + // fully effective at this moment + if prev_cluster_stake.activating == 0 { + break; + } + + // Calculate how much of this account's remaining stake becomes effective in `current_epoch`. + let remaining_activating_stake = delegated_stake - activated_stake_amount; + let newly_effective_stake = calculate_activation_allowance( + current_epoch, + remaining_activating_stake, + &prev_cluster_stake, + new_rate_activation_epoch, + ); + + // Add the newly effective stake, clamping the per-epoch increase to at least 1 lamport so warmup always makes progress + activated_stake_amount += newly_effective_stake.max(1); + + // Stop if we've fully warmed up this account's stake. + if activated_stake_amount >= delegated_stake { + activated_stake_amount = delegated_stake; + break; + } + + // Stop when we've reached the time bound for this query + if current_epoch >= target_epoch || current_epoch >= self.deactivation_epoch { + break; + } + + // Advance to the next epoch if we have history, otherwise we can't model further warmup + if let Some(current_cluster_stake) = history.get_entry(current_epoch) { + prev_epoch = current_epoch; + prev_cluster_stake = current_cluster_stake; + } else { + // No more history data, return the best-effort state as of the last known epoch + break; + } + } + + // Return the portion that has become effective and the portion still activating + ( + activated_stake_amount, + delegated_stake - activated_stake_amount, + ) + } else { + // no history or I've dropped out of history, so assume fully effective + (delegated_stake, 0) + } + } } #[cfg_attr(feature = "codama", derive(CodamaType))] @@ -721,6 +928,7 @@ pub struct Stake { } impl Stake { + #[deprecated(since = "3.0.0", note = "Use stake_v2() instead")] pub fn stake( &self, epoch: Epoch, @@ -731,6 +939,16 @@ impl Stake { .stake(epoch, history, new_rate_activation_epoch) } + pub fn stake_v2( + &self, + epoch: Epoch, + history: &T, + new_rate_activation_epoch: Option, + ) -> u64 { + self.delegation + .stake_v2(epoch, history, new_rate_activation_epoch) + } + pub fn split( &mut self, remaining_stake_delta: u64, @@ -765,7 +983,7 @@ impl Stake { mod tests { use { super::*, - crate::stake_history::StakeHistory, + crate::{stake_history::StakeHistory, warmup_cooldown_allowance::warmup_cooldown_rate_bps}, assert_matches::assert_matches, bincode::serialize, solana_account::{state_traits::StateMut, AccountSharedData, ReadableAccount}, @@ -792,7 +1010,11 @@ mod tests { I: Iterator, { stakes.fold(StakeHistoryEntry::default(), |sum, stake| { - sum + stake.stake_activating_and_deactivating(epoch, history, new_rate_activation_epoch) + sum + stake.stake_activating_and_deactivating_v2( + epoch, + history, + new_rate_activation_epoch, + ) }) } @@ -994,28 +1216,37 @@ mod tests { }; // save this off so stake.config.warmup_rate changes don't break this test - let increment = (1_000_f64 * warmup_cooldown_rate(0, None)) as u64; + let rate_bps = warmup_cooldown_rate_bps(0, None); + let increment = ((1_000u128 * rate_bps as u128) / 10_000) as u64; let mut stake_history = StakeHistory::default(); // assert that this stake follows step function if there's no history assert_eq!( - stake.stake_activating_and_deactivating(stake.activation_epoch, &stake_history, None), + stake.stake_activating_and_deactivating_v2( + stake.activation_epoch, + &stake_history, + None + ), StakeActivationStatus::with_effective_and_activating(0, stake.stake), ); for epoch in stake.activation_epoch + 1..stake.deactivation_epoch { assert_eq!( - stake.stake_activating_and_deactivating(epoch, &stake_history, None), + stake.stake_activating_and_deactivating_v2(epoch, &stake_history, None), StakeActivationStatus::with_effective(stake.stake), ); } // assert that this stake is full deactivating assert_eq!( - stake.stake_activating_and_deactivating(stake.deactivation_epoch, &stake_history, None), + stake.stake_activating_and_deactivating_v2( + stake.deactivation_epoch, + &stake_history, + None + ), StakeActivationStatus::with_deactivating(stake.stake), ); // assert that this stake is fully deactivated if there's no history assert_eq!( - stake.stake_activating_and_deactivating( + stake.stake_activating_and_deactivating_v2( stake.deactivation_epoch + 1, &stake_history, None @@ -1032,7 +1263,7 @@ mod tests { ); // assert that this stake is broken, because above setup is broken assert_eq!( - stake.stake_activating_and_deactivating(1, &stake_history, None), + stake.stake_activating_and_deactivating_v2(1, &stake_history, None), StakeActivationStatus::with_effective_and_activating(0, stake.stake), ); @@ -1047,7 +1278,7 @@ mod tests { ); // assert that this stake is broken, because above setup is broken assert_eq!( - stake.stake_activating_and_deactivating(2, &stake_history, None), + stake.stake_activating_and_deactivating_v2(2, &stake_history, None), StakeActivationStatus::with_effective_and_activating( increment, stake.stake - increment @@ -1066,7 +1297,7 @@ mod tests { ); // assert that this stake is broken, because above setup is broken assert_eq!( - stake.stake_activating_and_deactivating( + stake.stake_activating_and_deactivating_v2( stake.deactivation_epoch + 1, &stake_history, None, @@ -1085,7 +1316,7 @@ mod tests { ); // assert that this stake is broken, because above setup is broken assert_eq!( - stake.stake_activating_and_deactivating( + stake.stake_activating_and_deactivating_v2( stake.deactivation_epoch + 2, &stake_history, None, @@ -1155,7 +1386,7 @@ mod tests { assert_eq!( expected_stakes, (0..expected_stakes.len()) - .map(|epoch| stake.stake_activating_and_deactivating( + .map(|epoch| stake.stake_activating_and_deactivating_v2( epoch as u64, &stake_history, None, @@ -1286,7 +1517,7 @@ mod tests { let calculate_each_staking_status = |stake: &Delegation, epoch_count: usize| -> Vec<_> { (0..epoch_count) .map(|epoch| { - stake.stake_activating_and_deactivating(epoch as u64, &stake_history, None) + stake.stake_activating_and_deactivating_v2(epoch as u64, &stake_history, None) }) .collect::>() }; @@ -1363,6 +1594,7 @@ mod tests { let mut effective = base_stake; let other_activation = 100; let mut other_activations = vec![0]; + let rate_bps = warmup_cooldown_rate_bps(0, None); // Build a stake history where the test staker always consumes all of the available warm // up and cool down stake. However, simulate other stakers beginning to activate during @@ -1385,7 +1617,7 @@ mod tests { }, ); - let effective_rate_limited = (effective as f64 * warmup_cooldown_rate(0, None)) as u64; + let effective_rate_limited = ((effective as u128) * rate_bps as u128 / 10_000) as u64; if epoch < stake.deactivation_epoch { effective += effective_rate_limited.min(activating); other_activations.push(0); @@ -1406,7 +1638,7 @@ mod tests { (0, history.deactivating) }; assert_eq!( - stake.stake_activating_and_deactivating(epoch, &stake_history, None), + stake.stake_activating_and_deactivating_v2(epoch, &stake_history, None), StakeActivationStatus { effective: expected_stake, activating: expected_activating, @@ -1428,7 +1660,8 @@ mod tests { let epochs = 7; // make bootstrap stake smaller than warmup so warmup/cooldownn // increment is always smaller than 1 - let bootstrap = (warmup_cooldown_rate(0, None) * 100.0 / 2.0) as u64; + let rate_bps = warmup_cooldown_rate_bps(0, None); + let bootstrap = ((100u128 * rate_bps as u128) / (2u128 * 10_000)) as u64; let stake_history = create_stake_history_from_delegations(Some(bootstrap), 0..epochs, &delegations, None); let mut max_stake = 0; @@ -1437,7 +1670,7 @@ mod tests { for epoch in 0..epochs { let stake = delegations .iter() - .map(|delegation| delegation.stake(epoch, &stake_history, None)) + .map(|delegation| delegation.stake_v2(epoch, &stake_history, None)) .sum::(); max_stake = max_stake.max(stake); min_stake = min_stake.min(stake); @@ -1506,7 +1739,7 @@ mod tests { let mut prev_total_effective_stake = delegations .iter() - .map(|delegation| delegation.stake(0, &stake_history, new_rate_activation_epoch)) + .map(|delegation| delegation.stake_v2(0, &stake_history, new_rate_activation_epoch)) .sum::(); // uncomment and add ! for fun with graphing @@ -1515,7 +1748,7 @@ mod tests { let total_effective_stake = delegations .iter() .map(|delegation| { - delegation.stake(epoch, &stake_history, new_rate_activation_epoch) + delegation.stake_v2(epoch, &stake_history, new_rate_activation_epoch) }) .sum::(); @@ -1526,13 +1759,10 @@ mod tests { // (0..(total_effective_stake as usize / (delegations.len() * 5))).for_each(|_| eprint("#")); // eprintln(); - assert!( - delta - <= ((prev_total_effective_stake as f64 - * warmup_cooldown_rate(epoch, new_rate_activation_epoch)) - as u64) - .max(1) - ); + let rate_bps = warmup_cooldown_rate_bps(epoch, new_rate_activation_epoch); + let max_delta = + ((prev_total_effective_stake as u128) * rate_bps as u128 / 10_000) as u64; + assert!(delta <= max_delta.max(1)); prev_total_effective_stake = total_effective_stake; } @@ -1725,7 +1955,7 @@ mod tests { stake: u64::MAX, activation_epoch: Epoch::MAX, deactivation_epoch: Epoch::MAX, - warmup_cooldown_rate: f64::MAX, + _reserved: [0; 8], }, credits_observed: 1, }, @@ -1746,8 +1976,122 @@ mod tests { check_flag(StakeFlags::empty(), 0); } + #[cfg(test)] + #[allow(deprecated)] + mod delegation_prop_tests { + use { + super::*, + crate::{ + stake_history::{StakeHistory, StakeHistoryEntry}, + ulp::max_ulp_tolerance, + }, + proptest::prelude::*, + solana_pubkey::Pubkey, + }; + + prop_compose! { + fn arbitrary_delegation()( + // This tests is bounded to the range where `f64` can represent every integer exactly. + // Beyond this, integer math and float math diverge considerably. + // This case is covered in `warmup_cooldown_allowance.rs`. + stake in 0u64..=(1u64 << 53) - 1, + activation_epoch in 0u64..=50, + deactivation_offset in 0u64..=50, + ) -> Delegation { + let deactivation_epoch = activation_epoch.saturating_add(deactivation_offset); + + Delegation { + voter_pubkey: Pubkey::new_unique(), + stake, + activation_epoch, + deactivation_epoch, + ..Delegation::default() + } + } + } + + prop_compose! { + fn arbitrary_stake_history(max_epoch: Epoch)( + entries in prop::collection::vec( + ( + 0u64..=max_epoch, + 0u64..=1_000_000_000_000, // effective + 0u64..=1_000_000_000_000, // activating + 0u64..=1_000_000_000_000, // deactivating + ), + 0..=((max_epoch + 1) as usize), + ) + ) -> StakeHistory { + let mut history = StakeHistory::default(); + for (epoch, effective, activating, deactivating) in entries { + history.add( + epoch, + StakeHistoryEntry { + effective, + activating, + deactivating, + }, + ); + } + history + } + } + + proptest! { + #![proptest_config(ProptestConfig::with_cases(10_000))] + + #[test] + fn delegation_stake_matches_legacy_within_tolerance( + delegation in arbitrary_delegation(), + target_epoch in 0u64..=50, + new_rate_activation_epoch_option in prop::option::of(0u64..=50), + stake_history in arbitrary_stake_history(50), + ) { + let new_stake = delegation.stake_v2( + target_epoch, + &stake_history, + new_rate_activation_epoch_option, + ); + let legacy_stake = delegation.stake( + target_epoch, + &stake_history, + new_rate_activation_epoch_option, + ); + + // neither path should ever exceed the delegated amount. + prop_assert!(new_stake <= delegation.stake); + prop_assert!(legacy_stake <= delegation.stake); + + // If the delegation has no stake, both must be zero. + if delegation.stake == 0 { + prop_assert_eq!(new_stake, 0); + prop_assert_eq!(legacy_stake, 0); + } else { + // Compare with a ULP-based tolerance to account for float vs integer math. + let diff = new_stake.abs_diff(legacy_stake); + let tolerance = max_ulp_tolerance(new_stake, legacy_stake); + + prop_assert!( + diff <= tolerance, + "stake mismatch: new={}, legacy={}, diff={}, tol={}, delegation={:?}, target_epoch={}, new_rate_activation_epoch_option={:?}", + new_stake, + legacy_stake, + diff, + tolerance, + delegation, + target_epoch, + new_rate_activation_epoch_option, + ); + } + } + } + } + mod deprecated { - use super::*; + use { + super::*, + static_assertions::{assert_eq_align, assert_eq_size}, + }; fn check_borsh_deserialization(stake: StakeState) { let serialized = serialize(&stake).unwrap(); @@ -1793,7 +2137,7 @@ mod tests { stake: u64::MAX, activation_epoch: Epoch::MAX, deactivation_epoch: Epoch::MAX, - warmup_cooldown_rate: f64::MAX, + _reserved: [0; 8], }, credits_observed: 1, }, @@ -1827,7 +2171,7 @@ mod tests { stake: u64::MAX, activation_epoch: Epoch::MAX, deactivation_epoch: Epoch::MAX, - warmup_cooldown_rate: f64::MAX, + _reserved: [0; 8], }, credits_observed: 1, }, @@ -1858,5 +2202,61 @@ mod tests { }) ); } + + /// Contains legacy struct definitions to verify memory layout compatibility. + mod legacy { + use super::*; + + #[derive(borsh::BorshSerialize, borsh::BorshDeserialize)] + #[borsh(crate = "borsh")] + pub struct Delegation { + pub voter_pubkey: Pubkey, + pub stake: u64, + pub activation_epoch: Epoch, + pub deactivation_epoch: Epoch, + pub warmup_cooldown_rate: f64, + } + } + + #[test] + fn test_delegation_struct_layout_compatibility() { + assert_eq_size!(Delegation, legacy::Delegation); + assert_eq_align!(Delegation, legacy::Delegation); + } + + #[test] + #[allow(clippy::used_underscore_binding)] + fn test_delegation_deserialization_from_legacy_format() { + let legacy_delegation = legacy::Delegation { + voter_pubkey: Pubkey::new_unique(), + stake: 12345, + activation_epoch: 10, + deactivation_epoch: 20, + warmup_cooldown_rate: NEW_WARMUP_COOLDOWN_RATE, + }; + + let serialized_data = borsh::to_vec(&legacy_delegation).unwrap(); + + // Deserialize into the NEW Delegation struct + let new_delegation = Delegation::try_from_slice(&serialized_data).unwrap(); + + // Assert that the fields are identical + assert_eq!(new_delegation.voter_pubkey, legacy_delegation.voter_pubkey); + assert_eq!(new_delegation.stake, legacy_delegation.stake); + assert_eq!( + new_delegation.activation_epoch, + legacy_delegation.activation_epoch + ); + assert_eq!( + new_delegation.deactivation_epoch, + legacy_delegation.deactivation_epoch + ); + + // Assert that the `reserved` bytes now contain the raw bits of the old f64 + assert_eq!( + new_delegation._reserved, + NEW_WARMUP_COOLDOWN_RATE.to_le_bytes() + ); + } } } diff --git a/interface/src/ulp.rs b/interface/src/ulp.rs new file mode 100644 index 00000000..04f96d08 --- /dev/null +++ b/interface/src/ulp.rs @@ -0,0 +1,106 @@ +//! Math utilities for calculating float/int differences + +/// Calculates the "Unit in the Last Place" (`ULP`) for a `u64` value, which is +/// the gap between adjacent `f64` values at that magnitude. We need this because +/// the prop test compares the integer vs float implementations. Past `2^53`, `f64` +/// can't represent every integer, so the float result can differ by a few `ULPs` +/// even when both are correct. `f64` facts: +/// - `f64` has 53 bits of precision (52 fraction bits plus an implicit leading 1). +/// - For integers `x < 2^53`, every integer is exactly representable (`ULP = 1`). +/// - At and above powers of two, spacing doubles: +/// `[2^53, 2^54) ULP = 2` +/// `[2^54, 2^55) ULP = 4` +/// `[2^55, 2^56) ULP = 8` +fn ulp_of_u64(magnitude: u64) -> u64 { + // Avoid the special zero case by forcing at least 1 + let magnitude_f64 = magnitude.max(1) as f64; + + // spacing to the next representable f64 + let spacing = magnitude_f64.next_up() - magnitude_f64; + + // Map back to integer units, clamp so we never return 0 + spacing.max(1.0) as u64 +} + +/// Compute an absolute tolerance for comparing the integer result to the +/// legacy `f64`-based implementation. +/// +/// Because the legacy path rounds multiple times before the final floor, +/// the integer result can differ from the float version by a small number +/// of `ULPs` ("Unit in the Last Place") even when both are "correct" for +/// their domain. +pub fn max_ulp_tolerance(candidate: u64, oracle: u64) -> u64 { + // Measure ULP at the larger magnitude of the two results + let mag = candidate.max(oracle); + + // Get the ULP spacing + let ulp = ulp_of_u64(mag); + + // Use a 4x ULP tolerance to account for precision error accumulation in the + // legacy `f64` impl: + // - Three `u64` to `f64` conversions + // - One division and two multiplications are rounded + // - The `as u64` cast truncates the final `f64` result + // + // Proptest confirmed these can accumulate to >3 ULPs, so 4x is a safe margin. + ulp.saturating_mul(4) +} + +#[cfg(test)] +mod test { + use super::*; + + #[test] + fn ulp_standard_calc() { + assert_eq!(ulp_of_u64(0), 1); + assert_eq!(ulp_of_u64(1), 1); + assert_eq!(ulp_of_u64((1u64 << 53) - 1), 1); + assert_eq!(ulp_of_u64(1u64 << 53), 2); + assert_eq!(ulp_of_u64(u64::MAX), 4096); + } + + #[test] + fn tolerance_small_magnitudes_use_single_ulp() { + // For magnitudes < 2^53, ULP = 1, so tolerance = 4 * 1 = 4. + assert_eq!(max_ulp_tolerance(0, 0), 4); + assert_eq!(max_ulp_tolerance(0, 1), 4); + assert_eq!(max_ulp_tolerance((1u64 << 53) - 1, 1), 4); + } + + #[test] + fn tolerance_scales_with_magnitude_powers_of_two() { + // Around powers of two, ULP doubles each time, so tolerance (4 * ULP) doubles. + let below_2_53 = max_ulp_tolerance((1u64 << 53) - 1, 0); // ULP = 1 + let at_2_53 = max_ulp_tolerance(1u64 << 53, 0); // ULP = 2 + let at_2_54 = max_ulp_tolerance(1u64 << 54, 0); // ULP = 4 + let at_2_55 = max_ulp_tolerance(1u64 << 55, 0); // ULP = 8 + + assert_eq!(below_2_53, 4); // 4 * 1 + assert_eq!(at_2_53, 8); // 4 * 2 + assert_eq!(at_2_54, 16); // 4 * 4 + assert_eq!(at_2_55, 32); // 4 * 8 + } + + #[test] + fn tolerance_uses_larger_of_two_results_and_is_symmetric() { + let small = 1u64; + let large = 1u64 << 53; // where ULP jumps from 1 to 2 + + // order of (candidate, oracle) shouldn't matter + let ab = max_ulp_tolerance(small, large); + let ba = max_ulp_tolerance(large, small); + assert_eq!(ab, ba); + + // Using (large, large) should give the same tolerance, since it's based on max() + let big_only = max_ulp_tolerance(large, large); + assert_eq!(ab, big_only); + } + + #[test] + fn tolerance_at_u64_max_matches_expected_ulp() { + // From ulp_standard_calc: ulp_of_u64(u64::MAX) == 4096 + // So tolerance = 4 * 4096 = 16384 + assert_eq!(max_ulp_tolerance(u64::MAX, 0), 4096 * 4); + assert_eq!(max_ulp_tolerance(0, u64::MAX), 4096 * 4); + } +} diff --git a/interface/src/warmup_cooldown_allowance.rs b/interface/src/warmup_cooldown_allowance.rs new file mode 100644 index 00000000..95aa7afd --- /dev/null +++ b/interface/src/warmup_cooldown_allowance.rs @@ -0,0 +1,444 @@ +use {crate::stake_history::StakeHistoryEntry, solana_clock::Epoch}; + +pub const BASIS_POINTS_PER_UNIT: u64 = 10_000; +pub const ORIGINAL_WARMUP_COOLDOWN_RATE_BPS: u64 = 2_500; // 25% +pub const TOWER_WARMUP_COOLDOWN_RATE_BPS: u64 = 900; // 9% + +#[inline] +pub fn warmup_cooldown_rate_bps(epoch: Epoch, new_rate_activation_epoch: Option) -> u64 { + if epoch < new_rate_activation_epoch.unwrap_or(u64::MAX) { + ORIGINAL_WARMUP_COOLDOWN_RATE_BPS + } else { + TOWER_WARMUP_COOLDOWN_RATE_BPS + } +} + +/// Calculates the potentially rate-limited stake warmup for a single account in the current epoch. +/// +/// This function allocates a share of the cluster's per-epoch activation allowance +/// proportional to the account's share of the previous epoch's total activating stake. +pub fn calculate_activation_allowance( + current_epoch: Epoch, + account_activating_stake: u64, + prev_epoch_cluster_state: &StakeHistoryEntry, + new_rate_activation_epoch: Option, +) -> u64 { + rate_limited_stake_change( + current_epoch, + account_activating_stake, + prev_epoch_cluster_state.activating, + prev_epoch_cluster_state.effective, + new_rate_activation_epoch, + ) +} + +/// Calculates the potentially rate-limited stake cooldown for a single account in the current epoch. +/// +/// This function allocates a share of the cluster's per-epoch deactivation allowance +/// proportional to the account's share of the previous epoch's total deactivating stake. +pub fn calculate_deactivation_allowance( + current_epoch: Epoch, + account_deactivating_stake: u64, + prev_epoch_cluster_state: &StakeHistoryEntry, + new_rate_activation_epoch: Option, +) -> u64 { + rate_limited_stake_change( + current_epoch, + account_deactivating_stake, + prev_epoch_cluster_state.deactivating, + prev_epoch_cluster_state.effective, + new_rate_activation_epoch, + ) +} + +/// Internal helper for the rate-limited stake change calculation. +fn rate_limited_stake_change( + epoch: Epoch, + account_portion: u64, + cluster_portion: u64, + cluster_effective: u64, + new_rate_activation_epoch: Option, +) -> u64 { + // Early return if there's no stake to change (also prevents divide by zero) + if account_portion == 0 || cluster_portion == 0 || cluster_effective == 0 { + return 0; + } + + let rate_bps = warmup_cooldown_rate_bps(epoch, new_rate_activation_epoch); + + // Calculate this account's proportional share of the network-wide stake change allowance for the epoch. + // Formula: `change = (account_portion / cluster_portion) * (cluster_effective * rate)` + // Where: + // - `(account_portion / cluster_portion)` is this account's share of the pool. + // - `(cluster_effective * rate)` is the total network allowance for change this epoch. + // + // Re-arranged formula to maximize precision: + // `change = (account_portion * cluster_effective * rate_bps) / (cluster_portion * BASIS_POINTS_PER_UNIT)` + // + // Using `u128` for the intermediate calculations to prevent overflow. + // If the multiplication would overflow, we saturate to u128::MAX. This ensures + // that even in extreme edge cases, the rate-limiting invariant is maintained + // (fail-safe) rather than bypassing rate limits entirely (fail-open). + let numerator = (account_portion as u128) + .saturating_mul(cluster_effective as u128) + .saturating_mul(rate_bps as u128); + let denominator = (cluster_portion as u128).saturating_mul(BASIS_POINTS_PER_UNIT as u128); + + // Safe unwrap as denominator cannot be zero due to early return guards above + let delta = numerator.checked_div(denominator).unwrap(); + // The calculated delta can be larger than `account_portion` if the network's stake change + // allowance is greater than the total stake waiting to change. In this case, the account's + // entire portion is allowed to change. + delta.min(account_portion as u128) as u64 +} + +#[cfg(test)] +mod test { + #[allow(deprecated)] + use crate::state::{DEFAULT_WARMUP_COOLDOWN_RATE, NEW_WARMUP_COOLDOWN_RATE}; + use {super::*, crate::ulp::max_ulp_tolerance, proptest::prelude::*, std::ops::Div}; + + // === Rate selector === + + #[test] + fn rate_bps_before_activation_epoch_uses_prev_rate() { + let epoch = 9; + let new_rate_activation_epoch = Some(10); + let bps = warmup_cooldown_rate_bps(epoch, new_rate_activation_epoch); + assert_eq!(bps, ORIGINAL_WARMUP_COOLDOWN_RATE_BPS); + } + + #[test] + fn rate_bps_at_or_after_activation_epoch_uses_curr_rate() { + let epoch = 10; + let new_rate_activation_epoch = Some(10); + assert_eq!( + warmup_cooldown_rate_bps(epoch, new_rate_activation_epoch), + TOWER_WARMUP_COOLDOWN_RATE_BPS + ); + let epoch2 = 11; + assert_eq!( + warmup_cooldown_rate_bps(epoch2, new_rate_activation_epoch), + TOWER_WARMUP_COOLDOWN_RATE_BPS + ); + } + + #[test] + fn rate_bps_none_activation_epoch_behaves_like_prev_rate() { + let epoch = 123; + let bps = warmup_cooldown_rate_bps(epoch, None); + assert_eq!(bps, ORIGINAL_WARMUP_COOLDOWN_RATE_BPS); + } + + // === Activation allowance === + + #[test] + fn activation_zero_cases_return_zero() { + // account_portion == 0 + let prev = StakeHistoryEntry { + activating: 10, + effective: 100, + ..Default::default() + }; + assert_eq!(calculate_activation_allowance(0, 0, &prev, Some(0)), 0); + + // cluster_portion == 0 + let prev = StakeHistoryEntry { + activating: 0, + effective: 100, + ..Default::default() + }; + assert_eq!(calculate_activation_allowance(0, 5, &prev, Some(0)), 0); + + // cluster_effective == 0 + let prev = StakeHistoryEntry { + activating: 10, + effective: 0, + ..Default::default() + }; + assert_eq!(calculate_activation_allowance(0, 5, &prev, Some(0)), 0); + } + + #[test] + fn activation_basic_proportional_prev_rate() { + // cluster_effective = 1000, prev rate = 1/4 => total allowance = 250 + // account share = 100 / 500 -> 1/5 => expected 50 + let current_epoch = 99; + let new_rate_activation_epoch = Some(100); + let prev = StakeHistoryEntry { + activating: 500, + effective: 1000, + ..Default::default() + }; + let result = + calculate_activation_allowance(current_epoch, 100, &prev, new_rate_activation_epoch); + assert_eq!(result, 50); + } + + #[test] + fn activation_caps_at_account_portion_when_network_allowance_is_large() { + // total network allowance enormous relative to waiting stake, should cap to account_portion. + let current_epoch = 99; + let new_rate_activation_epoch = Some(100); // prev rate (1/4) + let prev = StakeHistoryEntry { + activating: 100, // cluster_portion + effective: 1_000_000, // large cluster effective + ..Default::default() + }; + let account_portion = 40; + let result = calculate_activation_allowance( + current_epoch, + account_portion, + &prev, + new_rate_activation_epoch, + ); + assert_eq!(result, account_portion); + } + + #[test] + fn activation_overflow_scenario_still_rate_limits() { + // Extreme scenario where a single account holding nearly the total supply + // and tries to activate everything at once. Asserting rate limiting is maintained. + let supply_lamports: u64 = 400_000_000_000_000_000; // 400M SOL + let account_portion = supply_lamports; + let prev = StakeHistoryEntry { + activating: supply_lamports, + effective: supply_lamports, + ..Default::default() + }; + + let actual_result = calculate_activation_allowance( + 100, + account_portion, + &prev, + None, // forces 25% rate + ); + + // Verify overflow actually occurs in this scenario + let rate_bps = ORIGINAL_WARMUP_COOLDOWN_RATE_BPS; + let would_overflow = (account_portion as u128) + .checked_mul(supply_lamports as u128) + .and_then(|n| n.checked_mul(rate_bps as u128)) + .is_none(); + assert!(would_overflow); + + // The ideal result (with infinite precision) is 25% of the stake. + // 400M * 0.25 = 100M + let ideal_allowance = supply_lamports / 4; + + // With saturation fix: + // Numerator saturates to u128::MAX (≈ 3.4e38) + let numerator = (account_portion as u128) + .saturating_mul(supply_lamports as u128) + .saturating_mul(rate_bps as u128); + assert_eq!(numerator, u128::MAX); + + // Denominator = 4e17 * 10,000 = 4e21 + let denominator = (supply_lamports as u128).saturating_mul(BASIS_POINTS_PER_UNIT as u128); + assert_eq!(denominator, 4_000_000_000_000_000_000_000); + + // Result = u128::MAX / 4e21 ≈ 8.5e16 (~85M SOL) + // 85M is ~21.25% of the stake (fail-safe) + // If we allowed unlocking the full account portion it would have been 100% (fail-open) + let expected_result = numerator.div(denominator).min(account_portion as u128) as u64; + assert_eq!(expected_result, 85_070_591_730_234_615); + + // Assert actual result is expected + assert_eq!(actual_result, expected_result); + assert!(actual_result < account_portion); + assert!(actual_result <= ideal_allowance); + } + + // === Cooldown allowance === + + #[test] + fn cooldown_zero_cases_return_zero() { + // account_portion == 0 + let prev = StakeHistoryEntry { + deactivating: 10, + effective: 100, + ..Default::default() + }; + assert_eq!(calculate_deactivation_allowance(0, 0, &prev, Some(0)), 0); + + // cluster_portion == 0 + let prev = StakeHistoryEntry { + deactivating: 0, + effective: 100, + ..Default::default() + }; + assert_eq!(calculate_deactivation_allowance(0, 5, &prev, Some(0)), 0); + + // cluster_effective == 0 + let prev = StakeHistoryEntry { + deactivating: 10, + effective: 0, + ..Default::default() + }; + assert_eq!(calculate_deactivation_allowance(0, 5, &prev, Some(0)), 0); + } + + #[test] + fn cooldown_basic_proportional_curr_rate() { + // cluster_effective = 10_000, curr rate = 9/100 => total allowance = 900 + // account share = 200 / 1000 => expected 180 + let current_epoch = 5; + let new_rate_activation_epoch = Some(5); // current (epoch >= activation) + let prev = StakeHistoryEntry { + deactivating: 1000, + effective: 10_000, + ..Default::default() + }; + let result = + calculate_deactivation_allowance(current_epoch, 200, &prev, new_rate_activation_epoch); + assert_eq!(result, 180); + } + + #[test] + fn cooldown_caps_at_account_portion_when_network_allowance_is_large() { + let current_epoch = 0; + let new_rate_activation_epoch = None; // uses prev (1/4) + let prev = StakeHistoryEntry { + deactivating: 100, + effective: 1_000_000, + ..Default::default() + }; + let account_portion = 70; + let result = calculate_deactivation_allowance( + current_epoch, + account_portion, + &prev, + new_rate_activation_epoch, + ); + assert_eq!(result, account_portion); + } + + // === Symmetry & integer rounding === + + #[test] + fn activation_and_cooldown_are_symmetric_given_same_inputs() { + // With equal cluster_portions and same epoch/rate, the math should match. + let epoch = 42; + let new_rate_activation_epoch = Some(1_000); // prev rate for both calls + let prev = StakeHistoryEntry { + activating: 1_000, + deactivating: 1_000, + effective: 5_000, + }; + let account = 333; + let act = calculate_activation_allowance(epoch, account, &prev, new_rate_activation_epoch); + let cool = + calculate_deactivation_allowance(epoch, account, &prev, new_rate_activation_epoch); + assert_eq!(act, cool); + } + + #[test] + fn integer_division_truncation_matches_expected() { + // Float math would yield 90.009, integer math must truncate to 90 + let account_portion = 100; + let cluster_portion = 1000; + let cluster_effective = 10001; + let epoch = 20; + let new_rate_activation_epoch = Some(10); // current 9/100 + + let result = rate_limited_stake_change( + epoch, + account_portion, + cluster_portion, + cluster_effective, + new_rate_activation_epoch, + ); + assert_eq!(result, 90); + } + + // === Property tests: compare the integer refactor vs legacy `f64` === + + #[allow(deprecated)] + fn legacy_warmup_cooldown_rate( + current_epoch: Epoch, + new_rate_activation_epoch: Option, + ) -> f64 { + if current_epoch < new_rate_activation_epoch.unwrap_or(u64::MAX) { + DEFAULT_WARMUP_COOLDOWN_RATE + } else { + NEW_WARMUP_COOLDOWN_RATE + } + } + + // The original formula used prior to integer implementation + fn calculate_stake_delta_f64_legacy( + account_portion: u64, + cluster_portion: u64, + cluster_effective: u64, + current_epoch: Epoch, + new_rate_activation_epoch: Option, + ) -> u64 { + if cluster_portion == 0 || account_portion == 0 || cluster_effective == 0 { + return 0; + } + let weight = account_portion as f64 / cluster_portion as f64; + let rate = legacy_warmup_cooldown_rate(current_epoch, new_rate_activation_epoch); + let newly_effective_cluster_stake = cluster_effective as f64 * rate; + (weight * newly_effective_cluster_stake) as u64 + } + + proptest! { + #![proptest_config(ProptestConfig::with_cases(10_000))] + + #[test] + fn rate_limited_change_consistent_with_legacy( + account_portion in 0u64..=u64::MAX, + cluster_portion in 0u64..=u64::MAX, + cluster_effective in 0u64..=u64::MAX, + current_epoch in 0u64..=2000, + new_rate_activation_epoch_option in prop::option::of(0u64..=2000), + ) { + let integer_math_result = rate_limited_stake_change( + current_epoch, + account_portion, + cluster_portion, + cluster_effective, + new_rate_activation_epoch_option, + ); + + let float_math_result = calculate_stake_delta_f64_legacy( + account_portion, + cluster_portion, + cluster_effective, + current_epoch, + new_rate_activation_epoch_option, + ).min(account_portion); + + let rate_bps = + warmup_cooldown_rate_bps(current_epoch, new_rate_activation_epoch_option); + + // See if the u128 product would overflow: account * effective * rate_bps + let would_overflow = (account_portion as u128) + .checked_mul(cluster_effective as u128) + .and_then(|n| n.checked_mul(rate_bps as u128)) + .is_none(); + + if account_portion == 0 || cluster_portion == 0 || cluster_effective == 0 { + prop_assert_eq!(integer_math_result, 0); + prop_assert_eq!(float_math_result, 0); + } else if would_overflow { + // In the overflow path, the numerator is `u128::MAX` and is divided then clamped to + // `account_portion`. This math often results in less than `account_portion`, but + // never should exceed it. It may be equal in the case the denominator is small and + // post-division result gets clamped. + prop_assert!(integer_math_result <= account_portion); + } else { + prop_assert!(integer_math_result <= account_portion); + prop_assert!(float_math_result <= account_portion); + + let diff = integer_math_result.abs_diff(float_math_result); + let tolerance = max_ulp_tolerance(integer_math_result, float_math_result); + prop_assert!( + diff <= tolerance, + "Test failed: candidate={}, oracle={}, diff={}, tolerance={}", + integer_math_result, float_math_result, diff, tolerance + ); + } + } + } +} diff --git a/program/Cargo.toml b/program/Cargo.toml index f36e915c..de854fa8 100644 --- a/program/Cargo.toml +++ b/program/Cargo.toml @@ -19,7 +19,7 @@ solana-program-entrypoint = "3.0.0" solana-program-error = "3.0.0" solana-pubkey = "4.1.0" solana-rent = "4.1.0" -solana-stake-interface = { version = "3.0.0", features = ["bincode", "borsh", "sysvar"] } +solana-stake-interface = { path = "../interface", version = "3.0.0", features = ["bincode", "borsh", "sysvar"] } solana-sysvar = "4.0.0" solana-sysvar-id = "3.1.0" solana-vote-interface = { version = "5.1.1", features = ["bincode"] } diff --git a/program/src/helpers/merge.rs b/program/src/helpers/merge.rs index 6228379d..0d0daad2 100644 --- a/program/src/helpers/merge.rs +++ b/program/src/helpers/merge.rs @@ -43,7 +43,7 @@ impl MergeKind { StakeStateV2::Stake(meta, stake, stake_flags) => { // stake must not be in a transient state. Transient here meaning // activating or deactivating with non-zero effective stake. - let status = stake.delegation.stake_activating_and_deactivating( + let status = stake.delegation.stake_activating_and_deactivating_v2( clock.epoch, stake_history, PERPETUAL_NEW_WARMUP_COOLDOWN_RATE_EPOCH, @@ -237,7 +237,10 @@ mod tests { solana_account::{state_traits::StateMut, AccountSharedData, ReadableAccount}, solana_pubkey::Pubkey, solana_rent::Rent, - solana_stake_interface::stake_history::{StakeHistory, StakeHistoryEntry}, + solana_stake_interface::{ + stake_history::{StakeHistory, StakeHistoryEntry}, + warmup_cooldown_allowance::warmup_cooldown_rate_bps, + }, }; #[test] @@ -532,10 +535,9 @@ mod tests { // all paritially activated, transient epochs fail loop { clock.epoch += 1; - let delta = activating.min( - (effective as f64 * warmup_cooldown_rate(clock.epoch, new_rate_activation_epoch)) - as u64, - ); + let rate_bps = warmup_cooldown_rate_bps(clock.epoch, new_rate_activation_epoch); + let rate_limited = ((effective as u128) * rate_bps as u128 / 10_000) as u64; + let delta = activating.min(rate_limited); effective += delta; activating -= delta; stake_history.add( @@ -609,10 +611,9 @@ mod tests { // all transient, deactivating epochs fail loop { clock.epoch += 1; - let delta = deactivating.min( - (effective as f64 * warmup_cooldown_rate(clock.epoch, new_rate_activation_epoch)) - as u64, - ); + let rate_bps = warmup_cooldown_rate_bps(clock.epoch, new_rate_activation_epoch); + let rate_limited = ((effective as u128) * rate_bps as u128 / 10_000) as u64; + let delta = deactivating.min(rate_limited); effective -= delta; deactivating -= delta; stake_history.add( diff --git a/program/src/processor.rs b/program/src/processor.rs index a5599b4c..0808cc57 100644 --- a/program/src/processor.rs +++ b/program/src/processor.rs @@ -443,7 +443,7 @@ impl Processor { validate_delegated_amount(stake_account_info, rent_exempt_reserve)?; // Get current activation status at this epoch - let effective_stake = stake.delegation.stake( + let effective_stake = stake.delegation.stake_v2( clock.epoch, stake_history, PERPETUAL_NEW_WARMUP_COOLDOWN_RATE_EPOCH, @@ -535,11 +535,13 @@ impl Processor { .check(&signers, StakeAuthorize::Staker) .map_err(to_program_error)?; - let source_status = source_stake.delegation.stake_activating_and_deactivating( - clock.epoch, - stake_history, - PERPETUAL_NEW_WARMUP_COOLDOWN_RATE_EPOCH, - ); + let source_status = source_stake + .delegation + .stake_activating_and_deactivating_v2( + clock.epoch, + stake_history, + PERPETUAL_NEW_WARMUP_COOLDOWN_RATE_EPOCH, + ); let is_active_or_activating = source_status.effective > 0 || source_status.activating > 0; @@ -763,7 +765,7 @@ impl Processor { .map_err(to_program_error)?; // if we have a deactivation epoch and we're in cooldown let staked = if clock.epoch >= stake.delegation.deactivation_epoch { - stake.delegation.stake( + stake.delegation.stake_v2( clock.epoch, stake_history, PERPETUAL_NEW_WARMUP_COOLDOWN_RATE_EPOCH, diff --git a/program/tests/interface.rs b/program/tests/interface.rs index 6ba865ff..20116f3a 100644 --- a/program/tests/interface.rs +++ b/program/tests/interface.rs @@ -17,10 +17,8 @@ use { instruction::{self, LockupArgs}, stake_flags::StakeFlags, stake_history::{StakeHistory, StakeHistoryEntry}, - state::{ - warmup_cooldown_rate, Authorized, Delegation, Lockup, Meta, Stake, StakeAuthorize, - StakeStateV2, NEW_WARMUP_COOLDOWN_RATE, - }, + state::{Authorized, Delegation, Lockup, Meta, Stake, StakeAuthorize, StakeStateV2}, + warmup_cooldown_allowance::warmup_cooldown_rate_bps, }, solana_stake_program::{get_minimum_delegation, id}, solana_svm_log_collector::LogCollector, @@ -102,10 +100,6 @@ const CUSTODIAN_RIGHT: Pubkey = // while also making it easy to write tests involving partial (de)activations // if the warmup/cooldown rate changes, this number must be adjusted const PERSISTENT_ACTIVE_STAKE: u64 = 100 * LAMPORTS_PER_SOL; -#[test] -fn assert_warmup_cooldown_rate() { - assert_eq!(warmup_cooldown_rate(0, Some(0)), NEW_WARMUP_COOLDOWN_RATE); -} // this mirrors the false const for `Meta.rent_exempt_reserve` in the stake program // the stake program uses true `Rent` unconditionally but maintains this field for compatibility @@ -163,8 +157,9 @@ impl Env { assert_eq!(mollusk.sysvars.clock.epoch, EXECUTION_EPOCH); // backfill stake history + let rate_bps = warmup_cooldown_rate_bps(0, Some(0)); let stake_delta_amount = - (PERSISTENT_ACTIVE_STAKE as f64 * NEW_WARMUP_COOLDOWN_RATE).floor() as u64; + ((PERSISTENT_ACTIVE_STAKE as u128 * rate_bps as u128) / 10_000) as u64; for epoch in 0..EXECUTION_EPOCH { mollusk.sysvars.stake_history.add( epoch, diff --git a/program/tests/program_test.rs b/program/tests/program_test.rs index 0a8d645e..d8d8a153 100644 --- a/program/tests/program_test.rs +++ b/program/tests/program_test.rs @@ -202,7 +202,7 @@ pub async fn get_effective_stake(banks_client: &mut BanksClient, pubkey: &Pubkey StakeStateV2::Stake(_, stake, _) => { stake .delegation - .stake_activating_and_deactivating(clock.epoch, &stake_history, Some(0)) + .stake_activating_and_deactivating_v2(clock.epoch, &stake_history, Some(0)) .effective } _ => 0, diff --git a/program/tests/stake_instruction.rs b/program/tests/stake_instruction.rs index b1bd4c11..59d77ddb 100644 --- a/program/tests/stake_instruction.rs +++ b/program/tests/stake_instruction.rs @@ -27,10 +27,8 @@ use { }, stake_flags::StakeFlags, stake_history::{StakeHistory, StakeHistoryEntry}, - state::{ - warmup_cooldown_rate, Authorized, Delegation, Lockup, Meta, Stake, StakeAuthorize, - StakeStateV2, - }, + state::{Authorized, Delegation, Lockup, Meta, Stake, StakeAuthorize, StakeStateV2}, + warmup_cooldown_allowance::warmup_cooldown_rate_bps, MINIMUM_DELINQUENT_EPOCHS_FOR_DEACTIVATION, }, solana_stake_program::{get_minimum_delegation, id}, @@ -234,7 +232,7 @@ fn get_active_stake_for_tests( let mut active_stake = 0; for account in stake_accounts { if let Ok(StakeStateV2::Stake(_meta, stake, _stake_flags)) = account.state() { - let stake_status = stake.delegation.stake_activating_and_deactivating( + let stake_status = stake.delegation.stake_activating_and_deactivating_v2( clock.epoch, stake_history, None, @@ -263,7 +261,7 @@ where I: Iterator, { stakes.fold(StakeHistoryEntry::default(), |sum, stake| { - sum + stake.stake_activating_and_deactivating(epoch, history, new_rate_activation_epoch) + sum + stake.stake_activating_and_deactivating_v2(epoch, history, new_rate_activation_epoch) }) } @@ -6365,10 +6363,9 @@ fn test_merge_active_stake() { if clock.epoch == merge_from_activation_epoch { activating += merge_from_amount; } - let delta = activating.min( - (effective as f64 * warmup_cooldown_rate(clock.epoch, new_warmup_cooldown_rate_epoch)) - as u64, - ); + let rate_bps = warmup_cooldown_rate_bps(clock.epoch, new_warmup_cooldown_rate_epoch); + let rate_limited = ((effective as u128) * rate_bps as u128 / 10_000) as u64; + let delta = activating.min(rate_limited); effective += delta; activating -= delta; stake_history.add( @@ -6384,9 +6381,10 @@ fn test_merge_active_stake() { StakeHistory::id(), create_account_shared_data_for_test(&stake_history), ); - if stake_amount == stake.stake(clock.epoch, &stake_history, new_warmup_cooldown_rate_epoch) + if stake_amount + == stake.stake_v2(clock.epoch, &stake_history, new_warmup_cooldown_rate_epoch) && merge_from_amount - == merge_from_stake.stake( + == merge_from_stake.stake_v2( clock.epoch, &stake_history, new_warmup_cooldown_rate_epoch, @@ -6417,10 +6415,9 @@ fn test_merge_active_stake() { // active/deactivating and deactivating/inactive mismatches fail loop { clock.epoch += 1; - let delta = deactivating.min( - (effective as f64 * warmup_cooldown_rate(clock.epoch, new_warmup_cooldown_rate_epoch)) - as u64, - ); + let rate_bps = warmup_cooldown_rate_bps(clock.epoch, new_warmup_cooldown_rate_epoch); + let rate_limited = ((effective as u128) * rate_bps as u128 / 10_000) as u64; + let delta = deactivating.min(rate_limited); effective -= delta; deactivating -= delta; if clock.epoch == stake_deactivation_epoch { @@ -6468,8 +6465,8 @@ fn test_merge_active_stake() { StakeHistory::id(), create_account_shared_data_for_test(&stake_history), ); - if 0 == stake.stake(clock.epoch, &stake_history, new_warmup_cooldown_rate_epoch) - && 0 == merge_from_stake.stake( + if 0 == stake.stake_v2(clock.epoch, &stake_history, new_warmup_cooldown_rate_epoch) + && 0 == merge_from_stake.stake_v2( clock.epoch, &stake_history, new_warmup_cooldown_rate_epoch, diff --git a/scripts/solana.dic b/scripts/solana.dic index 6c0dd4f2..70c0df24 100644 --- a/scripts/solana.dic +++ b/scripts/solana.dic @@ -15,6 +15,7 @@ pubkeys redelegate redelegated redelegation +representable rpc staker struct